| (2020)24LittleHours[ING].srt |
104.304 |
22.08.2021 15:19:40 +00:00 |
| 03 - Holy Ghost.srt |
40.758 |
28.03.2024 06:26:34 +00:00 |
| 04 - A History Of Violence.srt |
45.270 |
3.04.2024 04:37:16 +00:00 |
| 05-22_21-00-09_RTL Klub HD (hun)_Alul-felül semmi.srt |
63.472 |
7.06.2021 22:34:26 +00:00 |
| 1.interrogation.(8256395).nfo |
6.437 |
16.09.2021 19:56:04 +00:00 |
| 1.Interrogation.2020.HDRip.XviD.AC3-EVO-HI.srt |
117.088 |
16.09.2021 22:56:00 +00:00 |
| 1.srt |
93.935 |
28.01.2023 10:48:42 +00:00 |
| 10.things.we.should.do.before.we.(8101295).nfo |
6.354 |
18.09.2021 15:47:38 +00:00 |
| 10.Things.We.Should.Do.Before.We.Break.Up.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
88.715 |
18.09.2021 18:47:20 +00:00 |
| 100.acres.of.hell.(7928569).nfo |
6.520 |
23.09.2021 21:52:24 +00:00 |
| 100.acres.of.hell.(9752756).nfo |
6.437 |
1.11.2023 14:42:46 +00:00 |
| 100.Acres.Of.Hell.2019.720p.WEBRip.x264-.YTS.LT.srt |
58.181 |
24.09.2021 00:51:27 +00:00 |
| 100.Percent.Wolf.2020.1080p.BluRay.H264.AAC-RARBG.srt |
95.917 |
2.09.2021 04:35:48 +00:00 |
| 100.wolf.(8668001).nfo |
6.271 |
2.09.2021 01:36:12 +00:00 |
| 18.presents.(8229392).nfo |
6.438 |
13.09.2021 05:17:08 +00:00 |
| 18.Presents.2020.ITALIAN.1080p.WEBRip.x264-VXT.srt |
94.338 |
13.09.2021 08:16:27 +00:00 |
| 2.graves.in.the.desert.(8116213).nfo |
6.437 |
6.09.2021 15:52:42 +00:00 |
| 2.Graves.In.The.Desert.2020.720p.BluRay.x264.AAC-.YTS.MX.srt |
63.013 |
6.09.2021 18:51:45 +00:00 |
| 2.minutes.of.fame.(8248470).nfo |
6.354 |
19.09.2021 06:07:58 +00:00 |
| 2.Minutes.Of.Fame.2020.HDRip.XviD.AC3-EVO.srt |
168.656 |
19.09.2021 09:07:35 +00:00 |
| 2019_Born in Evin.deu.srt |
92.407 |
15.03.2023 10:46:02 +00:00 |
| 2019_Die Heinzels - Rückkehr der Heinzelmännchen.deu.srt |
158.145 |
15.02.2023 02:14:22 +00:00 |
| 24.little.hours.(8230439).nfo |
6.520 |
22.08.2021 12:19:50 +00:00 |
| 2x01.srt |
36.979 |
18.08.2021 06:34:35 +00:00 |
| 3022.(7989132).nfo |
6.520 |
13.07.2023 14:37:40 +00:00 |
| 3022.2019.HDRip.XviD.AC3-EVO-HI.srt |
83.629 |
13.07.2023 17:37:40 +00:00 |
| 365 Days (2020) - forumiptv 49.srt |
55.636 |
18.08.2021 19:57:32 +00:00 |
| 365.days.(8318432).nfo |
6.271 |
18.08.2021 16:58:14 +00:00 |
| 37.teen.(8057504).nfo |
6.354 |
22.09.2021 18:48:32 +00:00 |
| 37.Teen.2019.720p.WEBRip.800MB.x264-GalaxyRG.srt |
130.211 |
22.09.2021 21:47:44 +00:00 |
| 40.the.temptation.of.christ.(8163087).nfo |
6.520 |
2.09.2021 01:36:00 +00:00 |
| 40.The.Temptation.Of.Christ.2020.HDRip.XviD.AC3-EVO-HI.srt |
60.338 |
2.09.2021 04:35:36 +00:00 |
| 47.hours.to.live.(8137260).nfo |
6.437 |
23.09.2021 08:19:12 +00:00 |
| 47.Hours.To.Live.2019.720p.WEBRip.800MB.x264-GalaxyRG.srt |
93.290 |
23.09.2021 11:18:19 +00:00 |
| 5g.zombies.(8769560).nfo |
6.437 |
14.09.2021 23:23:38 +00:00 |
| 5G.Zombies.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
94.465 |
15.09.2021 02:22:43 +00:00 |
| 5_Spanish.srt |
103.260 |
23.06.2023 05:57:59 +00:00 |
| 7.days.to.vegas.(8541320).nfo |
6.354 |
23.09.2021 08:18:50 +00:00 |
| 7.Days.To.Vegas.2019.720p.WEBRip.800MB.x264-GalaxyRG.srt |
86.500 |
23.09.2021 11:17:58 +00:00 |
| 8.A.South.African.Horror.Story.2019.720p.WEBRip.800MB.x264-GalaxyRG.srt |
54.115 |
28.08.2021 15:58:18 +00:00 |
| 8.slices.(8164819).nfo |
6.437 |
21.08.2021 09:48:14 +00:00 |
| 8.Slices.2019.HDRip.XviD.AC3-EVO.srt |
119.452 |
21.08.2021 12:48:13 +00:00 |
| 8_Japanese.srt |
115.435 |
21.08.2021 05:21:54 +00:00 |
| 9.songs.(4147687).nfo |
6.354 |
27.07.2022 19:49:58 +00:00 |
| 9.Songs.LiMiTED.DVDRip. XviD-DMT-TR.srt |
35.460 |
27.07.2022 22:49:58 +00:00 |
| A Christmas Movie Christmas (2019) 720p HDTV X264 Solar.srt |
63.684 |
24.09.2021 14:40:02 +00:00 |
| A Guide To Second Date Sex (2019) WEBRip 720p YTS .YIFY.srt |
94.410 |
23.09.2021 11:18:13 +00:00 |
| a.christmas.movie.christmas.(7987560).nfo |
6.437 |
24.09.2021 11:40:02 +00:00 |
| a.clear.shot.(8251837).nfo |
6.437 |
10.09.2021 05:03:28 +00:00 |
| A.Clear.Shot.2019.720p.AMZN.WEBRip.800MB.x264-GalaxyRG.srt |
64.268 |
10.09.2021 08:03:08 +00:00 |
| a.dark.path.(8349931).nfo |
6.437 |
8.09.2021 20:04:02 +00:00 |
| A.Dark.Path.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
43.723 |
8.09.2021 23:03:52 +00:00 |
| A.Dog's.Journey.2019.1080p.BluRay.x264-.YTS.LT.srt |
136.777 |
26.09.2021 08:43:56 +00:00 |
| a.dog.s.journey.(7875771).nfo |
6.354 |
26.09.2021 05:44:10 +00:00 |
| a.guide.to.second.date.sex.(7956802).nfo |
6.354 |
23.09.2021 08:19:06 +00:00 |
| A.Hospedeira.2020.1080p.WEB-DL.x264.DUAL.srt |
88.576 |
18.02.2024 02:45:16 +00:00 |
| a.little.sex.(8086776).nfo |
6.354 |
24.06.2022 13:35:40 +00:00 |
| A.Little.Sex.1982.1080p.WEBRip.x264-RARBG.srt |
94.464 |
24.06.2022 16:35:41 +00:00 |
| a.nice.girl.like.you.(8288154).nfo |
6.437 |
3.09.2021 02:27:32 +00:00 |
| A.Nice.Girl.Like.You.2020.HDRip.XviD.AC3-EVO.srt |
121.139 |
3.09.2021 05:27:02 +00:00 |
| a.night.of.horror.nightmare.(8334761).nfo |
6.437 |
20.09.2021 11:38:58 +00:00 |
| A.Night.Of.Horror.Nightmare.Radio.2019.720p.WEBRip.x264.AAC-[YTS.MX].srt |
49.667 |
20.09.2021 14:38:27 +00:00 |
| a.nun.s.curse.(8209449).nfo |
6.437 |
16.09.2021 19:59:18 +00:00 |
| A.Nuns.Curse.2020.HDRip.XviD.AC3-EVO.srt |
48.356 |
16.09.2021 22:59:15 +00:00 |
| a.perfect.host.(8233804).nfo |
6.437 |
13.09.2021 05:18:10 +00:00 |
| a.perfect.plan.(8192195).nfo |
6.520 |
1.09.2021 11:41:52 +00:00 |
| A.Perfect.Plan.2020.HDRip.XviD.AC3-EVO-HI.srt |
75.689 |
1.09.2021 14:41:32 +00:00 |
| a.piece.of.cake.(9375293).nfo |
6.354 |
14.02.2023 23:14:22 +00:00 |
| a.predator.s.obsession.(8144390).nfo |
6.354 |
19.08.2021 09:21:32 +00:00 |
| a.predators.obsession.2020.720p.hdtv.x264-w4f.srt |
82.543 |
19.08.2021 12:20:45 +00:00 |
| a.rainy.day.in.new.york.(8219570).nfo |
6.354 |
24.09.2021 11:41:44 +00:00 |
| A.Rainy.Day.in.New.York.2019.1080p.BluRay.REMUX.AVC.DTS-HD.MA.5.1-FGT.srt |
144.885 |
24.09.2021 14:41:45 +00:00 |
| a.rebel.born.(8159315).nfo |
6.520 |
26.08.2021 23:21:38 +00:00 |
| A.Rebel.Born.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
61.609 |
27.08.2021 02:20:58 +00:00 |
| A.Serial.Killer's.Guide.To.Life.2019.720p.WEBRip.x264-[YTS.LT].srt |
40.770 |
3.09.2021 18:03:55 +00:00 |
| a.serial.killer.s.guide.to.life.(8218623).nfo |
6.354 |
3.09.2021 15:04:30 +00:00 |
| a.shaun.the.sheep.movie.(8093160).nfo |
6.520 |
19.08.2023 09:08:28 +00:00 |
| A.Shaun.the.Sheep.Movie.Farmageddon.2019.720p.BluRay.X264-AMIABLE.srt |
12.021 |
19.08.2023 12:08:29 +00:00 |
| a.soldier.s.revenge.(8244636).nfo |
6.437 |
10.09.2021 15:30:34 +00:00 |
| A.Soldiers.Revenge.2020.DVDRip.x264-CMRG.srt |
106.978 |
10.09.2021 18:30:11 +00:00 |
| a.thousand.miles.behind.(8240622).nfo |
6.437 |
3.09.2021 02:28:08 +00:00 |
| a.thousand.miles.behind.(8809303).nfo |
6.271 |
16.10.2021 10:06:50 +00:00 |
| A.Thousand.Miles.Behind.2019.1080p.WEBRip.x264.srt |
35.677 |
16.10.2021 13:06:37 +00:00 |
| A.Thousand.Miles.Behind.2020.HDRip.XviD.AC3-EVO.srt |
34.856 |
3.09.2021 05:27:37 +00:00 |
| a.thread.of.deceit.the.hart.(8333269).nfo |
6.437 |
8.09.2021 20:04:40 +00:00 |
| A.Thread.of.Deceit.The.Hart.Family.2020.1080p.WEB-DL.AAC2.0.H264-MVL.srt |
83.626 |
8.09.2021 23:04:31 +00:00 |
| a.wakefield.project.(8115365).nfo |
6.438 |
23.09.2021 08:19:36 +00:00 |
| A.Wakefield.Project.2019.720p.WEBRip.800MB.x264-GalaxyRG.srt |
65.829 |
23.09.2021 11:18:43 +00:00 |
| a.whisker.away.(8251274).nfo |
6.437 |
2.09.2021 01:35:24 +00:00 |
| A.Whisker.Away.2020.JAPANESE.1080p.NF.WEBRip.DDP5.1.x264-NTG.srt |
103.273 |
2.09.2021 04:35:00 +00:00 |
| A.World.of.Calm.S01E01.The.Coral.City.1080p.HMAX.WEB-DL.DD5.1.H.264-NTb.srt |
7.300 |
28.03.2024 13:19:34 +00:00 |
| a.world.of.calm.the.coral.city.(8372382).nfo |
6.437 |
28.03.2024 13:19:34 +00:00 |
| abducted.(8542720).nfo |
6.437 |
20.09.2021 11:39:24 +00:00 |
| abominable.(8171119).nfo |
6.520 |
11.09.2021 21:59:24 +00:00 |
| Abominable.2019.HDRip.XviD.AC3-EVO.srt |
40.445 |
12.09.2021 00:58:51 +00:00 |
| above.suspicion.(8646185).nfo |
6.271 |
12.07.2023 19:41:02 +00:00 |
| Above.Suspicion.2019.720p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
77.150 |
12.07.2023 22:41:03 +00:00 |
| abstruse.(8123502).nfo |
6.520 |
19.09.2021 06:07:30 +00:00 |
| Abstruse.2020.HDRip.XviD.AC3-EVO.srt |
120.541 |
19.09.2021 09:07:07 +00:00 |
| Acampamento.Maldito.2020.1080p.WEB-DL.DUAL.2.0.srt |
54.105 |
1.11.2023 17:42:46 +00:00 |
| acrylic.(8300997).nfo |
6.354 |
3.09.2021 02:27:10 +00:00 |
| Acrylic.2020.720p.WEBRip.x264.AAC-[YTS.MX].tr.srt |
113.035 |
3.09.2021 05:26:40 +00:00 |
| Ad Astra (Turkish).srt |
80.093 |
20.08.2023 13:33:09 +00:00 |
| ad.astra.(8004209).nfo |
6.437 |
20.08.2023 10:33:08 +00:00 |
| Adonis.Complex.2019.720p.WEBRip.x264.AAC-[YTS.MX].srt |
37.494 |
13.09.2021 08:17:28 +00:00 |
| adu.(8264174).nfo |
6.354 |
19.08.2021 08:43:58 +00:00 |
| Adu.2020.720p.WEB.H264-CRYPTIC-TUR.srt |
62.127 |
19.08.2021 11:43:10 +00:00 |
| adventures.of.aladdin.(7778550).nfo |
6.354 |
17.07.2023 19:39:06 +00:00 |
| Adventures.Of.Aladdin.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
53.536 |
17.07.2023 22:39:07 +00:00 |
| adventures.of.rufus.the.(8223474).nfo |
6.354 |
28.08.2021 12:59:14 +00:00 |
| Adventures.Of.Rufus.The.Fantastic.Pet.2020.HDRip.XviD.AC3-EVO.srt |
76.066 |
28.08.2021 15:58:21 +00:00 |
| after.(7818248).nfo |
6.271 |
27.07.2023 13:58:34 +00:00 |
| After.2019.1080p.WEB-DL.DD5.1.H264-FGT.srt |
61.784 |
27.07.2023 16:58:34 +00:00 |
| age.out.(7989186).nfo |
6.437 |
22.09.2021 04:49:10 +00:00 |
| Age.Out.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
49.589 |
22.09.2021 07:48:25 +00:00 |
| agent.jade.black.(8181596).nfo |
6.437 |
11.09.2021 21:59:18 +00:00 |
| Agent.Jade.Black.2019.DVDRip.XviD.AC3-EVO.srt |
75.101 |
12.09.2021 00:58:46 +00:00 |
| agent.toby.barks.(8171879).nfo |
6.437 |
3.09.2021 15:03:44 +00:00 |
| Agent.Toby.Barks.2020.HDRip.XviD.AC3-EVO.srt |
87.143 |
3.09.2021 18:03:10 +00:00 |
| Agramon's.Gate.2019.720p.WEBRip.x264.AAC-.YTS.MX.srt |
88.354 |
5.09.2023 15:49:32 +00:00 |
| agramon.s.gate.(8094467).nfo |
6.271 |
6.09.2021 15:52:46 +00:00 |
| agramon.s.gate.(8102193).nfo |
6.354 |
5.09.2023 12:49:32 +00:00 |
| Agramons.Gate.2020.1080p.WEB-DL.DD2.0.H264-EVO-HI.srt |
91.267 |
6.09.2021 18:51:50 +00:00 |
| ahs-banksyatrooa-720p.est.srt |
145.811 |
4.09.2021 14:56:40 +00:00 |
| airplane.mode.(7849746).nfo |
6.437 |
26.03.2023 15:22:26 +00:00 |
| Airplane.Mode.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
107.161 |
26.03.2023 18:22:27 +00:00 |
| aka.jane.roe.(8221192).nfo |
6.437 |
4.09.2021 11:57:32 +00:00 |
| AKA.Jane.Roe.2020.1080p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
105.510 |
4.09.2021 14:56:51 +00:00 |
| Alex Fernández El mejor comediante del mundo (2020).srt |
65.494 |
30.07.2021 17:35:58 +00:00 |
| alien.domicile.2.lot.24.(7765945).nfo |
6.437 |
22.07.2023 09:54:26 +00:00 |
| Alien.Domicile.2.Lot.24.2019.HDRip.720p-1XBET.srt |
68.683 |
22.07.2023 12:54:27 +00:00 |
| alien.outbreak.(8378490).nfo |
6.437 |
20.09.2021 11:39:38 +00:00 |
| Alien.Outbreak.2020.1080p.WEB-DL.H264.AC3-EVO.srt |
44.863 |
20.09.2021 14:39:06 +00:00 |
| alienated.(8257668).nfo |
6.354 |
29.08.2021 19:27:34 +00:00 |
| Alienated.2020.720p.AMZN.WEBRip.800MB.x264-GalaxyRG.srt |
55.812 |
29.08.2021 22:27:34 +00:00 |
| aliens.stole.my.body.(8307677).nfo |
6.354 |
4.09.2021 11:57:34 +00:00 |
| Aliens.Stole.My.Body.2020.HDRip.XviD.AC3-EVO.srt |
96.694 |
4.09.2021 14:56:54 +00:00 |
| alive.(8343745).nfo |
6.271 |
19.09.2021 20:28:12 +00:00 |
| alive.(8969548).nfo |
6.354 |
14.01.2023 10:29:16 +00:00 |
| Alive.2020.1080p.BluRay.DD+.7.1.x264-c0kE.tr.srt |
44.561 |
14.01.2023 13:29:16 +00:00 |
| All The Bright Places.srt |
65.156 |
11.09.2021 05:02:34 +00:00 |
| all.creatures.here.below.(7765214).nfo |
6.437 |
26.09.2021 05:43:36 +00:00 |
| All.Creatures.Here.Below.2018.720p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
68.942 |
26.09.2021 08:43:23 +00:00 |
| all.for.nikki.(8207384).nfo |
6.354 |
5.09.2021 19:52:44 +00:00 |
| All.For.Nikki.2020.HDRip.XviD.AC3-EVO.srt |
133.221 |
5.09.2021 22:51:54 +00:00 |
| all.the.bright.places.(8291386).nfo |
6.354 |
11.09.2021 02:03:00 +00:00 |
| all.together.now.(8331041).nfo |
6.271 |
25.08.2021 17:52:18 +00:00 |
| All.Together.Now.2020.WEBRip.x264-ION10.srt |
68.803 |
25.08.2021 20:51:46 +00:00 |
| allan.the.dog.(8258771).nfo |
6.354 |
9.09.2021 16:28:38 +00:00 |
| Allan.The.Dog.2020.HDRip.XviD.AC3-EVO.srt |
150.387 |
9.09.2021 19:28:21 +00:00 |
| almost.human.(8332162).nfo |
6.437 |
10.09.2021 15:30:10 +00:00 |
| Almost.Human.2020.CHINESE.1080p.WEBRip.AAC2.0.x264-NOGRP.srt |
85.291 |
10.09.2021 18:29:47 +00:00 |
| alone.(8359376).nfo |
6.354 |
4.09.2021 11:57:02 +00:00 |
| Alone.2020.1080p.WEB-DL.DD5.1.H264-FGT.srt |
59.747 |
4.09.2021 14:56:22 +00:00 |
| alone.wolf.(8265907).nfo |
6.354 |
6.09.2021 15:53:04 +00:00 |
| Alone.Wolf.2020.HDRip.XviD.AC3-EVO.srt |
64.223 |
6.09.2021 18:52:08 +00:00 |
| alpha.code.(8722906).nfo |
6.354 |
19.09.2021 06:07:50 +00:00 |
| Alpha.Code.2020.1080p.WEBRip.x264-RARBG-Türkçe.srt |
66.869 |
19.09.2021 09:07:28 +00:00 |
| american.driller.killer.(8484820).nfo |
6.437 |
16.09.2021 19:54:36 +00:00 |
| american.fighter.(8665103).nfo |
6.437 |
16.09.2021 19:55:46 +00:00 |
| American.Fighter.2019.720p.WEBRip.x264.AAC-[YTS.MX].srt |
83.856 |
16.09.2021 22:55:43 +00:00 |
| american.woman.(8262766).nfo |
6.520 |
25.09.2021 15:14:22 +00:00 |
| American.Woman.2020.HDRip.XviD.AC3-EVO.srt |
65.959 |
25.09.2021 18:14:13 +00:00 |
| american.zombieland.(8275494).nfo |
6.437 |
18.09.2021 01:12:06 +00:00 |
| amityville.island.(8269871).nfo |
6.520 |
18.09.2021 01:11:56 +00:00 |
| Amityville.Island.2020.HDRip.XviD.AC3-EVO.srt |
40.785 |
18.09.2021 04:11:43 +00:00 |
| amjeon.(8262190).nfo |
6.271 |
8.07.2023 21:48:50 +00:00 |
| among.thieves.(7924537).nfo |
6.520 |
22.09.2021 18:48:26 +00:00 |
| Among.Thieves.2019.1080p.WEB-DL.H264.AC3-EVO-HI.srt |
76.887 |
22.09.2021 21:47:37 +00:00 |
| amulet.(8336198).nfo |
6.354 |
3.09.2021 22:16:30 +00:00 |
| Amulet.srt |
28.345 |
4.09.2021 01:15:54 +00:00 |
| amundsen.(7988666).nfo |
6.271 |
26.09.2021 05:43:54 +00:00 |
| Amundsen.2019.NORWEGIAN.1080p.BluRay.H264.AAC-VXT.srt |
85.986 |
26.09.2021 08:43:40 +00:00 |
| an.american.pickle.(8317626).nfo |
6.354 |
9.09.2021 16:28:36 +00:00 |
| An.American.Pickle.2020.1080p.HMAX.WEB-DL.DD5.1.H.264-NTG.srt |
76.509 |
9.09.2021 19:28:19 +00:00 |
| an.english.haunting.(8176944).nfo |
6.354 |
4.09.2021 05:18:48 +00:00 |
| An.English.Haunting.2020.720p.WEBRip.x264.AAC-YTS.MX.srt |
49.004 |
4.09.2021 08:18:09 +00:00 |
| ana.(8127888).nfo |
6.437 |
8.09.2021 20:04:34 +00:00 |
| Ana.2020.720p.BluRay.x264-CADAVER.srt |
80.337 |
8.09.2021 23:04:24 +00:00 |
| Anastasia.2019.720p.WEBRip.x264.AAC-[YTS.MX].srt |
57.101 |
18.09.2021 04:12:37 +00:00 |
| anastasia.once.upon.a.time.(8157198).nfo |
6.437 |
18.09.2021 01:12:50 +00:00 |
| ancestral.world.(8232017).nfo |
6.520 |
3.09.2021 22:16:02 +00:00 |
| Ancestral.World.2020.HDRip.XviD.AC3-EVO.srt |
43.791 |
4.09.2021 01:15:26 +00:00 |
| andres.iniesta.the.unexpected.(8201679).nfo |
6.271 |
19.09.2021 06:06:46 +00:00 |
| Andres.Iniesta.The.Unexpected.Hero.2020.SPANISH.WEBRip.XviD.MP3-VXT.srt |
113.174 |
19.09.2021 09:06:25 +00:00 |
| Anelka Misunderstood 2020.srt |
143.244 |
10.09.2021 18:29:43 +00:00 |
| anelka.misunderstood.(8308693).nfo |
6.271 |
10.09.2021 15:30:06 +00:00 |
| angels.fallen.(8132821).nfo |
6.354 |
3.09.2021 02:27:56 +00:00 |
| Angels.Fallen.2020.1080p.WEB-DL.H264.AC3-EVO.srt |
54.410 |
3.09.2021 05:27:25 +00:00 |
| anna.2.(7893193).nfo |
6.271 |
28.03.2023 05:38:26 +00:00 |
| Anna.2019.HDRip.AC3.x264-CMRG.srt |
97.623 |
28.03.2023 08:38:26 +00:00 |
| anthropocene.the.human.epoch.(7728210).nfo |
6.437 |
22.09.2021 18:49:20 +00:00 |
| Anthropocene.The.Human.Epoch.2019.HDTV.x264-aAF.srt |
23.400 |
22.09.2021 21:48:32 +00:00 |
| any.bullet.will.do.(7670836).nfo |
7.018 |
17.07.2023 19:36:48 +00:00 |
| Any.Bullet.Will.Do.2018.720p.WEB-DL.H264.AC3-EVO_ptBR.srt |
82.677 |
17.07.2023 22:36:49 +00:00 |
| Any.Bullet.Will.Do.2018.WEBRip.x264-ION10_ptBR.srt |
81.635 |
17.07.2023 19:36:48 +00:00 |
| appiness.(8078060).nfo |
6.437 |
3.09.2021 15:04:18 +00:00 |
| Appiness.2018.720p.WEBRip.800MB.x264-GalaxyRG.srt |
91.001 |
3.09.2021 18:03:43 +00:00 |
| Architecture of Infinity-390464554.en.vtt |
24.695 |
9.07.2023 16:19:18 +00:00 |
| architektur.der.unendlichkeit.(8214501).nfo |
6.354 |
9.07.2023 13:19:18 +00:00 |
| archive.(8295563).nfo |
6.354 |
6.09.2021 15:52:58 +00:00 |
| Archive.srt |
70.588 |
6.09.2021 18:52:02 +00:00 |
| arkansas.(8751834).nfo |
6.354 |
11.09.2021 22:00:52 +00:00 |
| Arkansas.2020.1080p.Bluray.DTS-HD.MA.5.1.X264-EVO.srt |
129.913 |
12.09.2021 01:00:20 +00:00 |
| artemis.fowl.(8245866).nfo |
6.271 |
26.11.2021 14:11:32 +00:00 |
| Artemis.Fowl.2020.1080p.WEB.H264-SECRECY.srt |
112.851 |
26.11.2021 17:10:40 +00:00 |
| arthur.merlin.knights.of.camelot.(8450600).nfo |
6.437 |
15.09.2021 17:31:04 +00:00 |
| Arthur.Merlin.Knights.Of.Camelot.2020.720p.BluRay.x264.AAC-[YTS.MX].srt |
59.547 |
15.09.2021 20:30:05 +00:00 |
| ask.no.questions.(8262962).nfo |
6.437 |
26.08.2021 23:21:42 +00:00 |
| Ask.No.Questions.2020.720p.AMZN.WEB-DL.DDP2.0.H.264-NTG.srt |
90.727 |
27.08.2021 02:21:00 +00:00 |
| assassin.33.a.d.(8176415).nfo |
6.354 |
9.09.2021 16:28:26 +00:00 |
| Assassin.33.A.D.2020.1080p.WEB-DL.H264.AC3-EVO.srt |
100.041 |
9.09.2021 19:28:10 +00:00 |
| Athlete A.srt |
129.367 |
2.09.2021 04:34:57 +00:00 |
| athlete.a.(8336203).nfo |
6.271 |
2.09.2021 01:35:20 +00:00 |
| attack.of.the.unknown.(8544653).nfo |
6.271 |
19.08.2021 21:35:20 +00:00 |
| attack.of.the.unknown.2020.1080p.bluray.srt |
89.540 |
20.08.2021 00:34:29 +00:00 |
| Attraction.2.Invasion.2020.1080p.BDRip.x264.AC3-EVO.srt |
121.494 |
25.08.2021 20:52:06 +00:00 |
| Automata.2019.WEBRip.XviD.MP3-XVID.srt |
53.277 |
24.09.2021 00:52:43 +00:00 |
| ava.(8333470).nfo |
6.354 |
22.08.2021 21:23:36 +00:00 |
| ava.(9111980).nfo |
6.354 |
4.06.2022 19:48:44 +00:00 |
| Ava.2020.720p.WEBRip.x264-GalaxyRG.SRT |
77.499 |
4.06.2022 22:48:44 +00:00 |
| Ava.srt |
76.825 |
23.08.2021 00:23:23 +00:00 |
| avengers.infinity.war.(7436479).nfo |
6.449 |
18.08.2021 06:34:52 +00:00 |
| Avengers.Infinity.War.2018.PROPER.720p.BluRay.x264-Replica.srt |
98.839 |
18.08.2021 06:34:36 +00:00 |
| away.go.(8338159).nfo |
6.203 |
18.08.2021 06:34:52 +00:00 |
| Away.S01E01.Go.720p.NF.WEB-DL.DDP5.1.Atmos.H.264-NTb_tur.srt |
51.777 |
18.08.2021 06:34:37 +00:00 |
| Baaghi 3 2020 BluRay 1080p Hindi DD 5.1 x264 ESub - mkvCinemas.srt |
136.759 |
2.01.2023 01:47:17 +00:00 |
| Baaghi 3 2020 Hindi 720p WEB-DL x264 ESubs - MkvHub.Com.srt |
116.160 |
16.09.2021 22:58:57 +00:00 |
| baaghi.3.(8195565).nfo |
6.354 |
16.09.2021 19:59:02 +00:00 |
| baaghi.3.(9242726).nfo |
6.188 |
1.01.2023 22:47:16 +00:00 |
| baaghi.3.(9901273).nfo |
6.354 |
24.02.2024 02:05:50 +00:00 |
| Baaghi.3.2020.Hindi.1080p.WEBRip.x264.SRT |
139.140 |
24.02.2024 05:05:51 +00:00 |
| baba.yaga.terror.of.the.dark.(8324282).nfo |
6.437 |
25.08.2021 17:52:36 +00:00 |
| Baba.Yaga.Terror.Of.The.Dark.Forest.2020.720p.BluRay.x264.AAC-[YTS.MX]-HI.srt |
70.114 |
25.08.2021 20:52:03 +00:00 |
| babyteeth.(8252098).nfo |
6.520 |
8.09.2021 20:04:48 +00:00 |
| Babyteeth.2020.HDRip.XviD.AC3-EVO.srt |
83.657 |
8.09.2021 23:04:37 +00:00 |
| back.roads.(7601101).nfo |
6.354 |
26.09.2021 05:43:12 +00:00 |
| Back.Roads.2018.HDRip.AC3.X264-CMRG-tr.srt |
83.461 |
26.09.2021 08:42:59 +00:00 |
| back.to.the.titanic.(8261189).nfo |
6.354 |
13.09.2021 05:17:20 +00:00 |
| Back.to.the.Titanic.2020.720p.WEB.x264-CAFFEiNE.srt |
53.647 |
13.09.2021 08:16:38 +00:00 |
| Bad Boy 2020.cs.srt |
95.643 |
2.09.2021 16:52:09 +00:00 |
| Bad Trip.srt |
131.756 |
25.08.2021 20:52:20 +00:00 |
| bad.boy.(8712293).nfo |
6.354 |
2.09.2021 13:52:36 +00:00 |
| bad.boys.for.life.(8149571).nfo |
6.285 |
18.08.2021 06:34:53 +00:00 |
| Bad.Boys.For.Life.2020.NEW.720p.HD-TS.x264.HQ-CPG.srt |
112.026 |
18.08.2021 06:34:38 +00:00 |
| bad.therapy.(8174792).nfo |
6.354 |
14.09.2021 23:25:24 +00:00 |
| Bad.Therapy.2020.HDRip.XviD.AC3-EVO.srt |
106.208 |
15.09.2021 02:24:31 +00:00 |
| bad.trip.(8296273).nfo |
6.354 |
25.08.2021 17:52:52 +00:00 |
| banking.on.africa.the.bitcoin.(8226648).nfo |
6.437 |
28.08.2021 12:58:22 +00:00 |
| banking.on.africa.the.bitcoin.(9404413).nfo |
6.354 |
28.01.2023 07:48:42 +00:00 |
| Banking.On.Africa.The.Bitcoin.Revolution.2020.WEBRip.x264-ION10.srt |
87.448 |
28.08.2021 15:57:30 +00:00 |
| Banksy and the Rise of Outlaw Art (2020).srt |
132.280 |
6.03.2023 17:07:12 +00:00 |
| banksy.and.the.rise.of.outlaw.(8711614).nfo |
6.354 |
4.09.2021 11:57:20 +00:00 |
| banksy.and.the.rise.of.outlaw.(9453787).nfo |
6.437 |
6.03.2023 14:07:12 +00:00 |
| bannister.dollhouse.(8302914).nfo |
6.437 |
8.09.2021 20:04:50 +00:00 |
| Barkskins.S01E08.1080p.WEB.H264-METCON.srt |
28.266 |
28.03.2024 15:01:22 +00:00 |
| barkskins.the.black.sun.(8328984).nfo |
6.520 |
28.03.2024 15:01:22 +00:00 |
| batman.hush.(7838723).nfo |
6.271 |
22.09.2021 18:49:26 +00:00 |
| Batman.Hush.2019.HDRip.XviD.AC3-EVO.srt |
73.359 |
22.09.2021 21:48:37 +00:00 |
| Batsh-t.Bride.2019.HDRip.XviD.AC3-EVO.srt |
117.710 |
27.08.2021 02:21:40 +00:00 |
| batsh.t.bride.(8205938).nfo |
6.436 |
26.08.2021 23:22:20 +00:00 |
| battle.scars.(8304244).nfo |
6.437 |
11.09.2021 02:02:36 +00:00 |
| Battle.Scars.2020.720p.WEBRip.X264.AAC.2.0-EVO.srt |
75.079 |
11.09.2021 05:02:10 +00:00 |
| battle.star.wars.(8077616).nfo |
6.354 |
19.08.2021 05:57:38 +00:00 |
| Battle.Star.Wars.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
64.789 |
19.08.2021 08:56:52 +00:00 |
| battlefield.2025.(8275364).nfo |
6.437 |
11.09.2021 02:03:24 +00:00 |
| Battlefield.2025.2020.720p.AMZN.WEBRip.800MB.x264-GalaxyRG.srt |
99.011 |
11.09.2021 05:02:59 +00:00 |
| be.still.and.know.(8172307).nfo |
6.354 |
26.09.2021 05:44:16 +00:00 |
| Be.Still.and.Know.2019.WEBRip.x264-ION10.srt |
82.811 |
26.09.2021 08:44:03 +00:00 |
| beastie.boys.story.(8183288).nfo |
6.354 |
11.09.2021 02:02:26 +00:00 |
| Beastie.Boys.Story.2020.1080p.WEB.H264-SECRECY.srt |
199.533 |
11.09.2021 05:01:59 +00:00 |
| beasts.clawing.at.straws.(8162954).nfo |
6.354 |
9.09.2021 16:28:54 +00:00 |
| beasts.clawing.at.straws.(8384831).nfo |
6.354 |
29.11.2021 10:39:46 +00:00 |
| Beasts.That.Cling.to.the.Straw.2020.1080p.ODK.WEB-DL.AAC.2.0.x264-iZON3.srt |
72.484 |
9.09.2021 19:28:37 +00:00 |
| Beasts.That.Cling.to.The.Straw.2020.720p.BluRay.DD5.1.x264-iFT.srt |
72.421 |
29.11.2021 13:39:34 +00:00 |
| beauty.and.the.beast.(6986199).nfo |
6.437 |
30.08.2021 21:21:22 +00:00 |
| Beauty.and.the.Beast.2017.720p.BluRay.x264-SPARKS.srt |
100.349 |
31.08.2021 00:21:15 +00:00 |
| beauty.and.the.beast.the.(6946442).nfo |
6.354 |
10.11.2022 18:47:18 +00:00 |
| Beauty.and.the.Beast.The.Enchanted.Christmas.1997.720p.BluRay.x264-PSYCHD.srt |
65.504 |
10.11.2022 21:47:18 +00:00 |
| becky.(8238360).nfo |
6.354 |
26.11.2021 14:11:10 +00:00 |
| Becky.2020.WEBRip.x264-ION10.srt |
58.245 |
26.11.2021 17:10:19 +00:00 |
| becoming.(8202419).nfo |
6.354 |
29.08.2021 19:28:08 +00:00 |
| Becoming.2020.1080p.WEBRip.x265.srt |
100.671 |
29.08.2021 22:28:07 +00:00 |
| Before the Fire.2020.HDRip.XviD.AC3-EVO.srt |
62.623 |
5.09.2021 22:52:01 +00:00 |
| before.the.fire.(8316023).nfo |
6.437 |
5.09.2021 19:52:50 +00:00 |
| behind.the.line.escape.to.(8313435).nfo |
6.437 |
13.09.2021 05:17:04 +00:00 |
| Behind.The.Line.Escape.To.Dunkirk.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
63.366 |
13.09.2021 08:16:23 +00:00 |
| behind.you.(8174766).nfo |
6.437 |
3.09.2021 15:04:38 +00:00 |
| behind.you.(9178516).nfo |
6.271 |
5.08.2022 06:00:38 +00:00 |
| behind.you.(9370643).nfo |
6.354 |
30.12.2022 12:45:42 +00:00 |
| Behind.You.2020.720p.BluRay.H264.AAC-RARBG.srt |
51.948 |
5.08.2022 09:00:39 +00:00 |
| Behind.You.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
49.604 |
3.09.2021 18:04:04 +00:00 |
| belgravia.episode.1.1.(8129250).nfo |
6.520 |
29.03.2024 08:09:12 +00:00 |
| belgravia.episode.1.1.(8210508).nfo |
6.354 |
3.04.2024 06:23:54 +00:00 |
| Belgravia.S01E01.720p.HDTV.x264-ORGANiC.srt |
74.946 |
29.03.2024 08:09:12 +00:00 |
| Belgravia.S01E01.iNTERNAL.1080p.WEB.H264-GHOSTS.srt |
52.893 |
3.04.2024 06:23:54 +00:00 |
| ben.platt.live.from.radio.city.(8216567).nfo |
6.354 |
4.09.2021 05:16:52 +00:00 |
| Ben.Platt.Live.from.Radio.City.Music.Hall.2020.720p.WEB.H264-AMRAP.srt |
88.443 |
4.09.2021 08:16:13 +00:00 |
| beneath.us.(8265914).nfo |
6.437 |
10.09.2021 05:02:26 +00:00 |
| Beneath.Us.2019.720p.WEBRip.x264-YIFY.srt |
32.543 |
10.09.2021 08:02:07 +00:00 |
| Benjamin.Blumchen.2019.GERMAN.1080p.AMZN.WEB-DL.DDP5.1.H.264-AlfaHD.srt |
116.279 |
5.09.2023 22:21:25 +00:00 |
| benjamin.the.elephant.(8275487).nfo |
6.437 |
5.09.2023 19:21:24 +00:00 |
| Berlin, Berlin (2020) - forumiptv 154.srt |
83.765 |
11.09.2021 05:01:26 +00:00 |
| berlin.berlin.(8318485).nfo |
6.354 |
11.09.2021 02:01:52 +00:00 |
| betonrausch.(8175063).nfo |
6.271 |
23.08.2021 15:20:28 +00:00 |
| between.shadow.and.soul.(8273946).nfo |
6.354 |
23.08.2021 20:02:24 +00:00 |
| Between.Shadow.And.Soul.2020.HDRip.XviD.AC3-EVO.srt |
11.650 |
23.08.2021 23:02:05 +00:00 |
| beyond.the.law.(8176223).nfo |
6.437 |
25.09.2021 15:12:24 +00:00 |
| Beyond.The.Law.2019.1080p.WEBRip.x264-RARBG.srt |
65.929 |
25.09.2021 18:12:16 +00:00 |
| Bhonsle (2020) Hindi - x264 - AAC - WEB - HDRip - ESub.srt |
35.336 |
15.09.2021 02:24:21 +00:00 |
| bhonsle.(8258659).nfo |
6.354 |
14.09.2021 23:25:14 +00:00 |
| big.time.adolescence.(8439825).nfo |
6.437 |
11.09.2021 11:55:00 +00:00 |
| Big.Time.Adolescence.2019.1080p.HULU.WEB-DL.DDP5.1.H.264-TEPES_ptBR.srt |
97.120 |
11.09.2021 14:54:32 +00:00 |
| Bill.and.Ted.Face.the.Music.2020.1080p.WEBRip.DD5.1.x264.srt |
109.011 |
21.09.2021 04:52:46 +00:00 |
| bill.ted.face.the.music.(8387182).nfo |
6.354 |
21.09.2021 01:53:22 +00:00 |
| Birds of Prey And the Fantabulous Emancipation.TR.srt |
101.903 |
16.09.2021 22:58:04 +00:00 |
| birds.of.prey.(8099720).nfo |
6.437 |
16.09.2021 19:58:08 +00:00 |
| Black Water Abyss.2020.HDRip.XviD.AC3-EVO.srt |
45.961 |
13.09.2021 08:17:24 +00:00 |
| black.is.king.(8304551).nfo |
6.518 |
21.08.2021 05:28:44 +00:00 |
| Black.Is.King.2020[WEBRip].[WEBDL] - RENOMEIE PARA SEU RELEASE.srt |
86.972 |
21.08.2021 08:28:44 +00:00 |
| black.ops.(8243353).nfo |
6.520 |
21.09.2021 01:54:38 +00:00 |
| black.water.abyss.(8317566).nfo |
6.437 |
13.09.2021 05:18:06 +00:00 |
| Blood and Money.srt |
34.869 |
4.09.2021 01:16:01 +00:00 |
| blood.and.money.(8334283).nfo |
6.354 |
3.09.2021 22:16:38 +00:00 |
| blood.on.her.name.(8312185).nfo |
6.437 |
26.11.2021 14:11:04 +00:00 |
| Blood.On.Her.Name.2019.[WEB-DL+WEBRip+HDRip].srt |
50.400 |
26.11.2021 17:10:13 +00:00 |
| blood.vessel.(9419248).nfo |
6.437 |
18.07.2023 01:28:54 +00:00 |
| blood.widow.(8058099).nfo |
6.271 |
19.08.2023 19:27:38 +00:00 |
| Blood.Widow.2019.HDRip.XviD.AC3-EVO.srt |
70.455 |
19.08.2023 22:27:39 +00:00 |
| bloodhound.(8125059).nfo |
6.271 |
8.09.2021 20:04:22 +00:00 |
| Bloodhound.2020.1080p.WEBRip.x264-.YTS.LT.es.srt |
77.801 |
8.09.2021 23:04:13 +00:00 |
| bloodshot.(8141809).nfo |
6.437 |
20.09.2021 11:39:16 +00:00 |
| Bloodshot.2020.HDRip.XviD.AC3-EVO.srt |
77.784 |
20.09.2021 14:38:44 +00:00 |
| Body Cam.srt |
55.404 |
21.09.2021 04:54:00 +00:00 |
| body.at.brighton.rock.(7732223).nfo |
6.520 |
27.03.2023 07:08:18 +00:00 |
| Body.at.Brighton.Rock.2019.HDRip.XviD.AC3-EVO.srt |
36.468 |
27.03.2023 10:08:19 +00:00 |
| body.cam.(8336202).nfo |
6.354 |
21.09.2021 01:54:36 +00:00 |
| bone.breaker.(8155909).nfo |
6.437 |
19.09.2021 06:08:34 +00:00 |
| Bone.Breaker.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
51.006 |
19.09.2021 09:08:13 +00:00 |
| boo.(7717126).nfo |
6.437 |
9.09.2023 22:13:18 +00:00 |
| Boo.2019.HDRip.XviD.AC3-EVO.srt |
54.883 |
10.09.2023 01:13:19 +00:00 |
| born.in.evin.(8322124).nfo |
6.271 |
25.09.2021 15:13:02 +00:00 |
| born.in.evin.(8906104).nfo |
6.354 |
15.03.2023 07:46:02 +00:00 |
| Born.In.Evin.2019.WEBRip.x264-ION10.srt |
44.652 |
25.09.2021 18:12:53 +00:00 |
| bottom.of.the.9th.(7836177).nfo |
6.354 |
25.09.2021 15:12:34 +00:00 |
| bottom.of.the.9th.(9033526).nfo |
6.271 |
14.03.2023 04:12:54 +00:00 |
| Bottom.Of.The.9th.2019.1080p.WEBRip.x264-[YTS.LT].srt |
107.756 |
14.03.2023 07:12:55 +00:00 |
| Bottom.Of.The.9th.2019.HDRip.XviD.AC3-EVO.srt |
101.367 |
25.09.2021 18:12:26 +00:00 |
| boys.state.(8317706).nfo |
6.354 |
3.09.2021 22:15:22 +00:00 |
| Boys.State.2020.WEBRip.XviD.MP3-XVID.srt |
148.040 |
4.09.2021 01:14:45 +00:00 |
| brabham.(8310979).nfo |
6.437 |
19.09.2021 06:07:24 +00:00 |
| brabham.2020.1080p.web.h264-huzzah.srt |
138.633 |
19.09.2021 09:07:02 +00:00 |
| brahms.the.boy.ii.(8210545).nfo |
6.354 |
3.09.2021 02:28:24 +00:00 |
| Brahms.The.Boy.II.2020.1080p.BluRay.x265-RARBG.tr.srt |
65.869 |
3.09.2021 05:27:54 +00:00 |
| braking.for.whales.(8183158).nfo |
6.354 |
23.09.2021 21:52:18 +00:00 |
| Braking.For.Whales.2019.HDRip.XviD.AC3-EVO.srt |
119.810 |
24.09.2021 00:51:21 +00:00 |
| break.(8484815).nfo |
6.437 |
8.09.2021 20:04:20 +00:00 |
| Break.2020.1080p.WEB-DL.DD5.1.H264-CMRG.srt |
96.566 |
8.09.2021 23:04:09 +00:00 |
| breaking.barbi.(7725695).nfo |
6.437 |
23.09.2021 21:53:02 +00:00 |
| Breaking.Barbi.2019.720p.Web.X264.Solar.srt |
84.154 |
24.09.2021 00:52:05 +00:00 |
| Briarpatch.S01E06.1080p.AMZN.WEBRip.DDP5.1.x264-iKA.srt |
32.103 |
18.08.2021 06:34:39 +00:00 |
| briarpatch.the.most.sinful.(8134786).nfo |
6.449 |
18.08.2021 06:34:54 +00:00 |
| bride.of.the.werewolf.(8372229).nfo |
6.354 |
27.03.2023 17:40:10 +00:00 |
| Bride.of.the.Werewolf.2019.1080p.WEBRip.x264-RARBG.srt |
50.271 |
27.03.2023 20:40:11 +00:00 |
| brightburn.(7821041).nfo |
6.271 |
23.09.2021 21:53:06 +00:00 |
| Brightburn.2019.KORSUB.HDRip.x264-STUTTERSHIT.TR.srt |
54.551 |
24.09.2021 00:52:09 +00:00 |
| bring.me.home.(8517419).nfo |
6.437 |
9.07.2023 07:28:12 +00:00 |
| Bring.Me.Home.2019.German.DL.1080p.BluRay.AVC-HOVAC.srt |
72.619 |
9.07.2023 10:28:14 +00:00 |
| brock.over.the.top.(8302684).nfo |
6.437 |
16.09.2021 19:55:12 +00:00 |
| Brock.Over.The.Top.2020.1080p.WEBRip.x264-RARBG.srt |
169.856 |
16.09.2021 22:55:08 +00:00 |
| broil.(8378156).nfo |
6.437 |
8.09.2021 20:04:54 +00:00 |
| Broil.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
80.848 |
8.09.2021 23:04:44 +00:00 |
| broken.poet.(8284101).nfo |
6.354 |
19.09.2021 20:28:08 +00:00 |
| Broken.Poet.2020.HDRip.XviD.AC3-EVO.srt |
135.327 |
19.09.2021 23:27:42 +00:00 |
| buffaloed.(8687681).nfo |
6.271 |
4.09.2021 11:58:04 +00:00 |
| Buffaloed.2019.COMPLETE.BLURAY-TAPAS.srt |
147.883 |
4.09.2021 14:57:24 +00:00 |
| Bulbbul (2020) Hindi 720p NF WEBRip x264 AAC 5.1 MSubs - LOKiHD - Telly - Turkish.srt |
43.442 |
11.09.2021 05:02:23 +00:00 |
| bulbbul.(8258690).nfo |
6.354 |
11.09.2021 02:02:50 +00:00 |
| bulletproof.2.(8047957).nfo |
6.437 |
8.09.2021 20:05:02 +00:00 |
| Bulletproof.2.2020.DVDRip.XviD.AC3-EVO.srt |
113.219 |
8.09.2021 23:04:51 +00:00 |
| burden.(8240594).nfo |
6.520 |
18.08.2021 21:20:20 +00:00 |
| Burden.2020.HDRip.XviD.AC3-EVO.srt |
110.892 |
19.08.2021 00:19:36 +00:00 |
| burning.dog.(8134706).nfo |
6.520 |
11.09.2021 11:54:54 +00:00 |
| Burning.Dog.2020.HDRip.XviD.AC3-EVO.srt |
144.236 |
11.09.2021 14:54:25 +00:00 |
| By.day's.end.2020_Arabic.srt |
105.825 |
18.09.2021 18:46:43 +00:00 |
| by.day.s.end.(8131919).nfo |
6.354 |
18.09.2021 15:47:00 +00:00 |
| by.light.of.desert.night.(8203275).nfo |
6.437 |
24.08.2021 06:27:30 +00:00 |
| By.Light.Of.Desert.Night.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
75.808 |
24.08.2021 09:27:07 +00:00 |
| cabal.(8140700).nfo |
6.354 |
20.08.2021 06:41:18 +00:00 |
| Cabal.2020.HDRip.XviD.AC3-EVO.srt |
36.607 |
20.08.2021 09:40:25 +00:00 |
| calm.with.horses.(8217974).nfo |
6.438 |
19.08.2021 02:55:34 +00:00 |
| Calm.With.Horses.2020.[Renomeie para o seu release].srt |
92.443 |
19.08.2021 05:54:48 +00:00 |
| cambio.tutto.(8516517).nfo |
6.520 |
6.09.2021 15:53:38 +00:00 |
| Cambio.Tutto.2020.SLOSubs.WEBRip.XviD-metalcamp.srt |
92.695 |
6.09.2021 18:52:42 +00:00 |
| Camp.Arrowhead.2020.HDRip.XviD.AC3-EVO.srt |
89.926 |
3.09.2021 18:04:12 +00:00 |
| Camp.Blood.8.2020.WEBRip.x264-ION10.srt |
86.985 |
21.09.2021 18:02:57 +00:00 |
| camp.blood.8.revelations.(8217815).nfo |
6.437 |
21.09.2021 15:03:36 +00:00 |
| camp.cold.brook.(8096505).nfo |
6.437 |
2.09.2021 01:35:46 +00:00 |
| Camp.Cold.Brook.2019.HDRip.XviD.AC3-EVO.srt |
62.636 |
2.09.2021 04:35:22 +00:00 |
| canal.street.(7870752).nfo |
6.354 |
21.09.2021 15:04:06 +00:00 |
| Canal.Street.2018.1080p.WEB-DL.DD5.1.H264-FGT.srt |
175.225 |
21.09.2021 18:03:27 +00:00 |
| Capone (2020).srt |
62.144 |
4.06.2022 04:08:15 +00:00 |
| capone.(8209144).nfo |
6.354 |
23.08.2021 09:56:28 +00:00 |
| capone.(9119810).nfo |
6.354 |
4.06.2022 01:08:14 +00:00 |
| Capone.1080p.WEB-DL.DD5.1.H.264-EVO.srt |
65.154 |
23.08.2021 12:56:13 +00:00 |
| captain.hagen.s.bed.breakfast.(7769195).nfo |
6.271 |
25.09.2021 15:13:30 +00:00 |
| Captain.Hagens.Bed.And.Breakfast.2019.HDRip.XviD.AC3-EVO.srt |
101.412 |
25.09.2021 18:13:22 +00:00 |
| Captain.Sabertooth.and.the.Magic.Diamond.2020.HDRip.XviD.AC3-EVO.srt |
69.042 |
15.09.2021 02:23:52 +00:00 |
| carrion.(8152020).nfo |
6.354 |
10.09.2021 05:01:50 +00:00 |
| Carrion.2020.1080p.WEB-DL.H264.AC3-EVO.srt |
36.496 |
10.09.2021 08:01:29 +00:00 |
| celebrity.crush.(8222813).nfo |
6.437 |
26.09.2021 19:48:32 +00:00 |
| Celebrity.Crush.2019.HDRip.XviD.AC3-EVO.srt |
76.401 |
26.09.2021 22:48:14 +00:00 |
| centigrade.(8334279).nfo |
6.354 |
19.08.2021 07:20:54 +00:00 |
| Centigrade.srt |
34.435 |
19.08.2021 10:20:08 +00:00 |
| chameleon.(8215492).nfo |
6.437 |
21.09.2021 15:04:14 +00:00 |
| Chameleon.2020.HDRip.XviD.AC3-EVO.srt |
50.316 |
21.09.2021 18:03:34 +00:00 |
| charlie.s.angels.(8112448).nfo |
6.520 |
25.09.2021 00:52:26 +00:00 |
| Charlies.Angels.2019.1080p.BluRay.x264-DRONES.(BluRay).srt |
120.501 |
25.09.2021 03:52:22 +00:00 |
| chemical.hearts.(8323647).nfo |
6.439 |
28.08.2021 12:58:58 +00:00 |
| Chemical.Hearts.2020.1080p.WEB.H264-SECRECY.srt |
81.521 |
28.08.2021 15:58:06 +00:00 |
| Chintu Ka Birthday (2020) Hindi WEB - HDRip - x264 - AAC - ESub.srt |
64.907 |
10.09.2021 18:30:05 +00:00 |
| chintu.ka.birthday.(8235052).nfo |
6.271 |
10.09.2021 15:30:28 +00:00 |
| Choke 2020 720p WEB-DL x264 ESubs - MkvHub.srt |
70.919 |
4.09.2021 14:56:33 +00:00 |
| choke.(8222921).nfo |
6.520 |
4.09.2021 11:57:14 +00:00 |
| Choked Paisa Bolta Hai (2020) Hindi 720p NF WEBRip ⭐800 MB⭐ ESub DD- 5.1 x264 - Shadow (BonsaiHD).srt |
81.882 |
3.08.2021 09:57:22 +00:00 |
| chopsticks.(7786108).nfo |
6.271 |
25.09.2021 15:12:08 +00:00 |
| Chopsticks.2019.1080p.NF.WEB-DL.DDP5.1.HEVC-MZABI_tur.srt |
69.523 |
25.09.2021 18:11:59 +00:00 |
| christmas.at.the.royal.hotel.(8162589).nfo |
6.271 |
14.08.2023 15:21:02 +00:00 |
| Christmas.At.The.Royal.Hotel.2018.720p.WEBRip.800MB.x264-GalaxyRG.srt |
87.025 |
14.08.2023 18:21:03 +00:00 |
| christmas.break.in.(7961419).nfo |
6.437 |
22.09.2021 18:49:14 +00:00 |
| christmas.break.in.(9316957).nfo |
6.437 |
31.01.2023 07:59:30 +00:00 |
| Christmas.Break.In.2018.1080p.WEB-DL.DD5.1.H264-FGT.Hun.Sub.FPS23,976.srt |
82.408 |
22.09.2021 21:48:26 +00:00 |
| cicada.song.(8096232).nfo |
6.354 |
9.07.2023 08:23:32 +00:00 |
| Cicada.Song.2019.720p.WEB-DL.x264.srt |
48.206 |
9.07.2023 11:23:33 +00:00 |
| ciemno.prawie.noc.(7918140).nfo |
6.437 |
21.07.2023 16:17:08 +00:00 |
| circus.of.books.(8181056).nfo |
6.437 |
21.09.2021 15:04:42 +00:00 |
| Circus.of.Books.2019.720p.NF.WEB-DL.DDP5.1.x264-NTG.srt |
118.172 |
21.09.2021 18:04:02 +00:00 |
| city.of.lies.(7826823).nfo |
6.271 |
20.08.2023 17:40:46 +00:00 |
| City.of.Lies.2018.1080p.10bit.BluRay.6CH.x265.HEVC-PSA.srt |
123.457 |
20.08.2023 20:40:47 +00:00 |
| class.action.park.(8330421).nfo |
6.354 |
21.09.2021 01:53:28 +00:00 |
| class.action.park.(8987973).nfo |
6.354 |
20.01.2023 21:29:30 +00:00 |
| Class.Action.Park.2020.1080p.WEBRip.x264-FGT.srt |
176.318 |
21.09.2021 04:52:52 +00:00 |
| Class.Action.Park.2020.1080p.WEBRip.x265-RARBG.srt |
155.911 |
21.01.2023 00:29:31 +00:00 |
| cleanin.up.the.town.remembering.(9671231).nfo |
6.354 |
16.08.2023 05:40:58 +00:00 |
| Cleanin.Up.The.Town.Remembering.Ghostbusters.2019.720p.BluRay.x264.AAC-[YTS.MX].srt |
245.713 |
16.08.2023 08:40:59 +00:00 |
| clover.(8156899).nfo |
6.354 |
21.09.2021 01:54:26 +00:00 |
| Clover.2020.HDRip.XviD.AC3-EVO.srt |
146.897 |
21.09.2021 04:53:51 +00:00 |
| clown.fear.(8100986).nfo |
6.354 |
2.09.2021 01:36:08 +00:00 |
| Clown.Fear.2020.1080p.WEB-DL.DD5.1.H264-EVO.srt |
98.950 |
2.09.2021 04:35:45 +00:00 |
| clownface.(8320209).nfo |
6.437 |
18.09.2021 01:12:30 +00:00 |
| Clownface.2020.HDRip.XviD.AC3-EVO.srt |
57.873 |
18.09.2021 04:12:16 +00:00 |
| coda.(8280452).nfo |
6.437 |
2.09.2021 01:35:52 +00:00 |
| Coda.2019.1080p.AMZN.WEB-DL.DDP5.1.H.264-NTG.por.srt |
69.506 |
2.09.2021 04:35:29 +00:00 |
| code.of.thieves.(8227404).nfo |
6.354 |
21.08.2021 05:01:52 +00:00 |
| Code.of.Thieves.2020.1080p.AMZN.WEB-DL.DDP2.0.H.264-CMRG.srt |
138.449 |
21.08.2021 08:01:52 +00:00 |
| Coffee . Kareem.srt |
132.898 |
19.09.2021 09:08:19 +00:00 |
| coffee.kareem.(8160317).nfo |
6.437 |
19.09.2021 06:08:42 +00:00 |
| Cold Blood Legacy Turkish.srt |
47.841 |
23.09.2021 11:18:49 +00:00 |
| cold.blood.(7903641).nfo |
6.354 |
23.09.2021 08:19:42 +00:00 |
| collision.earth.(8188869).nfo |
6.437 |
11.09.2021 11:54:26 +00:00 |
| Collision.Earth.2020.720p.WEBRip.x264.AAC-YTS.MX.srt |
95.717 |
11.09.2021 14:53:58 +00:00 |
| color.out.of.space.(8090414).nfo |
6.354 |
3.09.2021 02:27:40 +00:00 |
| Color.Out.of.Space.2019.720p.SCREENER.800MB.x264-GalaxyRG.srt |
82.059 |
3.09.2021 05:27:09 +00:00 |
| come.as.you.are.(8283643).nfo |
6.271 |
1.09.2021 11:41:30 +00:00 |
| Come.As.You.Are.2019.1080p.WEB-DL.H264.AC3-EVO-TR.srt |
110.648 |
1.09.2021 14:41:10 +00:00 |
| corona.zombies.(8746588).nfo |
6.437 |
27.08.2021 19:09:24 +00:00 |
| Corona.Zombies.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
65.931 |
27.08.2021 22:08:36 +00:00 |
| Coronavirus.A.Origem.2020.1080p.WEB-DL.DD2.0.H264-RK.srt |
83.540 |
22.08.2021 22:04:10 +00:00 |
| corpus.christi.(8099812).nfo |
6.437 |
23.09.2021 08:19:28 +00:00 |
| Corpus.Christi.2019.1080p.BRRip.x264.Ac3.HORiZON-ArtSubs.AMARELO+NEGRITO.srt |
100.391 |
23.09.2021 11:18:36 +00:00 |
| Crazy.Awesome.Teachers.2020.INDONESIAN.1080p.WEBRip.x265-VXT.srt |
84.403 |
18.09.2021 04:11:26 +00:00 |
| cross.3.(7960441).nfo |
6.354 |
26.09.2021 19:48:26 +00:00 |
| Cross.3.2019.1080p.WEB-DL.DD5.1.H264-FGT.srt |
79.691 |
26.09.2021 22:48:08 +00:00 |
| crossing.swords.pilot.(8249789).nfo |
6.437 |
10.03.2024 00:06:38 +00:00 |
| Crossing.Swords.S01E01.1080p.WEB.h264-TRUMP.srt |
29.963 |
10.03.2024 00:06:38 +00:00 |
| cruel.peter.(8125313).nfo |
6.437 |
19.08.2021 07:58:38 +00:00 |
| Cruel.Peter.2019.720p.WEBRip.x264.AAC-.YTS.MX.srt |
32.922 |
19.08.2021 10:57:51 +00:00 |
| cry.havoc.(8198005).nfo |
6.354 |
27.08.2021 19:09:28 +00:00 |
| Cry.Havoc.2020.HDRip.XviD.AC3-EVO.srt |
39.071 |
27.08.2021 22:08:41 +00:00 |
| Crypsis (2019) WEBRip 720p YTS .YIFY.srt |
61.448 |
23.09.2021 11:16:34 +00:00 |
| crypsis.(8022715).nfo |
6.520 |
23.09.2021 08:17:26 +00:00 |
| cupid.(8167246).nfo |
6.437 |
10.09.2021 15:29:38 +00:00 |
| Cupid.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
84.664 |
10.09.2021 18:29:15 +00:00 |
| curious.george.royal.monkey.(7887039).nfo |
6.354 |
26.09.2021 05:43:14 +00:00 |
| Curious.George.Royal.Monkey.2019.DVDRip.XviD.AC3-EVO.srt |
69.470 |
26.09.2021 08:43:01 +00:00 |
| cut.and.chop.(8316030).nfo |
6.437 |
11.09.2021 02:03:08 +00:00 |
| Cut.and.Chop.2020.HDRip.XviD.AC3-EVO.srt |
59.365 |
11.09.2021 05:02:42 +00:00 |
| D-Day.2019.720p.BluRay.x264-SPOOKS.srt |
77.949 |
26.11.2021 17:10:16 +00:00 |
| d.day.battle.of.omaha.beach.(7834079).nfo |
6.520 |
26.11.2021 14:11:08 +00:00 |
| da.5.bloods.(8244569).nfo |
6.437 |
11.09.2021 11:55:46 +00:00 |
| Da.5.Bloods.2020.1080p.WEB.H264-SECRECY.srt |
132.180 |
11.09.2021 14:55:18 +00:00 |
| dads.(8252738).nfo |
6.520 |
25.09.2021 15:12:20 +00:00 |
| Dads.1080p.ATVP.WEB-DL.DDP5.1.H.264-TOMMY.srt |
105.271 |
25.09.2021 18:12:12 +00:00 |
| dale.archdale.(8285218).nfo |
6.354 |
20.08.2021 11:49:52 +00:00 |
| Dale.Archdale.2020.HDRip.XviD.AC3-EVO.srt |
122.126 |
20.08.2021 14:48:56 +00:00 |
| Danger Close The Battle of Long Tan (2019) Netrip.srt |
83.233 |
16.08.2023 08:29:12 +00:00 |
| danger.close.(8692034).nfo |
6.354 |
16.08.2023 05:29:12 +00:00 |
| dangerous.lies.(8191247).nfo |
6.354 |
3.09.2021 02:27:04 +00:00 |
| Dangerous.Lies.2020.720p.NF.WEB-DL.DDP5.1.x264-NTG.srt |
103.916 |
3.09.2021 05:26:33 +00:00 |
| Daniel Isn't Real.srt |
60.605 |
22.09.2021 07:48:54 +00:00 |
| daniel.isn.t.real.(8097428).nfo |
6.271 |
22.09.2021 04:49:38 +00:00 |
| danmarks.sonner.(8093233).nfo |
6.354 |
26.09.2021 05:44:20 +00:00 |
| danny.s.game.(8232007).nfo |
6.354 |
22.08.2021 12:55:00 +00:00 |
| Dannys.Game.2020.HDRip.XviD.AC3-EVO.srt |
91.352 |
22.08.2021 15:54:51 +00:00 |
| Dark.Almost.Night.2019.1080p.BluRay.x264-SPRiNTER.srt |
62.850 |
21.07.2023 19:17:10 +00:00 |
| dark.forces.(8324110).nfo |
6.188 |
10.09.2021 15:30:02 +00:00 |
| darkness.falls.(8243694).nfo |
6.520 |
10.09.2021 05:02:44 +00:00 |
| Darkness.Falls.2020.HDRip.XviD.AC3-EVO.srt |
56.033 |
10.09.2021 08:02:24 +00:00 |
| Dating Amber.srt |
68.787 |
13.09.2021 08:17:16 +00:00 |
| dating.amber.(8333434).nfo |
6.354 |
13.09.2021 05:17:58 +00:00 |
| dave.chappelle.the.kennedy.(8246870).nfo |
6.458 |
2.09.2021 13:52:40 +00:00 |
| Dave.Chappelle.The.Kennedy.Center.Mark.Twain.Prize.For.American.Humor.2020.NF.WEB-DL.DDP2.0.x264-NTG.srt |
108.577 |
2.09.2021 16:52:13 +00:00 |
| day.13.(8307817).nfo |
6.188 |
24.08.2021 00:12:08 +00:00 |
| Day.13.2020.720p.AMZN.WEB-DL.DDP2.0.H.264-NTG.srt |
61.395 |
24.08.2021 03:11:47 +00:00 |
| de.dodes.tjern.(8191015).nfo |
6.354 |
28.03.2023 21:18:04 +00:00 |
| De.Doedes.Tjern.2019.NORWEGIAN.1080p.BluRay.x264-WASTE.srt |
39.376 |
29.03.2023 00:18:05 +00:00 |
| dead.by.dawn.(8162057).nfo |
6.354 |
9.09.2021 16:28:32 +00:00 |
| Dead.By.Dawn.2020.HDRip.XviD.AC3-EVO.srt |
68.064 |
9.09.2021 19:28:16 +00:00 |
| dead.voices.(8273953).nfo |
6.354 |
20.09.2021 11:38:56 +00:00 |
| Dead.Voices.2020.HDRip.XviD.AC3-EVO.srt |
62.487 |
20.09.2021 14:38:24 +00:00 |
| dead.water.(7846587).nfo |
6.354 |
11.09.2021 22:00:10 +00:00 |
| Dead.Water.2019.720p.WEBRip.x264-.YTS.LT.srt |
72.016 |
12.09.2021 00:59:38 +00:00 |
| deadly.mile.high.club.(8668851).nfo |
6.435 |
19.08.2021 01:55:54 +00:00 |
| Deadly.Mile.High.Club.2020.WEBRip.[RENOMEIE PARA SEU RELEASE].srt |
89.703 |
19.08.2021 04:55:09 +00:00 |
| Deadpool (2016).tur.srt |
105.525 |
18.08.2021 06:34:40 +00:00 |
| Deadpool 2 (2018) English HDTS-Rip - 720p - x264 - MP3 - 800MB.srt |
110.033 |
21.08.2021 02:06:54 +00:00 |
| deadpool.(6605857).nfo |
6.285 |
18.08.2021 06:34:54 +00:00 |
| deadpool.2.(7375906).nfo |
6.354 |
20.08.2021 23:07:52 +00:00 |
| Deadwater Fell - 01x01 - Episode 1.1080p.MTB.English.C.updated.Addic7ed.com.srt |
26.914 |
18.08.2021 06:34:41 +00:00 |
| deadwater.fell.episode.1.1.(8075875).nfo |
6.203 |
18.08.2021 06:34:55 +00:00 |
| deadwater.fell.episode.1.1.(9061800).nfo |
6.354 |
2.04.2024 18:04:18 +00:00 |
| deadwater.fell.episode.1.2.(9061803).nfo |
6.354 |
3.04.2024 06:24:16 +00:00 |
| deadwater.fell.episode.1.3.(9061811).nfo |
6.354 |
28.03.2024 20:07:18 +00:00 |
| deadwater.fell.episode.1.4.(9061812).nfo |
6.354 |
29.03.2024 07:43:24 +00:00 |
| Deadwater.Fell.S01E01.1080p.AMZN.WEB-DL.DDP2.0.H.264-TEPES.srt |
28.930 |
2.04.2024 18:04:18 +00:00 |
| Deadwater.Fell.S01E02.1080p.AMZN.WEB-DL.DDP2.0.H.264-TEPES.srt |
34.929 |
3.04.2024 06:24:16 +00:00 |
| Deadwater.Fell.S01E03.1080p.AMZN.WEB-DL.DDP2.0.H.264-TEPES.srt |
35.415 |
28.03.2024 20:07:18 +00:00 |
| Deadwater.Fell.S01E04.1080p.AMZN.WEB-DL.DDP2.0.H.264-TEPES.srt |
36.379 |
29.03.2024 07:43:24 +00:00 |
| deadwood.the.movie.(7923355).nfo |
6.437 |
25.09.2021 15:12:56 +00:00 |
| Deadwood.The.Movie.2019.1080p.10bit.BluRay.6CH.x265.HEVC-PSA.srt |
90.120 |
25.09.2021 18:12:47 +00:00 |
| deathstroke.knights.dragons.(8052336).nfo |
6.365 |
3.09.2021 22:15:08 +00:00 |
| Deathstroke.Knights.Dragons.S01E01.Knights.Dragons.Part.One.WEB-DL-ROYALTiES HI.srt |
41.605 |
4.09.2021 01:14:32 +00:00 |
| debt.collectors.(8226862).nfo |
6.520 |
2.09.2021 01:35:10 +00:00 |
| Debt.Collectors.2020.HDRip.XviD.AC3-EVO.srt |
118.385 |
2.09.2021 04:34:47 +00:00 |
| Deep Blue Sea 3.srt |
77.331 |
10.09.2021 18:29:34 +00:00 |
| deep.blue.sea.3.(8334241).nfo |
6.354 |
10.09.2021 15:29:58 +00:00 |
| defiant.(7855986).nfo |
6.354 |
22.09.2021 04:49:14 +00:00 |
| Defiant.2019.720p.WEBRip.800MB.x264-GalaxyRG.srt |
70.274 |
22.09.2021 07:48:30 +00:00 |
| deported.(8112079).nfo |
6.354 |
19.09.2021 20:28:46 +00:00 |
| Deported.2020.1080p.WEBRip.x264-RARBG.srt |
133.148 |
19.09.2021 23:28:19 +00:00 |
| desperados.(8296436).nfo |
6.354 |
6.09.2021 15:52:34 +00:00 |
| Desperados.srt |
140.615 |
6.09.2021 18:51:38 +00:00 |
| Detroit.Driller.Killer.2020.1080p.WEBRip.x264.AAC-[YTS.MX].srt |
58.256 |
16.09.2021 22:54:33 +00:00 |
| devil.s.night.dawn.of.the.nain.(8256388).nfo |
6.354 |
15.09.2021 17:31:10 +00:00 |
| Devils.Junction.Handy.Dandys.Revenge.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
94.886 |
20.04.2024 14:57:26 +00:00 |
| Devils.Night.Dawn.Of.The.Nain.Rouge.2020.HDRip.XviD.AC3-EVO.srt |
73.953 |
15.09.2021 20:30:12 +00:00 |
| di.ren.jie.tan.an.(8294456).nfo |
6.271 |
11.09.2021 02:02:30 +00:00 |
| dia.of.the.dead.(7969573).nfo |
6.188 |
27.03.2023 04:52:46 +00:00 |
| Dia.Of.The.Dead.2019.1080p.WEB-DL.DD2.0.H264-FGT.srt |
114.561 |
27.03.2023 07:52:47 +00:00 |
| Diablo.L.ultima.corsa.AMZN.ita.srt |
46.431 |
24.01.2023 06:41:30 +00:00 |
| diablo.the.race.for.everything.(8096306).nfo |
6.437 |
21.09.2021 15:05:02 +00:00 |
| diablo.the.race.for.everything.(9016877).nfo |
6.437 |
24.01.2023 03:41:30 +00:00 |
| Diablo.The.Race.For.Everything.2019.720p.BluRay.moviezen.co.srt |
45.535 |
21.09.2021 18:04:23 +00:00 |
| die.heinzels.ruckkehr.der.(8236360).nfo |
6.437 |
3.09.2021 02:28:18 +00:00 |
| diery.(8327852).nfo |
6.354 |
19.09.2021 06:08:10 +00:00 |
| DieRy.2020.HDRip.XviD.AC3-EVO.srt |
107.605 |
19.09.2021 09:07:49 +00:00 |
| diggerz.black.lung.rises.(7794651).nfo |
6.437 |
24.09.2021 11:41:30 +00:00 |
| Dil Bechara (2020)-(1080p BluRay x265 10bit AC3) - [Musafirboy].SRT |
93.367 |
21.05.2023 01:24:30 +00:00 |
| Dil Bechara (2020).srt |
81.154 |
18.09.2021 04:12:58 +00:00 |
| dil.bechara.(8333481).nfo |
6.354 |
18.09.2021 01:13:10 +00:00 |
| dil.bechara.(9523525).nfo |
6.354 |
20.05.2023 22:24:30 +00:00 |
| dirt.music.(8288161).nfo |
6.520 |
3.09.2021 02:27:00 +00:00 |
| Dirt.Music.2020.HDRip.XviD.AC3-EVO.srt |
72.416 |
3.09.2021 05:26:30 +00:00 |
| disappearance.at.clifton.hill.(8330009).nfo |
6.354 |
11.09.2021 02:03:12 +00:00 |
| Disappearance.At.Clifton.Hill.2019.720p.WEBRip.x264.AAC-[YTS.MX].srt |
54.911 |
11.09.2021 05:02:47 +00:00 |
| disclosure.(8252288).nfo |
6.437 |
2.09.2021 13:53:48 +00:00 |
| Disclosure.2020.720p.WEB.H264-HUZZAH.srt |
147.256 |
2.09.2021 16:53:21 +00:00 |
| disturbing.the.peace.(8093706).nfo |
6.437 |
2.09.2021 01:35:42 +00:00 |
| disturbing.the.peace.2020.dvdrip.x264-cadaver.srt |
41.634 |
2.09.2021 04:35:19 +00:00 |
| divos.(8285151).nfo |
6.354 |
19.09.2021 20:29:08 +00:00 |
| DIVOS.2020.HDRip.XviD.AC3-EVO.srt |
143.775 |
19.09.2021 23:28:42 +00:00 |
| dolemite.is.my.name.(7941804).nfo |
6.271 |
8.07.2023 09:08:24 +00:00 |
| Dolemite.Is.My.Name.2019.720p.NF.WEBRip.DDP5.1.Atmos.x264-NTG_tur.srt |
140.844 |
8.07.2023 12:08:24 +00:00 |
| Dolittle 2020 HDRip.srt |
88.217 |
15.09.2021 20:29:54 +00:00 |
| dolittle.(8101219).nfo |
6.437 |
15.09.2021 17:30:52 +00:00 |
| doll.house.(8291762).nfo |
6.437 |
28.08.2021 12:59:20 +00:00 |
| Doll.House.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
31.067 |
28.08.2021 15:58:28 +00:00 |
| dolphin.reef.(8238385).nfo |
6.354 |
13.09.2021 05:16:58 +00:00 |
| Dolphin.Reef.2020.1080p.WEB.H264-SECRECY.srt |
43.357 |
13.09.2021 08:16:17 +00:00 |
| don.t.let.them.in.(8148204).nfo |
6.437 |
23.08.2021 04:34:52 +00:00 |
| don.t.speak.(8378492).nfo |
6.437 |
26.08.2021 23:21:30 +00:00 |
| Dont.Let.Them.in.2020.WEBRip.x264-ION10.srt |
56.795 |
23.08.2021 07:34:38 +00:00 |
| Dont.Speak.2020.1080p.WEB-DL.H264.AC3-EVO.srt |
24.933 |
27.08.2021 02:20:48 +00:00 |
| doppel.(8171114).nfo |
6.354 |
10.09.2021 15:29:36 +00:00 |
| Doppel.2019.HDRip.XviD.AC3-EVO.srt |
106.835 |
10.09.2021 18:29:12 +00:00 |
| double.world.(8297366).nfo |
6.271 |
3.09.2021 22:15:12 +00:00 |
| Double.World.2019.720p.NF.WEB-DL.DDP5.1.x264-NTG_tur.srt |
66.582 |
4.09.2021 01:14:36 +00:00 |
| downhill.(8145551).nfo |
6.520 |
3.09.2021 02:27:36 +00:00 |
| Downhill.2020.HDRip.XviD.AC3-EVO.srt |
101.584 |
3.09.2021 05:27:06 +00:00 |
| Downton Abbey (2019) [1080p x265 10bit FS98 Joy].tr.srt |
146.004 |
25.09.2021 18:12:59 +00:00 |
| downton.abbey.(8238060).nfo |
6.437 |
25.09.2021 15:13:08 +00:00 |
| dragon.soldiers.(8205945).nfo |
6.354 |
18.08.2021 08:17:52 +00:00 |
| Dragon.Soldiers.2020.HDRip.XviD.AC3-EVO.srt |
59.712 |
18.08.2021 11:17:13 +00:00 |
| dragonheart.vengeance.(8509350).nfo |
6.354 |
23.08.2021 23:36:08 +00:00 |
| Dragonheart.Vengeance.2020.1080p.BluRay.x264.AAC5.1-[YTS.MX].tr.srt |
80.391 |
24.08.2021 02:35:48 +00:00 |
| dragons.rescue.riders.secrets.of.(8296527).nfo |
6.272 |
4.09.2021 05:17:10 +00:00 |
| Dragons.Rescue.Riders.Secrets.Of.The.Songwing.2020.720p.NF.WEBRip.400MB.x264-GalaxyRG.srt |
54.527 |
4.09.2021 08:16:32 +00:00 |
| dreamkatcher.(8188192).nfo |
6.437 |
26.08.2021 23:21:26 +00:00 |
| Dreamkatcher.2020.DVDRip.XviD.AC3-EVO.srt |
53.692 |
27.08.2021 02:20:45 +00:00 |
| drive.me.to.the.end.(8340036).nfo |
6.437 |
29.08.2021 19:28:44 +00:00 |
| Drive.Me.To.The.End.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
86.035 |
29.08.2021 22:28:43 +00:00 |
| driven.(8248786).nfo |
6.520 |
26.09.2021 19:48:46 +00:00 |
| Driven.2020.HDRip.XviD.AC3-EVO.srt |
112.465 |
26.09.2021 22:48:28 +00:00 |
| Drone.srt |
71.513 |
25.09.2021 03:52:59 +00:00 |
| drowning.echo.(7855242).nfo |
6.521 |
12.07.2023 18:29:12 +00:00 |
| drunk.parents.(7734395).nfo |
6.520 |
19.08.2023 18:05:22 +00:00 |
| Drunk.Parents.2019.720p.WEB-DL.XviD.AC3-FGT.srt |
134.668 |
19.08.2023 21:05:22 +00:00 |
| Due.West.Our.Sex.Journay.2012.BluRay.720p.AC3.2Audio.x264-CHD.srt |
131.560 |
14.02.2022 19:17:00 +00:00 |
| Eagle.And.The.Albatross.2020.HDRip.XviD.AC3-EVO.srt |
104.346 |
11.09.2021 14:54:42 +00:00 |
| earthquake.bird.(7980428).nfo |
6.437 |
23.09.2021 08:19:18 +00:00 |
| Earthquake.Bird.2019.1080p.NF.WEB-DL.DDP5.1.Atmos.H264-CMRG.srt |
68.935 |
23.09.2021 11:18:26 +00:00 |
| easy.does.it.(8288167).nfo |
6.437 |
3.09.2021 15:04:02 +00:00 |
| Easy.Does.It.2020.HDRip.XviD.AC3-EVO.srt |
115.574 |
3.09.2021 18:03:28 +00:00 |
| Edge.Of.Extinction.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
108.500 |
18.03.2022 12:45:07 +00:00 |
| el.silencio.del.pantano.(8235253).nfo |
6.354 |
25.09.2021 00:53:22 +00:00 |
| elephant.(8159237).nfo |
6.354 |
20.09.2021 11:39:04 +00:00 |
| Elephant.2020.1080p.WEB.H264-SECRECY.srt |
51.964 |
20.09.2021 14:38:33 +00:00 |
| ella.bella.bingo.(8140707).nfo |
6.520 |
19.09.2021 06:08:26 +00:00 |
| Ella.Bella.Bingo.2020.HDRip.XviD.AC3-EVO.srt |
85.199 |
19.09.2021 09:08:05 +00:00 |
| ellipse.(7989664).nfo |
6.520 |
23.07.2023 04:48:50 +00:00 |
| Ellipse.2019.1080p.WEBRip.x264-.YTS.LT.srt |
24.780 |
23.07.2023 07:48:50 +00:00 |
| elsewhere.(8092538).nfo |
6.437 |
3.09.2021 22:16:14 +00:00 |
| Elsewhere.2019.1080p.WEBRip.srt |
94.353 |
4.09.2021 01:15:38 +00:00 |
| elvis.from.outer.space.(8273949).nfo |
6.354 |
21.09.2021 01:53:48 +00:00 |
| Elvis.From.Outer.Space.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
105.547 |
21.09.2021 04:53:13 +00:00 |
| emma.(8210116).nfo |
6.437 |
16.09.2021 19:59:54 +00:00 |
| Emma.2020.1080p.BluRay.x265-RARBG.tr.srt |
95.713 |
16.09.2021 22:59:50 +00:00 |
| emperor.(8320472).nfo |
6.354 |
16.09.2021 19:58:44 +00:00 |
| Emperor.2020.HDRip.XviD.AC3-EVO.srt |
62.417 |
16.09.2021 22:58:39 +00:00 |
| end.of.the.century.(8218944).nfo |
6.354 |
24.09.2021 11:42:12 +00:00 |
| End.of.the.Century.2019.SPANISH.1080p.BluRay.x265-VXT.tr.srt |
48.855 |
24.09.2021 14:42:11 +00:00 |
| end.of.the.trail.(8201585).nfo |
6.271 |
23.09.2021 21:52:30 +00:00 |
| End.of.the.Trail.2019.1080p.WEBRip.x264-RARBG.srt |
72.310 |
24.09.2021 00:51:33 +00:00 |
| endings.beginnings.(9003981).nfo |
6.354 |
9.07.2023 03:41:22 +00:00 |
| Endings.Beginnings.2020.1080p.WEB-DL.H264.AC3-EVO.srt |
82.578 |
9.07.2023 06:41:24 +00:00 |
| enemy.lines.(8183068).nfo |
6.520 |
19.08.2021 09:13:54 +00:00 |
| Enemy.Lines.2020.HDRip.XviD.AC3-EVO.srt |
69.279 |
19.08.2021 12:13:06 +00:00 |
| enter.the.fat.dragon.(8294333).nfo |
6.271 |
4.09.2021 05:17:56 +00:00 |
| Enter.The.Fat.Dragon.2020.720p.BluRay.x264.AAC-[YTS.MX] TR.srt |
106.655 |
4.09.2021 08:17:17 +00:00 |
| envelop.e.(8304734).nfo |
6.188 |
29.08.2021 19:28:38 +00:00 |
| Envelope.2020.1080p.WEBRip.x264-RARBG.srt |
24.636 |
29.08.2021 22:28:38 +00:00 |
| epiphany.(8062498).nfo |
6.437 |
23.09.2021 21:52:44 +00:00 |
| epiphany.(9602937).nfo |
6.437 |
20.06.2023 17:30:38 +00:00 |
| Epiphany.2019.720p.WEBRip.800MB.x264-GalaxyRG.srt |
64.949 |
24.09.2021 00:51:48 +00:00 |
| Epiphany.Amor.e.Perdao.2019.1080p.WEB-DL.DUAL.srt |
57.038 |
20.06.2023 20:30:38 +00:00 |
| eric.andre.legalize.everything.(8256691).nfo |
6.354 |
11.09.2021 02:02:44 +00:00 |
| Eric.Andre.Legalize.Everything.2020.720p.WEB.H264-HUZZAH.srt |
64.332 |
11.09.2021 05:02:18 +00:00 |
| escape.from.pretoria.(8121013).nfo |
6.437 |
19.08.2021 03:17:40 +00:00 |
| Escape.from.Pretoria.2020.HDRip.XviD.AC3-EVO.srt |
54.924 |
19.08.2021 06:16:55 +00:00 |
| escape.puzzle.of.fear.(8320205).nfo |
6.354 |
18.09.2021 01:12:42 +00:00 |
| Escape.Puzzle.of.Fear.2020.HDRip.XviD.AC3-EVO.srt |
77.173 |
18.09.2021 04:12:29 +00:00 |
| escape.room.(7709145).nfo |
6.354 |
23.09.2021 08:18:34 +00:00 |
| Escape.Room.2019.720p.HC.WEBRip.XviD.MP3-STUTTERSHIT.srt |
107.171 |
23.09.2021 11:17:43 +00:00 |
| escaping.my.stalker.(8315931).nfo |
6.437 |
4.09.2021 05:18:56 +00:00 |
| Escaping.My.Stalker.2020.1080p.WEBRip.x264-RARBG.srt |
86.703 |
4.09.2021 08:18:17 +00:00 |
| eternal.beauty.(8327239).nfo |
6.271 |
13.09.2021 05:17:36 +00:00 |
| Eternal.Beauty.2019.HDRip.XviD.AC3-EVO (Turkish).srt |
70.532 |
13.09.2021 08:16:54 +00:00 |
| eurovision.song.contest.the.(8258858).nfo |
6.354 |
10.09.2021 05:03:16 +00:00 |
| Eurovision.Song.Contest_.The.Story.of.Fire.Saga.720p.WEB.srt |
125.863 |
10.09.2021 08:02:56 +00:00 |
| evil.little.things.(8207392).nfo |
6.520 |
3.09.2021 02:27:08 +00:00 |
| Evil.Little.Things.2020.HDRip.XviD.AC3-EVO.srt |
57.678 |
3.09.2021 05:26:37 +00:00 |
| extraction.(8183244).nfo |
6.437 |
2.09.2021 01:36:16 +00:00 |
| Extraction.2020.720p.NF.WEB-DL.DDP5.1.x264-NTG TR.srt |
43.818 |
2.09.2021 04:35:52 +00:00 |
| extracurricular.(8055799).nfo |
6.437 |
4.09.2021 05:17:40 +00:00 |
| Extracurricular.2019.720p.WEBRip.800MB.x264-GalaxyRG.srt |
71.364 |
4.09.2021 08:17:02 +00:00 |
| fagara.(8066810).nfo |
6.271 |
18.07.2023 19:57:08 +00:00 |
| fagara.(9883976).nfo |
6.354 |
7.02.2024 21:21:10 +00:00 |
| Fagara.2019.CHINESE.720p.BluRay.x264-WIKI.srt |
99.331 |
18.07.2023 22:57:08 +00:00 |
| Fagara.2019.CHINESE.BluRay.x264-BiPOLAR.id.srt |
99.453 |
8.02.2024 00:21:10 +00:00 |
| false.colors.(8154858).nfo |
6.354 |
28.08.2021 12:58:42 +00:00 |
| False.Colors.2020.HDRip.XviD.AC3-EVO.srt |
83.529 |
28.08.2021 15:57:50 +00:00 |
| Fame-ish.2020.HDRip.XviD.AC3-EVO.srt |
129.943 |
10.09.2021 18:30:02 +00:00 |
| fame.ish.(8207111).nfo |
6.354 |
10.09.2021 15:30:24 +00:00 |
| Fangio El hombre que domaba las máquinas (2020).srt |
108.088 |
10.09.2020 04:59:15 +00:00 |
| fantasy.island.(8179835).nfo |
6.449 |
18.08.2021 06:34:56 +00:00 |
| Fantasy.Island.2020.1080p.WEB-DL.DD5.1.H264-FGT.srt |
114.863 |
18.08.2021 06:34:42 +00:00 |
| Fantasy.Magician.2020.CHINESE.WEBRip.x264-NOGRP.srt |
59.850 |
2.09.2021 04:35:09 +00:00 |
| fast.and.fierce.death.race.(8215495).nfo |
6.437 |
10.09.2021 15:29:56 +00:00 |
| Fast.And.Fierce.Death.Race.2020.HDRip.XviD.AC3-EVO.srt |
78.401 |
10.09.2021 18:29:32 +00:00 |
| Fat.Ass.Zombies.2020.1080p.AMZN.WEBRip.DDP5.1.x264-iKA.srt |
78.593 |
18.09.2021 04:11:53 +00:00 |
| fat.fiction.(8164320).nfo |
6.354 |
27.08.2021 19:09:16 +00:00 |
| Fat.Fiction.2020.1080p.WEBRip.x264-RARBG.srt |
189.390 |
27.08.2021 22:08:29 +00:00 |
| fatal.affair.(8287044).nfo |
6.354 |
26.08.2021 23:21:36 +00:00 |
| Fatal.Affair.2020.720p.WEB.H264-HUZZAH.srt |
76.970 |
27.08.2021 02:20:55 +00:00 |
| Fatal.Journey.2020.1080p.bluray.mora.25r.srt |
63.450 |
9.11.2022 11:17:46 +00:00 |
| father.s.day.(7907563).nfo |
6.437 |
24.09.2021 11:42:08 +00:00 |
| father.soldier.son.(8288604).nfo |
6.271 |
3.09.2021 02:27:20 +00:00 |
| Father.Soldier.Son.2020.720p.WEB.H264-HUZZAH_Turkish.srt |
91.204 |
3.09.2021 05:26:49 +00:00 |
| Fathers.Day.2019.HDRip.XviD.AC3-EVO.srt |
94.772 |
24.09.2021 14:42:09 +00:00 |
| fatima.(8331740).nfo |
6.437 |
25.08.2021 10:30:20 +00:00 |
| Fatima.2020.1080p.WEB-DL.DD5.1.H.264-EVO.srt |
81.111 |
25.08.2021 13:29:49 +00:00 |
| fearless.(8317567).nfo |
6.354 |
4.09.2021 11:58:10 +00:00 |
| Fearless.WEBRip.Netflix.tr.srt |
69.786 |
4.09.2021 14:57:30 +00:00 |
| feast.of.the.seven.fishes.(8891203).nfo |
6.354 |
23.07.2023 06:02:20 +00:00 |
| Feast.Of.The.Seven.Fishes.2019.1080p.WEBRip.x264-[YTS.LT].srt |
80.612 |
23.07.2023 09:02:21 +00:00 |
| feel.the.beat.(8252366).nfo |
6.354 |
1.09.2021 11:40:54 +00:00 |
| Feel.the.Beat.2020.720p.WEB.H264-SECRECY_Turkish.srt |
112.568 |
1.09.2021 14:40:35 +00:00 |
| fighting.with.my.family.(7789344).nfo |
6.437 |
25.09.2021 15:13:12 +00:00 |
| Fighting.With.My.Family.2019.720p.WEBRip.x264-.YTS.AM.srt |
137.836 |
25.09.2021 18:13:02 +00:00 |
| final.kill.(8162679).nfo |
6.437 |
1.09.2021 11:41:54 +00:00 |
| Final.Kill.2020.720p.BluRay.x264-ROVERS.srt |
92.868 |
1.09.2021 14:41:35 +00:00 |
| final.transit.(8273046).nfo |
6.271 |
13.09.2021 05:18:02 +00:00 |
| Final.Transit.2019.1080p.WEBRip.x264-RARBG.srt |
69.994 |
13.09.2021 08:17:20 +00:00 |
| finding.grace.(8179821).nfo |
6.354 |
4.09.2021 11:57:54 +00:00 |
| Finding.Grace.2020.HDRip.XviD.AC3-EVO.srt |
100.826 |
4.09.2021 14:57:13 +00:00 |
| first.cow.(8504570).nfo |
6.354 |
6.09.2021 15:53:44 +00:00 |
| first.love.(8138196).nfo |
6.437 |
20.05.2023 06:53:12 +00:00 |
| First.Love.2019.720p.BluRay.x264.AAC-.YTS.MX.srt |
72.366 |
20.05.2023 09:53:14 +00:00 |
| float.like.a.butterfly.(8220309).nfo |
6.437 |
22.07.2023 19:31:14 +00:00 |
| Float.Like.a.Butterfly.2018.SLOSubs.WEBRip.XviD-metalcamp.srt |
52.082 |
22.07.2023 22:31:14 +00:00 |
| followed.(8334766).nfo |
6.520 |
11.10.2021 06:50:08 +00:00 |
| Followed.2020.HDRip.XviD.AC3-EVO.srt |
133.072 |
11.10.2021 09:49:36 +00:00 |
| for.the.love.of.jessee.(8192232).nfo |
6.354 |
9.09.2021 16:28:22 +00:00 |
| For.The.Love.Of.Jessee.2020.HDRip.XviD.AC3-EVO.srt |
89.173 |
9.09.2021 19:28:06 +00:00 |
| for.the.weekend.(8175445).nfo |
6.354 |
19.09.2021 20:29:02 +00:00 |
| For.the.Weekend.1080p.AMZN.WEB-DL.DDP2.0.H.264-CMRG.srt |
173.193 |
19.09.2021 23:28:35 +00:00 |
| for.we.are.many.(8226868).nfo |
6.437 |
18.07.2023 22:46:30 +00:00 |
| For.We.Are.Many.2019.HDRip.XviD.AC3-EVO.srt |
45.897 |
19.07.2023 01:46:31 +00:00 |
| force.of.nature.(8266986).nfo |
6.354 |
28.08.2021 12:58:04 +00:00 |
| Force.of.Nature.2020.1080p.BluRay.H264.AAC-RARBG.srt |
81.232 |
28.08.2021 15:57:12 +00:00 |
| Forever christmas.srt |
92.031 |
10.08.2022 12:34:16 +00:00 |
| forte.(8381275).nfo |
6.271 |
28.08.2021 12:59:26 +00:00 |
| Forte.2020.FRENCH.HDRip.XviD-EXTREME.srt |
108.136 |
28.08.2021 15:58:33 +00:00 |
| four.kids.and.it.(8250825).nfo |
6.437 |
3.09.2021 02:27:52 +00:00 |
| Four.Kids.And.It.2020.BDRip.XviD.AC3-EVO.srt |
97.377 |
3.09.2021 05:27:22 +00:00 |
| foxtrot.six.(8118848).nfo |
6.520 |
22.09.2021 18:49:30 +00:00 |
| Foxtrot.Six.2019.HDRip.XviD.AC3-EVO.srt |
69.702 |
22.09.2021 21:48:41 +00:00 |
| frankie.(8090867).nfo |
6.354 |
28.03.2023 11:08:26 +00:00 |
| Frankie.2019.1080p.BluRay.x264-AAA.srt |
76.949 |
28.03.2023 14:08:27 +00:00 |
| frieda.coming.home.(8191800).nfo |
6.520 |
21.09.2021 01:54:32 +00:00 |
| Frieda.Coming.Home.2020.HDRip.XviD.AC3-EVO-HI.srt |
80.695 |
21.09.2021 04:53:55 +00:00 |
| FriendButMarried 2 2020 NF.srt |
88.716 |
10.09.2021 18:29:25 +00:00 |
| friendbutmarried.2.(8261239).nfo |
6.271 |
10.09.2021 15:29:48 +00:00 |
| friends.who.kill.(8602423).nfo |
6.354 |
4.09.2021 11:57:06 +00:00 |
| Friends.Who.Kill.2020.1080p.bluray.mora.25r.srt |
157.944 |
4.09.2021 14:56:26 +00:00 |
| from.the.dead.(7863261).nfo |
6.437 |
25.09.2021 00:52:22 +00:00 |
| From.The.Dead.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
58.264 |
25.09.2021 03:52:19 +00:00 |
| fronteras.(7919798).nfo |
6.520 |
23.08.2021 23:30:02 +00:00 |
| Fronteras.2018.HDRip.AC3.x264-CMRG-HI.srt |
92.037 |
24.08.2021 02:29:43 +00:00 |
| Fuego.negro.2020.720p.NF.WEB-DL.DDP5.1.x264-NTG_tur.srt |
23.590 |
10.09.2021 18:29:40 +00:00 |
| full.out.2.you.got.this.(8182000).nfo |
6.437 |
18.08.2021 03:35:00 +00:00 |
| Full.Out.2.You.Got.This.2020.720p.WEBRip.X264.AAC.2.0-EVO.srt |
96.317 |
18.08.2021 06:34:21 +00:00 |
| Funhouse 2020 1080p WEB-DL H264 AC3-EVO.srt |
95.310 |
18.09.2021 04:12:34 +00:00 |
| funhouse.(8662600).nfo |
6.271 |
18.09.2021 01:12:48 +00:00 |
| fyre.fraud.(7694908).nfo |
6.271 |
23.09.2021 21:53:14 +00:00 |
| fyre.fraud.2019.web.h264-tbs.srt |
169.995 |
24.09.2021 00:52:17 +00:00 |
| G-Loc.2020.DVDRip.AC3.X264-CMRG.srt |
65.885 |
25.08.2021 20:52:24 +00:00 |
| g.loc.(8313282).nfo |
6.354 |
25.08.2021 17:52:56 +00:00 |
| Gabriel's Inferno.srt |
82.876 |
29.08.2021 22:27:50 +00:00 |
| gabriel.s.inferno.part.one.(8294874).nfo |
6.354 |
29.08.2021 19:27:50 +00:00 |
| gam.cam.grrl.(8273886).nfo |
6.354 |
25.09.2021 00:53:32 +00:00 |
| Gam.Cam.Grrl.2019.1080p.WEBRip.x264-RARBG.srt |
161.065 |
25.09.2021 03:53:28 +00:00 |
| Game of Thrones - The Last Watch.srt |
134.041 |
22.09.2021 07:48:09 +00:00 |
| game.of.thrones.the.last.watch.(7788528).nfo |
6.437 |
22.09.2021 04:48:52 +00:00 |
| gangbyeon.hotel.(7780862).nfo |
6.354 |
19.08.2023 03:19:22 +00:00 |
| gates.of.darkness.(8714603).nfo |
6.520 |
26.09.2021 05:43:18 +00:00 |
| Gates.of.Darkness.2019.1080p.BluRay.x264.srt |
83.957 |
26.09.2021 08:43:05 +00:00 |
| george.lopez.we.ll.do.it.for.(8262870).nfo |
6.354 |
25.08.2021 17:51:54 +00:00 |
| George.Lopez.Well.Do.It.for.Half.2020.720p.WEB.H264-HUZZAH.srt |
69.699 |
25.08.2021 20:51:22 +00:00 |
| Georgetown 2019 1080p WEB-DL H264 AC3-EVO.srt |
114.534 |
26.09.2021 08:43:12 +00:00 |
| georgetown.(8136908).nfo |
6.437 |
26.09.2021 05:43:26 +00:00 |
| get.out.(7215978).nfo |
6.437 |
6.11.2022 10:37:38 +00:00 |
| Get.Out.2017.dvdrip.srt |
86.975 |
6.11.2022 13:37:38 +00:00 |
| Ghoomketu (2020) Hindi TRUE WEB-DL - 720p - AVC - UNTOUCHED - AAC - 800MB - ESub(1).srt |
137.803 |
19.09.2021 23:28:13 +00:00 |
| ghoomketu.(8217983).nfo |
6.188 |
19.09.2021 20:28:40 +00:00 |
| ghosts.of.war.(8285486).nfo |
6.520 |
19.09.2021 06:07:34 +00:00 |
| Ghosts.Of.War.2020.HDRip.XviD.AC3-EVO.srt |
55.908 |
19.09.2021 09:07:13 +00:00 |
| ghoul.catchers.(8298996).nfo |
6.354 |
11.09.2021 02:01:46 +00:00 |
| Ghoul.Catchers.2019.1080p.WEBRip.x264-RARBG.srt |
106.218 |
11.09.2021 05:01:19 +00:00 |
| gi6-stld-s01e01-1080p.srt |
35.597 |
2.04.2024 14:19:32 +00:00 |
| gi6-stld-s01e02-1080p.srt |
36.586 |
2.04.2024 15:48:28 +00:00 |
| gi6-stld-s01e03-1080p.srt |
33.561 |
3.04.2024 01:52:12 +00:00 |
| gi6-stld-s01e04-1080p.srt |
33.895 |
2.04.2024 15:51:42 +00:00 |
| gi6-stld-s01e05-1080p.srt |
37.851 |
28.03.2024 19:39:22 +00:00 |
| gi6-stld-s01e06-1080p.srt |
36.712 |
3.04.2024 00:44:02 +00:00 |
| gi6-stld-s01e07-1080p.srt |
35.384 |
3.04.2024 11:11:38 +00:00 |
| gi6-stld-s01e08-1080p.srt |
36.829 |
3.04.2024 06:48:46 +00:00 |
| gi6-stld-s01e09-1080p.srt |
34.828 |
2.04.2024 21:24:28 +00:00 |
| gi6-stld-s01e10-1080p.srt |
41.366 |
3.04.2024 10:52:02 +00:00 |
| gina.brillon.the.floor.is.lava.(8248848).nfo |
6.437 |
1.09.2021 11:41:16 +00:00 |
| Gina.Brillon.The.Floor.Is.Lava.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
88.123 |
1.09.2021 14:40:57 +00:00 |
| ginger.s.tale.(8267127).nfo |
6.437 |
10.09.2021 05:02:22 +00:00 |
| Gingers.Tale.2020.WEB.h264-RedBlade.srt |
98.200 |
10.09.2021 08:02:03 +00:00 |
| gli.infedeli.(8285969).nfo |
6.271 |
18.08.2021 14:58:10 +00:00 |
| glitch.techs.age.of.hinobi.(8102778).nfo |
6.354 |
28.03.2024 16:07:50 +00:00 |
| glitch.techs.bitt.prime.(8321410).nfo |
6.271 |
3.04.2024 04:31:20 +00:00 |
| glitch.techs.buds.(8321404).nfo |
6.271 |
3.04.2024 10:09:08 +00:00 |
| glitch.techs.find.the.glitch.(8321406).nfo |
6.271 |
2.04.2024 16:09:22 +00:00 |
| glitch.techs.i.m.mitch.williams.(8321409).nfo |
6.271 |
3.04.2024 01:51:48 +00:00 |
| glitch.techs.ping.(8321402).nfo |
6.271 |
3.04.2024 12:15:58 +00:00 |
| glitch.techs.ralphie.bear.is.(8321403).nfo |
6.271 |
3.04.2024 06:22:34 +00:00 |
| Glitch.Techs.S01E01.NF.WEBRip.srt |
55.353 |
28.03.2024 16:07:50 +00:00 |
| Glitch.Techs.S02E01.1080p.WEB.H264-EDHD_tur.srt |
25.245 |
2.04.2024 20:14:40 +00:00 |
| Glitch.Techs.S02E02.1080p.WEB.H264-EDHD_tur.srt |
25.461 |
3.04.2024 12:15:58 +00:00 |
| Glitch.Techs.S02E03.1080p.WEB.H264-EDHD_tur.srt |
28.698 |
3.04.2024 06:22:34 +00:00 |
| Glitch.Techs.S02E04.1080p.WEB.H264-EDHD_tur.srt |
26.280 |
3.04.2024 10:09:08 +00:00 |
| Glitch.Techs.S02E05.1080p.WEB.H264-EDHD_tur.srt |
24.728 |
2.04.2024 18:14:58 +00:00 |
| Glitch.Techs.S02E06.1080p.WEB.H264-EDHD_tur.srt |
29.025 |
2.04.2024 16:09:22 +00:00 |
| Glitch.Techs.S02E07.1080p.WEB.H264-EDHD_tur.srt |
27.724 |
2.04.2024 20:04:34 +00:00 |
| Glitch.Techs.S02E08.1080p.WEB.H264-EDHD_tur.srt |
25.910 |
3.04.2024 04:21:04 +00:00 |
| Glitch.Techs.S02E09.1080p.WEB.H264-EDHD_tur.srt |
27.057 |
3.04.2024 01:51:48 +00:00 |
| Glitch.Techs.S02E10.1080p.WEB.H264-EDHD_tur.srt |
25.467 |
3.04.2024 04:31:20 +00:00 |
| glitch.techs.settling.the.score.(8321408).nfo |
6.271 |
3.04.2024 04:21:04 +00:00 |
| glitch.techs.the.glitch.modder.(8321401).nfo |
6.271 |
2.04.2024 20:14:40 +00:00 |
| glitch.techs.the.new.recruit.(8321405).nfo |
6.271 |
2.04.2024 18:14:58 +00:00 |
| glitch.techs.the.real.glitch.(8321407).nfo |
6.271 |
2.04.2024 20:04:34 +00:00 |
| go.(8126000).nfo |
6.271 |
16.09.2021 19:58:26 +00:00 |
| Go.Karts.2020.1080p.NF.WEB-DL.DDP5.1.x264-NTG.srt |
91.267 |
16.09.2021 22:58:22 +00:00 |
| gold.dust.(8162081).nfo |
6.520 |
10.09.2021 05:02:32 +00:00 |
| Gold.Dust.2020.HDRip.XviD.AC3-EVO-HI.srt |
103.049 |
10.09.2021 08:02:11 +00:00 |
| goldie.(8102628).nfo |
6.520 |
10.09.2021 05:02:50 +00:00 |
| Goldie.2019.HDRip.XviD.AC3-EVO-HI.srt |
71.934 |
10.09.2021 08:02:29 +00:00 |
| good.friday.(8322432).nfo |
6.437 |
3.09.2021 22:15:54 +00:00 |
| Good.Friday.2020.720p.AMZN.WEB-DL.DDP2.0.H.264-IKA.srt |
94.397 |
4.09.2021 01:15:17 +00:00 |
| good.newwz.(8248832).nfo |
6.437 |
13.07.2023 08:18:26 +00:00 |
| Good.Newwz.2019.720p.WEBRip.x264.AAC-[YTS.MX].srt |
415.505 |
13.07.2023 09:18:27 +00:00 |
| grand.isle.(8707943).nfo |
6.437 |
21.09.2021 15:04:32 +00:00 |
| Grand.Isle.2019.1080p.BluRay.x264.AAC5.1-[YTS.LT].srt |
78.101 |
21.09.2021 18:03:52 +00:00 |
| grand.theft.auto.girls.(8095523).nfo |
6.188 |
19.09.2021 20:29:28 +00:00 |
| Grand.Theft.Auto.Girls.2020.1080p.WEB-DL.DD5.1.H264-FGT.srt |
80.594 |
19.09.2021 23:29:02 +00:00 |
| greed.(8198176).nfo |
6.520 |
20.09.2021 11:39:56 +00:00 |
| greed.(9933261).nfo |
6.354 |
24.03.2024 20:29:44 +00:00 |
| Greed.2019.1080p.WEB-DL.x264-NTG.srt |
145.920 |
24.03.2024 23:29:45 +00:00 |
| Greed.2020.HDRip.XviD.AC3-EVO.srt |
152.819 |
20.09.2021 14:39:25 +00:00 |
| green.rush.(8307080).nfo |
6.437 |
3.09.2021 02:28:12 +00:00 |
| Green.Rush.2020.HDRip.XviD.AC3-EVO.srt |
78.525 |
3.09.2021 05:27:42 +00:00 |
| greenlight.(8107022).nfo |
6.271 |
18.09.2021 01:12:36 +00:00 |
| Greenlight.2020.1080p.WEBRip.x264-RARBG.srt |
89.623 |
18.09.2021 04:12:23 +00:00 |
| Gretel.and.Hansel.2020.1080p.WEB-DL.DD5.1.x264-CMRG.srt |
55.338 |
18.09.2021 04:13:23 +00:00 |
| gretel.hansel.(8176811).nfo |
6.437 |
18.09.2021 01:13:36 +00:00 |
| greyhound.(8282270).nfo |
6.271 |
4.09.2021 05:17:44 +00:00 |
| Greyhound.2020.1080p.WEB.H264-SECRECY.srt |
87.890 |
4.09.2021 08:17:06 +00:00 |
| greyhound.attack.(7701238).nfo |
6.437 |
23.09.2021 21:53:58 +00:00 |
| Greyhound.Attack.2019.1080p.BluRay.x264.DTS-FGT.srt |
65.875 |
24.09.2021 00:53:01 +00:00 |
| gripped.climbing.the.killer.(8313083).nfo |
6.354 |
19.08.2021 07:51:10 +00:00 |
| Gripped.Climbing.the.Killer.Pillar.2020.HDRip.XviD.AC3-EVO.srt |
63.399 |
19.08.2021 10:50:22 +00:00 |
| gua-hellbound-sd.srt |
94.077 |
24.09.2021 14:41:30 +00:00 |
| Guardians of the Galaxy Vol-2 2017 1080p HD-TS x264-24HD.srt |
102.460 |
30.10.2021 18:36:40 +00:00 |
| guardians.of.the.galaxy.vol.2.(7018709).nfo |
6.520 |
30.10.2021 15:37:38 +00:00 |
| guava.island.(7719542).nfo |
6.271 |
12.07.2023 23:09:30 +00:00 |
| Guava.Island.2019.720p.AMZN.WEB-DL.DDP5.1.H.264-NTG_tur.srt |
24.954 |
13.07.2023 02:09:30 +00:00 |
| guest.artist.(8293222).nfo |
6.437 |
25.09.2021 15:13:38 +00:00 |
| Guest.Artist.2020.HDRip.XviD.AC3-EVO.srt |
91.294 |
25.09.2021 18:13:29 +00:00 |
| guest.of.honour.(8293218).nfo |
6.437 |
20.09.2021 11:40:00 +00:00 |
| Guest.Of.Honour.2020.HDRip.XviD.AC3-EVO.srt |
88.430 |
20.09.2021 14:39:28 +00:00 |
| gulabo.sitabo.(8245396).nfo |
6.520 |
1.09.2021 11:40:50 +00:00 |
| Gulabo.Sitabo.2020.1080p.AMZN.WEB-DL.DDP.5.1.H.265-Telly.srt |
144.931 |
1.09.2021 14:40:30 +00:00 |
| Gunjan Saxena The Kargil Girl (2020) Hindi 720p NF WEBRip x264 AAC 5.1 MSubs - LOKiHD - Telly (Turkish).srt |
100.511 |
15.09.2021 20:29:23 +00:00 |
| gunjan.saxena.the.kargil.girl.(8314904).nfo |
6.354 |
15.09.2021 17:30:22 +00:00 |
| guru.guru.gokil.(8320115).nfo |
6.354 |
18.09.2021 01:11:40 +00:00 |
| gutterbug.(8313429).nfo |
6.437 |
18.07.2023 22:39:06 +00:00 |
| Gutterbug.2019.HDRip.XviD.AC3-EVO.srt |
104.066 |
19.07.2023 01:39:07 +00:00 |
| half.white.(8331592).nfo |
6.354 |
2.09.2021 13:53:14 +00:00 |
| Halston (2019).est.srt |
91.656 |
26.09.2021 22:48:45 +00:00 |
| halston.(8045698).nfo |
6.354 |
26.09.2021 19:49:02 +00:00 |
| hamilton.(8266110).nfo |
6.520 |
4.09.2021 05:18:42 +00:00 |
| hamilton.2020.720p.web.h264-watcher.srt |
283.549 |
4.09.2021 08:18:04 +00:00 |
| handy.dandy.(7914736).nfo |
6.271 |
26.09.2021 05:44:12 +00:00 |
| handy.dandy.(7916794).nfo |
6.437 |
20.04.2024 11:57:26 +00:00 |
| Handy.Dandys.2019.1080p.WEB-DL.DD2.0.H264-FGT.srt |
85.559 |
26.09.2021 08:44:00 +00:00 |
| hang.time.(9166996).nfo |
6.437 |
20.08.2023 10:18:22 +00:00 |
| Hang.Time.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
112.343 |
20.08.2023 13:18:24 +00:00 |
| hannah.gadsby.douglas.(8263579).nfo |
6.437 |
27.08.2021 19:09:10 +00:00 |
| Hannah.Gadsby.Douglas.2020.720p.WEB.H264-AMRAP.srt |
100.794 |
27.08.2021 22:08:23 +00:00 |
| happy.death.day.2u.(7734449).nfo |
6.271 |
22.09.2021 18:49:04 +00:00 |
| Happy.Death.Day.2U.2019.720p.WEBRip.x264-.YTS.AM.srt |
83.702 |
22.09.2021 21:48:15 +00:00 |
| happy.happy.joy.joy.the.ren.(9485580).nfo |
6.354 |
13.04.2023 10:38:46 +00:00 |
| Happy.Happy.Joy.Joy.The.Ren.and.Stimpy.Story.2020.SDR.2160p.WEB-DL.DD5.1.H.264-ROCCaT.srt |
132.778 |
13.04.2023 13:38:47 +00:00 |
| hard.kill.(8433629).nfo |
6.354 |
16.09.2021 19:54:54 +00:00 |
| Hard.Kill.2020.720p1080p.WEBRip.x264.AAC-[YTS.MX]-Turkish2.srt |
68.960 |
16.09.2021 22:54:50 +00:00 |
| healing.river.(8217362).nfo |
6.271 |
14.09.2021 23:24:26 +00:00 |
| Healing.River.1080p.AMZN.WEB.ENG HI.srt |
126.991 |
15.09.2021 02:23:32 +00:00 |
| heartbeat.(8299842).nfo |
6.271 |
13.09.2021 05:17:12 +00:00 |
| Heartbeat.2020.720p.AMZN.WEBRip.800MB.x264-GalaxyRG.srt |
103.605 |
13.09.2021 08:16:31 +00:00 |
| Heavenquest.A.Pilgrim's.Progress.2020.1080p.WEBRip.x264.AAC5.1-.YTS.MX.srt |
50.220 |
28.08.2021 15:58:02 +00:00 |
| heavenquest.a.pilgrim.s.progress.(8393804).nfo |
6.437 |
28.08.2021 12:58:54 +00:00 |
| hell.girl.(7739504).nfo |
6.437 |
23.07.2023 05:59:42 +00:00 |
| Hellgirl.2019.BRRip.XviD.AC3-EVO.srt |
54.336 |
23.07.2023 08:59:43 +00:00 |
| her.name.was.christa.(8190035).nfo |
6.271 |
8.09.2021 20:04:38 +00:00 |
| Her.Name.Was.Christa.2020.1080p.WEB-DL.x264.srt |
115.662 |
8.09.2021 23:04:27 +00:00 |
| hidden.orchard.mysteries.the.(8248842).nfo |
6.366 |
2.09.2021 01:35:14 +00:00 |
| Hidden.Orchard.Mysteries.The.Case.of.the.Air.B.and.B.Robbery.2020.HDRip.XviD.AC3-EVO.srt |
123.635 |
2.09.2021 04:34:51 +00:00 |
| his.father.s.voice.(7948180).nfo |
6.354 |
5.09.2023 12:42:22 +00:00 |
| His.Fathers.Voice.2019.1080p.WEB-DL.DD2.0.H264-FGT.srt |
52.635 |
5.09.2023 15:42:22 +00:00 |
| hitman.agent.jun.(8337110).nfo |
6.354 |
19.09.2021 20:28:20 +00:00 |
| Hitman.Agent.Jun.2020.KOREAN.1080p.NF.WEBRip.DDP5.1.x264-tG1R0.srt |
99.355 |
19.09.2021 23:27:53 +00:00 |
| hitmen.reunion.(8824807).nfo |
6.271 |
2.04.2024 16:52:04 +00:00 |
| Hitmen.S02E01.1080p.WEB.H264-GLHF-NHI.srt |
27.962 |
2.04.2024 16:52:04 +00:00 |
| Holly Slept Over 2020 1080p.txt |
97.940 |
11.09.2021 14:54:47 +00:00 |
| holly.slept.over.(8154789).nfo |
6.188 |
11.09.2021 11:55:16 +00:00 |
| home.sweet.home.(8192253).nfo |
6.520 |
9.09.2021 16:28:48 +00:00 |
| Home.Sweet.Home.2020.HDRip.XviD.AC3-EVO-HI.srt |
77.527 |
9.09.2021 19:28:31 +00:00 |
| homeward.(8115817).nfo |
6.437 |
25.08.2021 17:51:50 +00:00 |
| Homeward.2020.720p.WEBRip.x264.AAC-.YTS.MX.srt |
108.674 |
25.08.2021 20:51:18 +00:00 |
| hooking.up.(8133727).nfo |
6.437 |
15.09.2021 17:32:08 +00:00 |
| Hooking.Up.2020.HDRip.XviD.AC3-EVO.srt |
122.171 |
15.09.2021 20:31:09 +00:00 |
| hope.gap.(8240045).nfo |
6.354 |
13.07.2023 19:09:32 +00:00 |
| Hope.Gap.2020.1080p.WEB-DL.H264.AC3-EVO.srt |
99.844 |
13.07.2023 22:09:32 +00:00 |
| horse.camp.a.love.tail.(8217071).nfo |
6.437 |
25.08.2021 17:51:36 +00:00 |
| Horse.Camp.A.Love.Tail.2020.HDRip.XviD.AC3-EVO.srt |
101.242 |
25.08.2021 20:51:03 +00:00 |
| host.(8336192).nfo |
6.354 |
18.08.2021 10:24:24 +00:00 |
| Host.srt |
56.310 |
18.08.2021 13:23:43 +00:00 |
| Hotel by the River (2018).srt |
74.160 |
19.08.2023 06:19:23 +00:00 |
| hotel.mumbai.(7816309).nfo |
6.354 |
20.08.2023 09:55:44 +00:00 |
| Hotel.Mumbai.2018.1080p.BluRay.H264.AAC-RARBG.srt |
99.899 |
20.08.2023 12:55:45 +00:00 |
| how.to.fake.a.war.(8310005).nfo |
6.437 |
18.09.2021 15:46:58 +00:00 |
| How.To.Fake.A.War.2020.HDRip.XviD.AC3-EVO.srt |
92.652 |
18.09.2021 18:46:40 +00:00 |
| how.to.train.your.dragon.the.(7706838).nfo |
6.354 |
22.09.2021 18:48:02 +00:00 |
| How.to.Train.Your.Dragon.The.Hidden.World.2019.1080p.WEB-DL.DD5.1.H264-FGT.tr.srt |
62.916 |
22.09.2021 21:47:14 +00:00 |
| human.capital.(8266799).nfo |
6.520 |
22.08.2021 15:47:08 +00:00 |
| Human.Capital.2020.HDRip.XviD.AC3-EVO.srt |
94.231 |
22.08.2021 18:46:58 +00:00 |
| human.nature.(8320063).nfo |
6.354 |
26.09.2021 05:44:24 +00:00 |
| Human.Nature.2019.1080p.AMZN.WEB-DL.DDP5.1.H.264-TEPES.srt |
133.384 |
26.09.2021 08:44:11 +00:00 |
| human.zoo.(8198203).nfo |
6.437 |
11.09.2021 22:00:02 +00:00 |
| Human.Zoo.2020.HDRip.XviD.AC3-EVO.srt |
110.483 |
12.09.2021 00:59:29 +00:00 |
| hunter.s.moon.(8149243).nfo |
6.354 |
27.08.2021 19:10:04 +00:00 |
| hustlers.(8022925).nfo |
6.354 |
23.09.2021 08:18:26 +00:00 |
| Hustlers.2019.1080p.BluRay.x264-AAA.srt |
111.961 |
23.09.2021 11:17:34 +00:00 |
| I Am Woman.2020.HDRip.XviD.AC3-EVO.srt |
124.845 |
21.09.2021 04:54:11 +00:00 |
| I Still Believe.srt |
93.103 |
4.09.2021 01:16:04 +00:00 |
| i.am.fear.(8101813).nfo |
6.354 |
23.08.2021 07:23:16 +00:00 |
| I.Am.Fear.2020.720p.BluRay.800MB.x264-GalaxyRG.srt |
64.848 |
23.08.2021 10:23:01 +00:00 |
| i.am.mother.(7793393).nfo |
6.354 |
27.03.2023 19:14:20 +00:00 |
| I.Am.Mother.2019.720p.NF.WEB-DL.DDP5.1.x264-NTG TR.srt |
61.646 |
27.03.2023 22:14:20 +00:00 |
| i.am.vengeance.retaliation.(8252066).nfo |
6.437 |
23.08.2021 00:32:10 +00:00 |
| I.Am.Vengeance.Retaliation.2020.HDRip.XviD.AC3-EVO.srt |
54.259 |
23.08.2021 03:31:56 +00:00 |
| i.am.woman.(8330368).nfo |
6.520 |
21.09.2021 01:54:46 +00:00 |
| i.got.five.on.it.3.(8179244).nfo |
6.437 |
27.08.2021 19:10:38 +00:00 |
| I.Got.Five.On.It.3.2020.720p.WEBRip.X264.AAC.2.0-EVO-HI.srt |
134.969 |
27.08.2021 22:09:50 +00:00 |
| i.still.believe.(8291768).nfo |
6.354 |
3.09.2021 22:16:40 +00:00 |
| i.trapped.the.devil.(8209113).nfo |
6.437 |
10.07.2023 11:21:28 +00:00 |
| I.Trapped.the.Devil.2019.1080p.BluRay.H264.AAC-RARBG.tr.srt |
32.310 |
10.07.2023 14:21:29 +00:00 |
| i.used.to.go.here.(8309995).nfo |
6.437 |
14.09.2021 23:23:06 +00:00 |
| I.Used.to.Go.Here.2020.1080p.WEB-DL.DD5.1.H264-CMRG.srt |
84.976 |
15.09.2021 02:22:13 +00:00 |
| i.will.make.you.mine.(8223468).nfo |
6.354 |
27.08.2021 19:10:32 +00:00 |
| I.Will.Make.You.Mine.2020.HDRip.XviD.AC3-EVO.srt |
77.068 |
27.08.2021 22:09:46 +00:00 |
| ice.cream.in.the.cupboard.(8300748).nfo |
6.520 |
16.09.2021 19:57:16 +00:00 |
| Ice.Cream.In.The.Cupboard.2019.HDRip.XviD.AC3-EVO.srt |
76.554 |
16.09.2021 22:57:11 +00:00 |
| Im.No.Longer.Here.2019.720p.NF.WEB-DL.DD+5.1.x264-iKA_tur.srt |
70.069 |
24.09.2021 14:41:14 +00:00 |
| impossible.monsters.(8128546).nfo |
6.437 |
21.09.2021 01:54:02 +00:00 |
| Impossible.Monsters.2019.720p.BluRay.x264-CADAVER.srt |
68.205 |
21.09.2021 04:53:27 +00:00 |
| impractical.jokers.the.movie.(8153723).nfo |
6.520 |
18.09.2021 01:13:46 +00:00 |
| Impractical.Jokers.The.Movie.2020.HDRip.XviD.AC3-EVO.srt |
161.476 |
18.09.2021 04:13:32 +00:00 |
| in.deep.with.ryan.lochte.(8324954).nfo |
6.437 |
18.09.2021 15:46:54 +00:00 |
| In.Deep.With.Ryan.Lochte.2020.1080p.WEBRip.x265-RARBG.srt |
102.972 |
18.09.2021 18:46:36 +00:00 |
| in.search.of.the.last.action.(8097532).nfo |
6.437 |
18.07.2023 12:44:24 +00:00 |
| In.Search.of.the.Last.Action.Heroes.2019.1080p.BluRay.H264.AAC-RARBG.srt |
190.025 |
18.07.2023 15:44:26 +00:00 |
| in.the.trap.(8166483).nfo |
6.520 |
27.08.2021 19:09:38 +00:00 |
| In.The.Trap.2019.HDRip.XviD.AC3-EVO.srt |
56.660 |
27.08.2021 22:08:52 +00:00 |
| Incident at Montauk 2019.srt |
33.705 |
22.07.2023 12:28:22 +00:00 |
| incident.at.guilt.ridge.(8306581).nfo |
6.354 |
2.09.2021 13:54:00 +00:00 |
| Incident.At.Guilt.Ridge.2020.720p.WEBRip.x264.AAC-YTS.MX.srt |
56.255 |
2.09.2021 16:53:34 +00:00 |
| incident.at.montauk.(7703224).nfo |
6.271 |
22.07.2023 09:28:22 +00:00 |
| infamous.(8244419).nfo |
6.520 |
1.09.2021 11:41:40 +00:00 |
| Infamous.2020.HDRip.XviD.AC3-EVO.srt |
82.280 |
1.09.2021 14:41:22 +00:00 |
| Infestation.2020.HDRip.XviD.AC3-EVO.srt |
78.141 |
21.09.2021 04:53:22 +00:00 |
| inherit.the.viper.(8060641).nfo |
6.520 |
26.08.2021 23:22:12 +00:00 |
| inheritance.(8221730).nfo |
6.354 |
26.08.2021 23:22:14 +00:00 |
| Inheritance.2020.1080p.WEBRip.x265-RARBG.tr.srt |
99.849 |
27.08.2021 02:21:33 +00:00 |
| Inmate .1; The Rise of Danny Trejo 2019 BeinTV_tur.srt |
148.967 |
23.09.2021 11:17:50 +00:00 |
| inmate.1.the.rise.of.danny.trejo.(8659306).nfo |
6.354 |
23.09.2021 08:18:42 +00:00 |
| inmate.zero.(8393954).nfo |
6.271 |
11.09.2021 22:00:24 +00:00 |
| instapsycho.(8315197).nfo |
6.437 |
29.08.2021 19:28:50 +00:00 |
| InstaPsycho.2020.1080p.AMZN.WEB-DL.DDP5.1.H.264-pawel2006.srt |
92.283 |
29.08.2021 22:28:49 +00:00 |
| Into.the.Dark.S01E06.Treehouse.1080p.HULU.WEB-DL.AAC.H.264-monkee.srt |
85.331 |
28.03.2023 16:17:42 +00:00 |
| into.the.dark.treehouse.(7682859).nfo |
6.435 |
28.03.2023 13:17:42 +00:00 |
| intruder.(8332131).nfo |
6.437 |
20.08.2021 13:28:20 +00:00 |
| intruder.(8393923).nfo |
6.437 |
7.09.2021 14:01:18 +00:00 |
| Intruder.2020.KOREAN.1080p.WEBRip.AAC2.0.x264-NOGRP.srt |
84.790 |
20.08.2021 16:27:24 +00:00 |
| Intruder.2020.KOREAN.720p.BluRay.H264.AAC-VXT.srt |
72.508 |
7.09.2021 17:01:17 +00:00 |
| intuition.(8226302).nfo |
6.355 |
19.09.2021 20:28:30 +00:00 |
| Intuition.2020.1080p.WEB-DL.DDP5.1.H264-CMRG.srt |
111.472 |
19.09.2021 23:28:02 +00:00 |
| invader.zim.enter.the.florpus.(7868469).nfo |
6.271 |
22.09.2021 18:48:40 +00:00 |
| Invader.ZIM.Enter.the.Florpus.2019.1080p.NF.WEB-DL.DDP5.1.x264_tur.srt |
72.766 |
22.09.2021 21:47:52 +00:00 |
| invasion.(8275499).nfo |
6.520 |
25.08.2021 17:52:38 +00:00 |
| irresistible.(8492026).nfo |
6.354 |
10.09.2021 15:30:32 +00:00 |
| Irresistible.2020.1080p.BluRay.x264.AAC5.1-[YTS.MX].srt |
135.490 |
10.09.2021 18:30:09 +00:00 |
| Isi . Ossi.tr.srt |
124.823 |
27.08.2021 02:21:57 +00:00 |
| isi.ossi.(8160291).nfo |
6.354 |
26.08.2021 23:22:38 +00:00 |
| Jack Whitehall Im Only Joking 2020.srt |
75.860 |
27.08.2021 22:08:46 +00:00 |
| jack.whitehall.i.m.only.joking.(8293412).nfo |
6.271 |
27.08.2021 19:09:32 +00:00 |
| jacob.s.ladder.(7922628).nfo |
6.271 |
24.09.2021 11:41:12 +00:00 |
| Jacobs Ladder.srt |
63.124 |
24.09.2021 14:41:12 +00:00 |
| jagdzeit.(8270257).nfo |
6.437 |
11.09.2021 22:00:42 +00:00 |
| jailbreak.pact.(8332295).nfo |
6.437 |
1.09.2021 11:41:20 +00:00 |
| jailbreak.pact.(8871971).nfo |
6.354 |
19.11.2021 15:32:06 +00:00 |
| Jailbreak.Pact.2020.SPANISH.1080p.AMZN.WEBRip.DDP5.1.x264-NOGRP.srt |
99.490 |
1.09.2021 14:41:00 +00:00 |
| Jailbreak.Pact.2020.SPANISH.1080p.WEBRip.x264-VXT.srt |
90.445 |
19.11.2021 18:32:07 +00:00 |
| james.veitch.straight.to.vhs.(8323143).nfo |
6.188 |
28.08.2021 12:58:38 +00:00 |
| James.Veitch.Straight.to.VHS.2020.WEBRip.x264-ION10.srt |
115.854 |
28.08.2021 15:57:46 +00:00 |
| jarhead.law.of.return.(7917161).nfo |
6.437 |
23.09.2021 08:17:20 +00:00 |
| Jarhead.Law.of.Return.2019.720p.BluRay.x264-ROVERS.srt |
83.805 |
23.09.2021 11:16:28 +00:00 |
| jasper.mall.(8268080).nfo |
6.437 |
22.08.2021 23:04:42 +00:00 |
| Jasper.Mall.2020.1080p.WEBRip.x264.AAC5.1-[YTS.MX].srt |
84.136 |
23.08.2021 02:04:30 +00:00 |
| jesus.(8210705).nfo |
6.437 |
15.09.2021 17:30:34 +00:00 |
| Jesus.2020.HDRip.XviD.AC3-EVO.srt |
128.035 |
15.09.2021 20:29:35 +00:00 |
| jesus.trejo.stay.at.home.son.(8230467).nfo |
6.354 |
19.09.2021 06:06:42 +00:00 |
| Jesus.Trejo.Stay.At.Home.Son.2020.HDTV.x264-aAF.srt |
114.342 |
19.09.2021 09:06:21 +00:00 |
| jim.gaffigan.the.pale.tourist.(8296499).nfo |
6.370 |
4.09.2021 05:17:06 +00:00 |
| Jim.Gaffigan.The.Pale.Tourist.Canadian.American.2020.1080p.WEBRip.x265-RARBG.srt |
52.192 |
4.09.2021 08:16:27 +00:00 |
| jim.jefferies.intolerant.(8274001).nfo |
6.354 |
22.08.2021 14:21:48 +00:00 |
| Jim.Jefferies.Intolerant.2020.720p.WEB.H264-HUZZAH.srt |
92.753 |
22.08.2021 17:21:37 +00:00 |
| jimmy.o.yang.good.deal.(8209323).nfo |
6.520 |
18.09.2021 15:46:50 +00:00 |
| Jimmy.O.Yang.Good.Deal.2020.1080p.AMZN.WEB-DL.DDP5.1.H.264-NTG.EN 23.976.srt |
89.885 |
18.09.2021 18:46:33 +00:00 |
| jo.koy.in.his.elements.(8244630).nfo |
6.354 |
11.09.2021 21:59:42 +00:00 |
| Jo.Koy.In.His.Elements.2020.720p.WEB.H264-HUZZAH.srt |
67.881 |
12.09.2021 00:59:10 +00:00 |
| john.henry.(8070731).nfo |
6.520 |
14.09.2021 23:24:56 +00:00 |
| John.Henry.HDRip.XviD.AC3-EVO-HI.srt |
92.735 |
15.09.2021 02:24:01 +00:00 |
| john.lewis.good.trouble.(8278988).nfo |
6.437 |
11.09.2021 11:53:52 +00:00 |
| john.lewis.good.trouble.2020.1080p.web.h264-adrenaline.srt |
156.955 |
11.09.2021 14:53:24 +00:00 |
| john.light.(8210006).nfo |
6.271 |
26.09.2021 19:47:56 +00:00 |
| John.Light.2019.1080p.WEBRip.x264-RARBG_English.srt |
120.230 |
26.09.2021 22:47:38 +00:00 |
| john.was.trying.to.contact.(8523263).nfo |
6.354 |
22.08.2021 03:13:36 +00:00 |
| John.Was.Trying.to.Contact.Aliens.2020.720p.NF.WEB-DL.DDP5.1.x264-NTG.srt |
13.076 |
22.08.2021 06:13:30 +00:00 |
| john.wick.(6754087).nfo |
6.437 |
11.08.2022 02:49:06 +00:00 |
| John.Wick.2014.BluRay.1080p.DTS-HD.MA.7.1.x264.dxva-FraMeSToR.tur.srt |
36.987 |
11.08.2022 05:49:07 +00:00 |
| John.Wick.3.2019.HDRip.x264-MkvCage.Com.srt |
51.166 |
25.09.2021 03:52:37 +00:00 |
| john.wick.chapter.2.(7000143).nfo |
6.354 |
23.08.2021 21:13:40 +00:00 |
| John.Wick.Chapter.2.2017.1080p.BluRay.x264-SPARKS.srt |
45.453 |
24.08.2021 00:13:20 +00:00 |
| john.wick.chapter.3.parabellum.(7828296).nfo |
6.437 |
25.09.2021 00:52:40 +00:00 |
| jump.shot.the.kenny.sailors.(8263394).nfo |
6.271 |
22.09.2021 04:49:06 +00:00 |
| Jump.Shot.The.Kenny.Sailors.Story.2019.1080p.WEBRip.x264.AAC5.1-[YTS.MX].srt |
141.568 |
22.09.2021 07:48:22 +00:00 |
| jungle.beat.the.movie.(8258312).nfo |
6.520 |
1.09.2021 11:41:10 +00:00 |
| Jungle.Beat.The.Movie.2020.HDRip.XviD.AC3-EVO.srt |
73.893 |
1.09.2021 14:40:50 +00:00 |
| justice.league.dark.apokolips.(8224278).nfo |
6.354 |
9.09.2021 16:27:56 +00:00 |
| Justice.League.Dark.Apokolips.War.2020.1080p.WEBRip.x264.AAC5.1-[YTS.MX].srt |
78.683 |
9.09.2021 19:27:41 +00:00 |
| justine.(8323559).nfo |
6.354 |
23.09.2021 21:53:34 +00:00 |
| Justine.2019.720p.AMZN.WEB-DL.srt |
118.042 |
24.09.2021 00:52:37 +00:00 |
| k.12.(7885146).nfo |
6.437 |
19.08.2023 03:59:08 +00:00 |
| K.12.2019.1080p.WEB-DL.H264.AC3-EVO-German.srt |
106.798 |
19.08.2023 06:59:08 +00:00 |
| kal.penn.approves.this.message.(8369546).nfo |
6.369 |
28.03.2024 13:22:34 +00:00 |
| Kal.Penn.Approves.This.Message.S01E01.720p.WEB.h264-BAE.srt |
44.149 |
28.03.2024 13:22:34 +00:00 |
| kaptein.sabeltann.og.den.magiske.(8116348).nfo |
6.437 |
14.09.2021 23:24:46 +00:00 |
| kat.and.the.band.(8314148).nfo |
6.437 |
15.09.2021 17:30:48 +00:00 |
| Kat.And.The.Band.2019.720p.WEBRip.x264.AAC-[YTS.MX].srt |
109.272 |
15.09.2021 20:29:50 +00:00 |
| Khuda Haafiz 2020 x264 720p HD-Hindi GOPI SAHI.SRT |
87.666 |
11.10.2023 11:00:20 +00:00 |
| khuda.haafiz.(8321822).nfo |
6.437 |
11.09.2021 22:00:14 +00:00 |
| khuda.haafiz.(9723902).nfo |
6.354 |
11.10.2023 08:00:20 +00:00 |
| Khuda.Haafiz.2020.1080p.DSNP.WEB-DL.DD+5.1.x264-Telly_Subtitles01.ENG.tr.srt |
78.263 |
12.09.2021 00:59:41 +00:00 |
| kidnapping.stella.(7830101).nfo |
6.188 |
26.09.2021 19:48:54 +00:00 |
| Kidnapping.Stella.20191080p.NF.MULTI.WEB-DL.DDP5.1.H264-CMRG_tur.srt |
39.438 |
26.09.2021 22:48:37 +00:00 |
| Kill Chain (2020).srt |
67.811 |
12.09.2021 01:00:05 +00:00 |
| kill.chain.(8650026).nfo |
6.354 |
11.09.2021 22:00:36 +00:00 |
| kill.it.and.leave.this.town.(8582231).nfo |
6.354 |
14.09.2021 23:25:04 +00:00 |
| Kill.It.And.Leave.This.Town.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
70.199 |
15.09.2021 02:24:11 +00:00 |
| Killer Camera Monsters (2020) WEBRip 1080p YTS .YIFY.srt |
79.620 |
28.08.2021 15:57:58 +00:00 |
| killer.camera.monsters.(8046515).nfo |
6.354 |
28.08.2021 12:58:50 +00:00 |
| killer.raccoons.2.dark.christmas.(8285351).nfo |
6.437 |
22.09.2021 18:48:58 +00:00 |
| Killer.Raccoons.2.Dark.Christmas.In.The.Dark.2020.HDRip.XviD.AC3-EVO.srt |
118.131 |
22.09.2021 21:48:10 +00:00 |
| Killer.Tattooist.2020.720p.WEBRip.800MB.x264-GalaxyRG-HI.srt |
73.161 |
12.09.2021 01:00:27 +00:00 |
| klovn.the.final.(8259159).nfo |
6.354 |
20.08.2021 09:47:26 +00:00 |
| Klovn.The.Final.2020.DANISH.1080p.BluRay.x264-CONDITION.srt |
96.838 |
20.08.2021 12:46:32 +00:00 |
| Kong Skull Island 2017 HDCAM x264 HQMic AC3-WhoOpiN.srt |
79.042 |
1.09.2021 15:27:40 +00:00 |
| kong.skull.island.(6937034).nfo |
6.520 |
1.09.2021 12:28:00 +00:00 |
| Korku Evi (2020).srt |
46.016 |
30.12.2022 15:45:42 +00:00 |
| la.llorona.(8357495).nfo |
6.520 |
11.09.2021 02:02:06 +00:00 |
| La.Llorona.2019.WEB-DL.WEBRip.HDRip.srt |
52.277 |
11.09.2021 05:01:39 +00:00 |
| lady.driver.(8786177).nfo |
6.437 |
15.09.2021 17:31:16 +00:00 |
| Lady.Driver.2020.1080p.BluRay.x264-JustWatch.srt |
77.436 |
15.09.2021 20:30:17 +00:00 |
| lake.artifact.(8054730).nfo |
6.437 |
22.09.2021 04:49:34 +00:00 |
| Lake.Artifact.2019.1080p.WEB-DL.DD2.0.H264-FGT.srt |
61.401 |
22.09.2021 07:48:50 +00:00 |
| Last and First Men 2020 BRRip Bluray sub ita [SRT project].srt |
25.360 |
12.09.2021 00:59:47 +00:00 |
| last.and.first.men.(8229917).nfo |
6.437 |
11.09.2021 22:00:20 +00:00 |
| last.letter.(8458817).nfo |
6.354 |
27.08.2021 19:10:30 +00:00 |
| Last.Letter.2020.JAPANESE.1080p.BluRay.x265-VXT.CHS.srt |
87.344 |
27.08.2021 22:09:43 +00:00 |
| last.moment.of.clarity.(8219762).nfo |
6.284 |
18.08.2021 06:34:57 +00:00 |
| Last.Moment.Of.Clarity.2020.WEB-DL.x264-FGT-TR.srt |
54.064 |
18.08.2021 06:34:43 +00:00 |
| last.shot.(8328360).nfo |
6.354 |
15.09.2021 17:31:22 +00:00 |
| Last.Shot.2020.HDRip.XviD.AC3-EVO.srt |
101.476 |
15.09.2021 20:30:23 +00:00 |
| lazy.susan.(8156887).nfo |
6.354 |
18.09.2021 01:13:24 +00:00 |
| Lazy.Susan.2020.HDRip.XviD.AC3-EVO.srt |
124.236 |
18.09.2021 04:13:11 +00:00 |
| lection.(8262759).nfo |
6.520 |
27.07.2023 16:48:26 +00:00 |
| Lection.2019.HDRip.XviD.AC3-EVO.srt |
13.844 |
27.07.2023 19:48:26 +00:00 |
| Legacy of Lies.srt |
64.404 |
11.09.2021 14:54:35 +00:00 |
| legacy.(8517600).nfo |
6.437 |
5.09.2021 19:53:06 +00:00 |
| Legacy.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
74.004 |
5.09.2021 22:52:16 +00:00 |
| legacy.of.lies.(8339359).nfo |
6.354 |
11.09.2021 11:55:04 +00:00 |
| Lego.DC.Shazam.Magic.And.Monsters.2020.HDRip.XviD.AC3-EVO.srt |
93.835 |
4.09.2021 01:15:03 +00:00 |
| lego.dc.shazam.magic.monsters.(8188717).nfo |
6.437 |
3.09.2021 22:15:40 +00:00 |
| lemonade.(7903278).nfo |
6.354 |
24.09.2021 11:41:38 +00:00 |
| Lemonade.TR.srt |
77.319 |
24.09.2021 14:41:38 +00:00 |
| les.miserables.(8447114).nfo |
6.354 |
26.09.2021 19:47:58 +00:00 |
| les.miserables.the.staged.(8191399).nfo |
6.437 |
25.09.2021 00:52:20 +00:00 |
| Les.Miserables.The.Staged.Concert.2019.720p.WEBRip.900MB.x264-GalaxyRG.srt |
175.228 |
25.09.2021 03:52:16 +00:00 |
| Les.Mis�rables.2019.1080p.BluRay.x264.AAC5.1-[YTS.MX].tr.srt |
95.690 |
26.09.2021 22:47:41 +00:00 |
| letters.from.a.nut.(8187640).nfo |
6.271 |
22.09.2021 18:48:50 +00:00 |
| Letters.From.a.Nut.2019.1080p.WEBRip.x264.srt |
105.531 |
22.09.2021 21:48:02 +00:00 |
| like.a.boss.(8200206).nfo |
6.354 |
10.09.2021 05:03:00 +00:00 |
| Like.A.Boss.2020.720p.WEB-DL.H264.AC3-EVO.srt |
124.294 |
10.09.2021 08:02:39 +00:00 |
| limerence.(8286245).nfo |
6.354 |
27.08.2021 19:10:08 +00:00 |
| Limerence.2017.WEBRip.XviD.MP3-XVID.srt |
128.059 |
27.08.2021 22:09:21 +00:00 |
| linda.ronstadt.the.sound.of.my.(8803786).nfo |
6.437 |
25.09.2021 00:52:14 +00:00 |
| Linda.Ronstadt.The.Sound.Of.My.Voice.2019.1080p.BluRay.x264.AAC5.1-[YTS.LT].srt |
142.267 |
25.09.2021 03:52:09 +00:00 |
| lionheart.(7598454).nfo |
6.354 |
28.08.2023 09:24:52 +00:00 |
| Lionheart.2018.1080p.WEB-DL.X264.AC3 TR.srt |
111.855 |
28.08.2023 12:24:52 +00:00 |
| Little Monsters 2019 1080p WEB-DL X264 AC3-EVO.srt |
99.008 |
26.09.2021 08:43:50 +00:00 |
| little.birds.episode.1.2.(8310874).nfo |
6.437 |
29.03.2024 11:09:22 +00:00 |
| Little.Birds.S01E02.2160p.WEB.H265-PETRiFiED.srt |
46.936 |
29.03.2024 11:09:22 +00:00 |
| little.monsters.(7992154).nfo |
6.354 |
26.09.2021 05:44:02 +00:00 |
| little.white.lies.2.(9004000).nfo |
6.354 |
28.03.2023 10:51:06 +00:00 |
| Little.White.Lies.2.2019.720p.BluRay.x264.AAC-YTS.srt |
123.591 |
28.03.2023 13:51:06 +00:00 |
| little.women.(8091173).nfo |
6.437 |
28.03.2023 15:53:48 +00:00 |
| Little.Women.2019.REPACK.DVDScr.XVID.AC3.HQ.Hive-CM8.srt |
122.784 |
28.03.2023 18:53:48 +00:00 |
| long.shot.(7842835).nfo |
6.271 |
18.07.2023 07:58:48 +00:00 |
| Long.Shot.2019.1080p.webrip.srt |
191.091 |
18.07.2023 10:58:49 +00:00 |
| Looks That Kill.srt |
81.953 |
2.09.2021 16:53:13 +00:00 |
| looks.that.kill.(8333566).nfo |
6.354 |
2.09.2021 13:53:40 +00:00 |
| loophole.(7690079).nfo |
6.271 |
22.09.2021 20:48:30 +00:00 |
| Loophole.2019.WEBRip.x264-ION10.srt |
222.839 |
22.09.2021 21:47:42 +00:00 |
| lootcase.(8364646).nfo |
6.354 |
10.09.2021 05:02:02 +00:00 |
| Lootcase.srt |
118.611 |
10.09.2021 08:01:42 +00:00 |
| los.lobos.(8380273).nfo |
6.354 |
25.08.2021 17:52:46 +00:00 |
| Lost Girls (2020) - forumiptv.srt |
80.447 |
29.08.2021 22:28:18 +00:00 |
| Lost S03E06 (2006) I Do HDTV ENGLiSH XoR TR.srt |
31.048 |
18.08.2021 06:34:44 +00:00 |
| lost.a.tale.of.two.cities.(3835511).nfo |
6.285 |
18.08.2021 06:34:57 +00:00 |
| lost.bullet.(8252405).nfo |
6.520 |
29.08.2021 19:27:42 +00:00 |
| Lost.Bullet.2020.720p.WEB.H264-CRYPTIC.srt |
42.360 |
29.08.2021 22:27:42 +00:00 |
| lost.girls.(8320340).nfo |
6.354 |
29.08.2021 19:28:18 +00:00 |
| lost.i.do.(3087209).nfo |
6.367 |
18.08.2021 06:34:58 +00:00 |
| Lost.S02E20.HR.HDTV.XviD-CTU.srt |
31.862 |
18.08.2021 06:34:45 +00:00 |
| Lost.S03E01.720p.BluRay.DTS.x264-BLiND.srt |
23.862 |
18.08.2021 06:34:46 +00:00 |
| lost.transmissions.(8125339).nfo |
6.437 |
21.09.2021 01:54:12 +00:00 |
| Lost.Transmissions.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
108.028 |
21.09.2021 04:53:36 +00:00 |
| lost.two.for.the.road.(6508687).nfo |
6.367 |
18.08.2021 06:34:59 +00:00 |
| love.on.the.rise.(8241067).nfo |
6.271 |
1.09.2021 11:42:04 +00:00 |
| Love.On.The.Rise.2020.1080p.WEB-DL.DD5.1.H.264-CMRG.srt |
80.819 |
1.09.2021 14:41:45 +00:00 |
| love.wedding.repeat.(8166683).nfo |
6.271 |
3.09.2021 22:15:56 +00:00 |
| Love.Wedding.Repeat.2020.720p.iNTERNAL.WEB.x264-SECRECY.srt |
111.226 |
4.09.2021 01:15:20 +00:00 |
| lovecraft.country.a.history.of.(8352385).nfo |
6.271 |
3.04.2024 04:37:16 +00:00 |
| lovecraft.country.full.circle.(8392415).nfo |
6.271 |
29.03.2024 07:17:30 +00:00 |
| lovecraft.country.holy.ghost.(8352384).nfo |
6.271 |
28.03.2024 06:26:34 +00:00 |
| lovecraft.country.i.am.(8371299).nfo |
6.271 |
2.04.2024 20:48:52 +00:00 |
| lovecraft.country.jig.a.bobo.(8378636).nfo |
6.271 |
3.04.2024 06:26:56 +00:00 |
| lovecraft.country.meet.me.in.(8371298).nfo |
6.271 |
2.04.2024 13:54:36 +00:00 |
| lovecraft.country.rewind.1921.(8387603).nfo |
6.271 |
2.04.2024 23:33:46 +00:00 |
| Lovecraft.Country.S01E01.WEB.x264-PHOENiX.srt |
56.873 |
2.04.2024 16:28:12 +00:00 |
| Lovecraft.Country.S01E02.WEB-DL-NTb+ION10.srt |
41.385 |
28.03.2024 15:56:06 +00:00 |
| Lovecraft.Country.S01E05.WEB-DL NTb+ION10+PHOENiX+MiNX+AFG+mSD.srt |
38.836 |
2.04.2024 14:41:40 +00:00 |
| Lovecraft.Country.S01E06.WEB-DL NTb+ION10+PHOENiX+MiNX+AFG+mSD.srt |
37.528 |
2.04.2024 13:54:36 +00:00 |
| Lovecraft.Country.S01E07.1080p.AMZN.WEB-DL.DDP5.1.H.264-NTb.tr.srt |
37.350 |
2.04.2024 20:48:52 +00:00 |
| Lovecraft.Country.S01E08.WEB-DL-NTb+MiNX+ION10+PHOENiX.srt |
35.903 |
3.04.2024 06:26:56 +00:00 |
| Lovecraft.Country.S01E09.1080p.AMZN.WEB-DL.DDP5.1.H.264-NTb.tr.srt |
40.168 |
2.04.2024 23:33:46 +00:00 |
| Lovecraft.Country.S01E10.WEB-DL-NTb+Full.Circle.XviD-AFG+Full.Circle.480p.x264-mSD.srt |
31.867 |
29.03.2024 07:17:30 +00:00 |
| lovecraft.country.strange.case.(8371296).nfo |
6.271 |
2.04.2024 14:41:40 +00:00 |
| lovecraft.country.sundown.(8340767).nfo |
6.354 |
2.04.2024 16:28:12 +00:00 |
| lovecraft.country.whitey.s.on.(8347550).nfo |
6.271 |
28.03.2024 15:56:06 +00:00 |
| Lovers of Di Renjie.srt |
85.931 |
11.09.2021 05:02:04 +00:00 |
| luan.po.(9238156).nfo |
6.354 |
9.11.2022 08:17:46 +00:00 |
| lucky.grandma.(8290032).nfo |
6.437 |
22.09.2021 04:48:42 +00:00 |
| Lucky.Grandma.2019.1080p.WEB-DL.AAC.AVC.srt |
52.671 |
22.09.2021 07:47:57 +00:00 |
| luna.nera.omen.(8082488).nfo |
6.437 |
29.03.2024 04:04:48 +00:00 |
| luna.nera.omen.(8085299).nfo |
6.271 |
29.03.2024 02:16:42 +00:00 |
| Luna.Nera.S01E01.ITALIAN.720p.NF.WEB-DL.DDP5.1.x264-NTG.srt |
30.961 |
29.03.2024 02:16:42 +00:00 |
| Luna.Nera.S01E01.Omen.720p.NF.WEB-DL.DDP5.1.x264-NTG.srt |
36.335 |
29.03.2024 04:04:48 +00:00 |
| mad.mom.(8315454).nfo |
6.437 |
26.09.2021 19:48:52 +00:00 |
| Made in Italy.srt |
62.377 |
15.09.2021 02:25:19 +00:00 |
| made.in.italy.(8499602).nfo |
6.354 |
14.09.2021 23:26:12 +00:00 |
| magic.camp.(8327664).nfo |
6.354 |
3.09.2021 22:15:48 +00:00 |
| Magic.Camp.2020.720p.DSNP.WEBRip.800MB.x264-GalaxyRG.srt |
119.222 |
4.09.2021 01:15:13 +00:00 |
| magnum.dopus.the.making.of.jay.(8315914).nfo |
6.358 |
6.09.2021 15:52:24 +00:00 |
| Magnum.Dopus.The.Making.of.Jay.and.Silent.Bob.Reboot.2020.1080p.WEBRip.x264-RARBG.srt |
178.989 |
6.09.2021 18:51:28 +00:00 |
| Make.America.White.Again.2020.1080p.WEBRip.x264-RARBG.srt |
119.365 |
2.09.2021 16:52:47 +00:00 |
| making.babies.(7816685).nfo |
6.437 |
14.07.2023 18:41:30 +00:00 |
| Making.Babies.2018.1080p.WEB-DL.H264.AC3-EVO.srt |
129.954 |
14.07.2023 21:41:30 +00:00 |
| Malibu Rescue The Next Wave.srt |
70.676 |
4.09.2021 14:56:29 +00:00 |
| Malibu.Rescue.2019.1080p.NF.WEB-DL.DD5.1.H264-CMRG_tur.srt |
79.230 |
21.09.2021 18:04:38 +00:00 |
| malibu.rescue.the.movie.(7753638).nfo |
6.188 |
21.09.2021 15:05:18 +00:00 |
| malibu.rescue.the.next.wave.(8339358).nfo |
6.271 |
4.09.2021 11:57:10 +00:00 |
| manou.the.swift.(8095451).nfo |
6.437 |
19.08.2023 01:16:28 +00:00 |
| Manou.the.Swift.2019.720p.BluRay.800MB.x264-GalaxyRG-HI.srt |
94.547 |
19.08.2023 04:16:29 +00:00 |
| marnies.welt.(7911449).nfo |
6.437 |
26.09.2021 19:48:18 +00:00 |
| matchless.mulan.(8332292).nfo |
6.437 |
4.09.2021 05:17:22 +00:00 |
| Matchless.Mulan.2020.CHINESE.1080p.WEBRip.AAC2.0.x264-NOGRP.srt |
63.138 |
4.09.2021 08:16:44 +00:00 |
| Matthias.and.Maxime.2019.[BluRay+BRRip+BDRip] - renomeie para seu release.srt |
100.597 |
10.07.2023 11:18:20 +00:00 |
| matthias.maxime.(8281225).nfo |
6.437 |
10.07.2023 08:18:20 +00:00 |
| max.reload.and.the.nether.(8310068).nfo |
6.354 |
18.09.2021 15:47:24 +00:00 |
| Max.Reload.and.the.Nether.Blasters.2020.BDRip.XviD.AC3-EVO.srt |
151.918 |
18.09.2021 18:47:07 +00:00 |
| max.winslow.and.the.house.of.(8425584).nfo |
6.437 |
17.08.2022 21:05:22 +00:00 |
| max.winslow.and.the.house.of.(8543875).nfo |
6.354 |
14.09.2021 23:25:44 +00:00 |
| Max.Winslow.and.the.House.of.Secrets.2019.1080p.WEBRip.x264-RARBG.srt |
97.057 |
15.09.2021 02:24:50 +00:00 |
| Max.Winslow.And.The.House.Of.Secrets.2019.720p.WEBRip.x264.AAC-[YTS.MX].srt |
105.981 |
18.08.2022 00:05:22 +00:00 |
| measure.for.measure.(8334797).nfo |
6.437 |
5.09.2021 19:53:30 +00:00 |
| Measure.For.Measure.2019.720p.WEBRip.x264.AAC-[YTS.MX].srt |
58.219 |
5.09.2021 22:52:40 +00:00 |
| men.in.black.international.(7873977).nfo |
6.354 |
25.09.2021 15:12:44 +00:00 |
| Men.in.Black.International.2019.720p.BluRay.x264-GECKOS-TR.srt |
87.158 |
25.09.2021 18:12:35 +00:00 |
| mermaid.down.(7928771).nfo |
6.437 |
15.08.2023 15:49:48 +00:00 |
| Mermaid.Down.2019.HDRip.XviD.AC3-EVO.srt |
51.246 |
15.08.2023 18:49:49 +00:00 |
| merveilles.a.montfermeil.(8323603).nfo |
6.437 |
21.08.2021 07:25:40 +00:00 |
| mighty.oak.(8273942).nfo |
6.437 |
18.08.2021 21:27:52 +00:00 |
| Mighty.Oak.2020.HDRip.XviD.AC3-EVO.srt |
135.232 |
19.08.2021 00:27:09 +00:00 |
| Milea-Suara Dari Dilan (2020) WEB-DL Bangla Subtitle By Sayed Fahmidul Islam [01.39.35].srt |
146.029 |
8.02.2024 12:10:05 +00:00 |
| milea.(9886187).nfo |
6.354 |
8.02.2024 09:10:04 +00:00 |
| milea.suara.dari.dilan.(8246086).nfo |
6.354 |
3.09.2021 15:03:48 +00:00 |
| Milea.Suara.Dari.Dilan.2020.NF.WEB-DL-Deoxys.srt |
97.460 |
3.09.2021 18:03:15 +00:00 |
| military.wives.(8145422).nfo |
6.520 |
22.08.2021 14:04:56 +00:00 |
| Military.Wives.2020.HDRip.XviD.AC3-EVO.srt |
121.968 |
22.08.2021 17:04:47 +00:00 |
| miracle.in.cell.no.7.(8269121).nfo |
6.271 |
22.09.2021 18:47:58 +00:00 |
| Miracle.in.Cell.No.7.2019.720p.NF.WEB-DL.DDP5.1.x264-TEPES_tur.srt |
120.956 |
22.09.2021 21:47:10 +00:00 |
| misbehaviour.(8176489).nfo |
6.354 |
4.09.2021 11:58:20 +00:00 |
| Misbehaviour.2020.HDRip.XviD.AC3-EVO.tr.srt |
121.463 |
4.09.2021 14:57:40 +00:00 |
| Miss Fisher and the Crypt of Tears.srt |
76.517 |
10.09.2021 08:02:58 +00:00 |
| Miss Virginia.en.srt |
140.909 |
25.09.2021 03:52:39 +00:00 |
| miss.fisher.and.the.crypt.of.(8364644).nfo |
6.354 |
10.09.2021 05:03:18 +00:00 |
| miss.juneteenth.(8252061).nfo |
6.520 |
15.09.2021 17:30:38 +00:00 |
| Miss.Juneteenth.2020.HDRip.XviD.AC3-EVO.srt |
84.505 |
15.09.2021 20:29:39 +00:00 |
| Miss.Scarlet.And.The.Duke.S01E01.1080p.WEB-DL.AAC2.0.H.264-PlayWEB[eztv.re].srt |
48.688 |
2.04.2024 16:55:58 +00:00 |
| Miss.Scarlet.And.The.Duke.S01E02.1080p.WEB-DL.AAC2.0.H.264-PlayWEB[eztv.re].srt |
56.759 |
3.04.2024 08:56:18 +00:00 |
| Miss.Scarlet.And.The.Duke.S01E03.1080p.WEB-DL.AAC2.0.H.264-PlayWEB[eztv.re].srt |
58.327 |
2.04.2024 16:48:58 +00:00 |
| Miss.Scarlet.And.The.Duke.S01E04.1080p.WEB-DL.AAC2.0.H.264-PlayWEB[eztv.re].srt |
57.450 |
2.04.2024 17:32:32 +00:00 |
| Miss.Scarlet.And.The.Duke.S01E05.1080p.WEB-DL.AAC2.0.H.264-PlayWEB[eztv.re].srt |
45.924 |
3.04.2024 11:50:50 +00:00 |
| Miss.Scarlet.And.The.Duke.S01E06.1080p.WEB-DL.AAC2.0.H.264-PlayWEB[eztv.re].srt |
53.800 |
28.03.2024 19:31:54 +00:00 |
| miss.scarlet.the.duke.(8642712).nfo |
6.354 |
2.04.2024 16:55:58 +00:00 |
| miss.scarlet.the.duke.cell.99.(8642717).nfo |
6.354 |
3.04.2024 11:50:50 +00:00 |
| miss.scarlet.the.duke.deeds.not.(8642715).nfo |
6.354 |
2.04.2024 16:48:58 +00:00 |
| miss.scarlet.the.duke.memento.(8642716).nfo |
6.354 |
2.04.2024 17:32:32 +00:00 |
| miss.scarlet.the.duke.the.case.(8642719).nfo |
6.356 |
28.03.2024 19:31:54 +00:00 |
| miss.scarlet.the.duke.the.woman.(8642713).nfo |
6.354 |
3.04.2024 08:56:18 +00:00 |
| miss.virginia.(8518668).nfo |
6.271 |
25.09.2021 00:52:44 +00:00 |
| Mister T.srt |
57.916 |
18.07.2023 23:41:58 +00:00 |
| mister.t.(8655365).nfo |
6.354 |
18.07.2023 20:41:58 +00:00 |
| mollywood.(7791787).nfo |
6.271 |
26.09.2021 05:44:00 +00:00 |
| Mollywood.2019.720p.WEBRip.800MB.x264-GalaxyRG.srt |
95.093 |
26.09.2021 08:43:47 +00:00 |
| monos.(8022625).nfo |
6.437 |
25.09.2021 15:13:04 +00:00 |
| Monos.2019.SPANISH.720p.AMZN.WEB-DL.DDP5.1.H264-TOMMY.srt |
38.415 |
25.09.2021 18:12:56 +00:00 |
| monster.hunters.(8522821).nfo |
6.437 |
2.09.2021 01:35:38 +00:00 |
| Monster.Hunters.2020.720p.BluRay.800MB.x264-GalaxyRG.srt |
66.848 |
2.09.2021 04:35:14 +00:00 |
| Monster.Hunters.2020.china.1080p.bluray.mora.25r.srt |
63.555 |
14.09.2021 23:23:56 +00:00 |
| monstrous.(8313419).nfo |
6.437 |
13.09.2021 05:17:24 +00:00 |
| Monstrous.2020.1080p.WEB-DL.DD5.1.H264-CMRG.srt |
46.259 |
13.09.2021 08:16:42 +00:00 |
| Mortal 2020 1080p AMZN WEB-DL DDP5 1 H264-NTG.srt |
39.286 |
22.08.2021 02:25:03 +00:00 |
| mortal.(8431258).nfo |
6.437 |
21.08.2021 23:25:10 +00:00 |
| mortal.kombat.legends.scorpion.s.(8174572).nfo |
6.271 |
18.09.2021 01:13:52 +00:00 |
| Mortal.Kombat.Legends.Scorpions.Revenge.2020.1080p.WEBRip.x264-RARBG.srt |
52.522 |
18.09.2021 04:13:39 +00:00 |
| most.wanted.(8296044).nfo |
6.520 |
3.09.2021 22:15:44 +00:00 |
| Most.Wanted.2020.HDRip.XviD.AC3-EVO.srt |
108.344 |
4.09.2021 01:15:07 +00:00 |
| mr.365.(7984130).nfo |
6.437 |
10.08.2022 09:34:16 +00:00 |
| mrs.serial.killer.(8269201).nfo |
6.271 |
22.08.2021 11:10:32 +00:00 |
| Mrs.Serial.Killer.2020.1080p.NF.WEB-DL.DDP5.1.Atmos.HDR.HEVC-MZABI_tur.srt |
76.765 |
22.08.2021 14:10:23 +00:00 |
| ms.purple.(7994842).nfo |
6.437 |
23.09.2021 21:53:18 +00:00 |
| Ms.Purple.2019.1080p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
36.261 |
24.09.2021 00:52:22 +00:00 |
| mucho.mucho.amor.the.legend.of.(8275433).nfo |
6.437 |
29.08.2021 19:27:54 +00:00 |
| Mucho.Mucho.Amor.The.Legend.of.Walter.Mercado.2020.1080p.NF.WEB-DL.DDP5.1.x264-CMRG.srt |
104.842 |
29.08.2021 22:27:54 +00:00 |
| murder.death.koreatown.(8296485).nfo |
6.437 |
2.09.2021 01:35:16 +00:00 |
| Murder.Death.Koreatown.2020.1080p.WEBRip.x264-RARBG.srt |
117.993 |
2.09.2021 04:34:54 +00:00 |
| murder.manual.(8226815).nfo |
6.271 |
29.08.2021 19:28:02 +00:00 |
| murder.manual.(8383521).nfo |
6.271 |
10.06.2022 01:52:02 +00:00 |
| Murder.Manual.2020.1080p.AMZN.WEB-DL.DDP2.0.H.264-CMRG-HI.srt |
68.606 |
29.08.2021 22:28:02 +00:00 |
| Murder.Manual.2020.720p.AMZN.WEBRip.800MB.x264-GalaxyRG.srt |
41.104 |
10.06.2022 04:52:03 +00:00 |
| murder.rx.(8162556).nfo |
6.354 |
22.08.2021 10:10:44 +00:00 |
| Murder.RX.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
66.205 |
22.08.2021 13:10:36 +00:00 |
| My Adventures with Santa 2019 WEB-DL LOM AAC AVC.x264-RARBG.GR unicode.srt |
121.550 |
22.09.2021 07:48:14 +00:00 |
| My name is Sara |
48.486 |
18.09.2021 18:46:55 +00:00 |
| my.adventures.with.santa.(7972637).nfo |
6.437 |
22.09.2021 04:48:58 +00:00 |
| my.name.is.sara.(8180972).nfo |
6.438 |
18.09.2021 15:47:12 +00:00 |
| my.senior.year.(8277974).nfo |
6.271 |
11.09.2021 11:54:48 +00:00 |
| My.Senior.Year.2020.1080p.WEBRip.x264-RARBG.srt |
109.355 |
11.09.2021 14:54:18 +00:00 |
| my.spy.(8185567).nfo |
6.271 |
3.09.2021 22:16:18 +00:00 |
| My.Spy.2020.1080p.Bluray.DTS-HD.MA.5.1.X264-EVO.srt |
102.086 |
4.09.2021 01:15:42 +00:00 |
| my.zoe.(8445764).nfo |
6.354 |
13.07.2023 16:12:02 +00:00 |
| My.Zoe.2019.1080p.BEIN.WEB-DL.DUAL.AAC2.0.H.264-BdC_track4_[tur].srt |
87.696 |
13.07.2023 19:12:02 +00:00 |
| narco.soldiers.(8388607).nfo |
6.437 |
23.09.2021 21:52:06 +00:00 |
| narco.soldiers.2019.480p.bluray.x264.srt |
80.669 |
24.09.2021 00:51:09 +00:00 |
| Natale.A.Scuola.2018.AMZN.ita.srt |
84.751 |
31.01.2023 10:59:31 +00:00 |
| Nathan's Kingdom.srt |
77.098 |
9.09.2021 19:27:53 +00:00 |
| nathan.s.kingdom.(8336207).nfo |
6.354 |
9.09.2021 16:28:08 +00:00 |
| nation.s.fire.(8629078).nfo |
6.271 |
26.09.2021 19:48:14 +00:00 |
| Nations.Fire.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
53.831 |
26.09.2021 22:47:57 +00:00 |
| Navio de Sangue 2020 1080p BluRay DUAL.srt |
61.659 |
18.07.2023 04:28:54 +00:00 |
| Nereus.2019.REPACK.BDRip.x264-JustWatch.srt |
51.182 |
12.07.2023 21:29:13 +00:00 |
| never.rarely.sometimes.always.(8197779).nfo |
6.520 |
2.09.2021 13:53:26 +00:00 |
| Never.Rarely.Sometimes.Always.2020.HDRip.XviD.AC3-EVO.srt |
49.360 |
2.09.2021 16:52:58 +00:00 |
| never.surrender.a.galaxy.quest.(8099395).nfo |
6.354 |
23.07.2023 08:26:46 +00:00 |
| Never.Surrender.A.Galaxy.Quest.Documentary.2019.720p.WEB.x264.srt |
140.242 |
23.07.2023 11:26:46 +00:00 |
| never.too.late.(8295991).nfo |
6.520 |
2.09.2021 13:53:52 +00:00 |
| never.too.late.(8884950).nfo |
6.354 |
2.12.2021 20:12:16 +00:00 |
| Never.Too.Late.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
87.831 |
2.12.2021 23:11:38 +00:00 |
| Never.Too.Late.2020.HDRip.XviD.AC3-EVO-HI.srt |
108.630 |
2.09.2021 16:53:25 +00:00 |
| nicole.(8309142).nfo |
6.437 |
15.09.2021 17:31:54 +00:00 |
| Nicole.2019.WEBRip.x264-ION10.srt |
58.842 |
15.09.2021 20:30:55 +00:00 |
| night.(7703287).nfo |
6.437 |
17.07.2023 10:43:54 +00:00 |
| Night.2019.720p.WEBRip.x264-.YTS.AM.srt |
31.357 |
17.07.2023 13:43:55 +00:00 |
| night.sweats.(7979141).nfo |
6.437 |
23.09.2021 21:52:40 +00:00 |
| Night.Sweats.2019.720p.WEB-DL.x264.AC3-EVO.srt |
84.828 |
24.09.2021 00:51:43 +00:00 |
| no.apology.(8231415).nfo |
6.437 |
25.09.2021 00:53:42 +00:00 |
| No.Apology.2019.HDRip.XviD.AC3-EVO.srt |
114.333 |
25.09.2021 03:53:37 +00:00 |
| no.turning.back.(8262256).nfo |
6.437 |
8.07.2023 09:33:08 +00:00 |
| No.Turning.Back.2019.HDRip.XviD.AC3-EVO.srt |
97.338 |
8.07.2023 12:33:09 +00:00 |
| nobody.knows.i.m.here.(8257265).nfo |
6.437 |
11.09.2021 02:01:58 +00:00 |
| Nobody.Knows.Im.Here.2020.720p.WEB.H264-CRYPTIC.srt |
52.283 |
11.09.2021 05:01:32 +00:00 |
| norm.of.the.north.family.(8106728).nfo |
6.354 |
29.08.2021 19:28:54 +00:00 |
| Norm.of.the.North.Family.Vacation.2020.HDRip.XviD.AC3-EVO.srt |
67.272 |
29.08.2021 22:28:53 +00:00 |
| nothing.but.the.blood.(8307707).nfo |
6.354 |
4.09.2021 11:57:26 +00:00 |
| Nothing.But.The.Blood.2020.HDRip.XviD.AC3-EVO.srt |
68.610 |
4.09.2021 14:56:46 +00:00 |
| Notre-Dame.du.Nil.2019.720p.WEB.x264-gooz.srt |
64.499 |
20.09.2021 14:39:18 +00:00 |
| notre.dame.du.nil.(8465259).nfo |
6.437 |
20.09.2021 11:39:50 +00:00 |
| nowhere.alaska.(8267518).nfo |
6.437 |
10.09.2021 15:30:30 +00:00 |
| Nowhere.Alaska.2020.720p.AMZN.WEBRip.800MB.x264-GalaxyRG.srt |
76.607 |
10.09.2021 18:30:07 +00:00 |
| O.Herdeiro.das.Drogas.2019.1080p.BluRay.6CH.x264.DUAL.srt |
55.477 |
27.08.2021 02:21:30 +00:00 |
| O.Sequestro.de.Eden.2021.720p.WEB-DL.x264-DUAL.COMANDO.TO.srt |
54.562 |
20.09.2021 14:38:52 +00:00 |
| octonauts.and.the.caves.of.sac.(8322054).nfo |
6.271 |
8.09.2021 20:04:06 +00:00 |
| Octonauts.and.the.Caves.of.Sac.Actun.2020.1080p.NF.WEB-DL.DDP5.1.x264-CMRG_tur.srt |
73.411 |
8.09.2021 23:03:56 +00:00 |
| ode.to.joy.(7916198).nfo |
6.520 |
23.09.2021 08:17:46 +00:00 |
| Ode.To.Joy.2019.1080p.WEB-DL.DD5.1.H264-FGT.srt |
104.551 |
23.09.2021 11:16:54 +00:00 |
| ode.to.passion.(8283969).nfo |
6.354 |
16.09.2021 19:57:32 +00:00 |
| Ode.to.Passion.2020.1080p.WEBRip.x264-RARBG.srt |
162.210 |
16.09.2021 22:57:29 +00:00 |
| offering.to.the.storm.(8296660).nfo |
6.271 |
3.09.2021 15:04:22 +00:00 |
| Offering.to.the.Storm.2020.1080p.NF.WEB-DL.DDP5.1.x264-CMRG_tur.srt |
126.273 |
3.09.2021 18:03:48 +00:00 |
| older.(8334375).nfo |
6.354 |
8.09.2021 20:04:16 +00:00 |
| Older.2020.1080p.AMZN.WEB-DL.DDP2.0.H.264-pawel2006.srt |
88.960 |
8.09.2021 23:04:06 +00:00 |
| olympic.dreams.(8099421).nfo |
6.271 |
27.08.2021 19:10:42 +00:00 |
| olympic.dreams.(9719696).nfo |
6.354 |
6.10.2023 11:54:52 +00:00 |
| Olympic.Dreams.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
67.485 |
6.10.2023 14:54:53 +00:00 |
| Olympic.Dreams.2019.1080p.WEBRip.x264-RARBG_English.srt |
92.562 |
27.08.2021 22:09:55 +00:00 |
| on.the.record.(8225906).nfo |
6.437 |
3.09.2021 22:15:34 +00:00 |
| On.the.Record.2020.1080p.HMAX.WEB-DL.DDP5.1.H.264-NTG.srt |
181.089 |
4.09.2021 01:14:57 +00:00 |
| on.the.trail.inside.the.2020.(8309627).nfo |
6.188 |
14.09.2021 23:23:46 +00:00 |
| On.the.Trail.Inside.the.2020.Primaries.2020.WEBRip.x264-FGT.srt |
156.909 |
15.09.2021 02:22:53 +00:00 |
| once.is.enough.(8281694).nfo |
6.437 |
19.09.2021 20:28:52 +00:00 |
| Once.Is.Enough.2020.1080p.WEBRip.x264-RARBG.srt |
86.756 |
19.09.2021 23:28:26 +00:00 |
| one.glorious.sunset.(8230956).nfo |
6.437 |
27.08.2021 19:09:42 +00:00 |
| One.Glorious.Sunset.2020.720p.AMZN.WEBRip.800MB.x264-GalaxyRG-HI.srt |
86.584 |
27.08.2021 22:08:55 +00:00 |
| one.last.prayer.(8280154).nfo |
6.437 |
9.09.2021 16:28:18 +00:00 |
| One.Last.Prayer.2020.1080p.WEB.h264-RedBlade.srt |
112.790 |
9.09.2021 19:28:01 +00:00 |
| one.man.and.his.shoes.(8224580).nfo |
6.188 |
26.11.2021 14:11:18 +00:00 |
| One.Man.and.His.Shoes.2020.1080p.WEBRip.x264-RARBG.srt |
149.051 |
26.11.2021 17:10:27 +00:00 |
| one.night.in.bangkok.(8377692).nfo |
6.354 |
11.09.2021 21:59:38 +00:00 |
| One.Night.In.Bangkok.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
60.307 |
12.09.2021 00:59:07 +00:00 |
| one.of.the.good.ones.(8162084).nfo |
6.437 |
21.09.2021 01:54:18 +00:00 |
| One.Of.The.Good.Ones.2020.HDRip.XviD.AC3-EVO-HI.srt |
86.622 |
21.09.2021 04:53:43 +00:00 |
| one.way.to.tomorrow.(8252702).nfo |
6.354 |
3.09.2021 22:15:36 +00:00 |
| One.Way.to.Tomorrow.2020.720p.WEB.H264-CRYPTIC.srt |
100.525 |
4.09.2021 01:15:00 +00:00 |
| only.(8147260).nfo |
6.354 |
10.09.2021 15:30:18 +00:00 |
| Only.2020.720p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
47.921 |
10.09.2021 18:29:56 +00:00 |
| only.the.animals.(8323767).nfo |
6.520 |
25.09.2021 15:12:14 +00:00 |
| Onward (2020).tur.srt |
90.309 |
13.09.2021 08:17:05 +00:00 |
| onward.(8211006).nfo |
6.354 |
13.09.2021 05:17:46 +00:00 |
| Open.Season.2020.720p.WEB.h264-iNTENSO.srt |
72.213 |
12.09.2021 01:00:11 +00:00 |
| ordinary.love.(8191310).nfo |
6.271 |
26.09.2021 05:43:44 +00:00 |
| Ordinary.Love.2020.HDRip.x264.AC3-EVO.srt |
70.365 |
26.09.2021 08:43:31 +00:00 |
| otoko.wa.tsurai.yo.50.okaeri.(8478965).nfo |
6.437 |
22.09.2021 04:48:56 +00:00 |
| ouija.shark.(8224462).nfo |
6.437 |
25.08.2021 17:51:40 +00:00 |
| Ouija.Shark.2020.WEBRip.x264-ION10-HI.srt |
63.726 |
25.08.2021 20:51:07 +00:00 |
| our.queen.at.war.(8201715).nfo |
6.354 |
19.09.2021 20:28:28 +00:00 |
| out.stealing.horses.(7816946).nfo |
6.437 |
25.09.2021 15:13:24 +00:00 |
| out.stealing.horses.(8310013).nfo |
6.520 |
15.03.2023 22:21:10 +00:00 |
| outlaws.don.t.get.funerals.(7762364).nfo |
6.437 |
25.09.2021 00:52:56 +00:00 |
| Outlaws.Dont.Get.Funerals.2019.720p.Web.X264.Solar.srt |
104.490 |
25.09.2021 03:52:52 +00:00 |
| outpost.earth.(8002711).nfo |
6.271 |
22.09.2021 18:48:12 +00:00 |
| Outpost.Earth.2019.1080p.AMZN.WEB-DL.DD.ENG.srt |
77.399 |
22.09.2021 21:47:24 +00:00 |
| palm.springs.(8320695).nfo |
6.437 |
4.09.2021 11:58:26 +00:00 |
| Palm.Springs.2020.1080p.WEBRip.x264.AAC5.1-[YTS.MX].srt |
94.546 |
4.09.2021 14:57:46 +00:00 |
| pandamonium.(8232001).nfo |
6.437 |
19.08.2021 22:03:06 +00:00 |
| Pandamonium.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
60.475 |
20.08.2021 01:02:14 +00:00 |
| papicha.(8374405).nfo |
6.354 |
21.09.2021 15:05:24 +00:00 |
| Papicha.2019.BluRay.23fps.tr.srt |
74.462 |
21.09.2021 18:04:43 +00:00 |
| paradise.z.(8365156).nfo |
6.437 |
20.09.2021 11:39:34 +00:00 |
| pariah.the.lives.and.deaths.of.(8112135).nfo |
6.437 |
25.09.2021 00:53:12 +00:00 |
| Pariah.The.Lives.and.Deaths.of.Sonny.Liston.2019.1080p.WEBRip.x264-RARBG.srt |
160.271 |
25.09.2021 03:53:07 +00:00 |
| Patients.Of.A.Saint.2019.1080p.WEB-DL.DD5.1.H264-FGT.srt |
55.943 |
12.09.2021 00:59:52 +00:00 |
| pavarotti.(7945988).nfo |
6.354 |
26.09.2021 05:43:56 +00:00 |
| Pavarotti.2019.TR.srt |
110.175 |
26.09.2021 08:43:44 +00:00 |
| paydirt.(8310008).nfo |
6.437 |
14.09.2021 23:23:16 +00:00 |
| Paydirt.2020.HDRip.XviD.AC3-EVO.srt |
87.988 |
15.09.2021 02:22:23 +00:00 |
| pearl.(8313425).nfo |
6.354 |
26.08.2021 23:21:50 +00:00 |
| Pearl.2020.HDRip.XviD.AC3-EVO.srt |
85.289 |
27.08.2021 02:21:10 +00:00 |
| peel.(7744840).nfo |
6.437 |
12.07.2023 16:45:36 +00:00 |
| Peel.2019.HDRip.AC3.x264-CMRG.srt |
77.422 |
12.07.2023 19:45:37 +00:00 |
| penance.lane.(8179824).nfo |
6.520 |
26.08.2021 23:22:00 +00:00 |
| Penance.Lane.2020.HDRip.XviD.AC3-EVO.srt |
58.380 |
27.08.2021 02:21:18 +00:00 |
| penguin.(8251690).nfo |
6.354 |
11.09.2021 02:02:08 +00:00 |
| Penguin.Tamil.2020.1080p.AMZN.WEB-DL.DD+5.1.x264-Telly_track3_[eng].srt |
86.930 |
11.09.2021 05:01:43 +00:00 |
| Peninsula.2020.1080p.WEBRip.x264.AAC5.1-[YTS.MX].srt |
67.925 |
11.09.2021 05:03:06 +00:00 |
| Pete Davidson Alive from New York 2020.srt |
66.366 |
27.08.2021 02:21:03 +00:00 |
| pete.davidson.alive.from.new.(8107231).nfo |
6.354 |
26.08.2021 23:21:44 +00:00 |
| phil.(7941279).nfo |
6.354 |
20.08.2023 12:19:24 +00:00 |
| Phil.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
83.628 |
20.08.2023 15:19:24 +00:00 |
| philophobia.or.the.fear.of.(7975511).nfo |
6.354 |
23.09.2021 08:18:58 +00:00 |
| Philophobia.Or.The.Fear.Of.Falling.In.Love.2019.1080p.WEB-DL.DD5.1.H264-EVO.srt |
96.970 |
23.09.2021 11:18:05 +00:00 |
| Phineas and Ferb the Movie Candace Against the Universe (2020) .srt |
197.456 |
21.09.2021 04:53:18 +00:00 |
| phineas.and.ferb.the.movie.(8333002).nfo |
6.360 |
21.09.2021 01:53:54 +00:00 |
| phineas.and.ferb.the.movie.(9023472).nfo |
6.360 |
21.01.2023 08:15:10 +00:00 |
| Phineas.And.Ferb.The.Movie.Candace.Against.The.Universe.2020.1080p.WEBRip.x264.AAC5.1-[YTS.MX].iw.srt |
137.543 |
21.01.2023 11:15:10 +00:00 |
| pig.hag.(8018534).nfo |
6.354 |
25.09.2021 15:13:44 +00:00 |
| Pig.Hag.2019.1080p.WEBRip.x264-.YTS.LT.srt |
68.621 |
25.09.2021 18:13:36 +00:00 |
| pigeon.kings.(8290125).nfo |
6.271 |
23.09.2021 08:17:58 +00:00 |
| Pigeon.Kings.2020.720p.WEBRip.x264.AAC-[GooMOVIES.ga].srt |
87.633 |
23.09.2021 11:17:06 +00:00 |
| pinch.(8292643).nfo |
6.354 |
19.09.2021 06:07:02 +00:00 |
| Pinch.2016.1080p.WEBRip.x264-RARBG.srt |
122.284 |
19.09.2021 09:06:40 +00:00 |
| ping.yuan.shang.de.xia.luo.ke.(8458600).nfo |
6.437 |
25.09.2021 00:52:16 +00:00 |
| point.man.(7782801).nfo |
6.520 |
25.09.2021 00:52:36 +00:00 |
| Point.Man.2018.1080p.AMZN.WEBRip.DDP2.0.x264-CMRG.srt |
61.884 |
25.09.2021 03:52:31 +00:00 |
| pokemon.detective.pikachu.(7807755).nfo |
6.437 |
26.03.2023 18:25:34 +00:00 |
| Pokemon.Detective.Pikachu.2019.1080p.HDRip.x264.AAC2.0-STUTTERSHIT.srt |
95.753 |
26.03.2023 21:25:35 +00:00 |
| Polaroid 2019 1080p BluRay H264 AAC-RARBG.srt |
50.280 |
26.09.2021 08:43:17 +00:00 |
| polaroid.(7792295).nfo |
6.520 |
26.09.2021 05:43:30 +00:00 |
| poms.(7849643).nfo |
6.520 |
17.07.2023 22:27:46 +00:00 |
| Poms.2019.1080p.WEBRip.x264-RARBG.srt |
92.781 |
18.07.2023 01:27:46 +00:00 |
| pond.life.(7870603).nfo |
6.520 |
10.08.2023 06:22:14 +00:00 |
| Pond.Life.2018.720p.WEBRip.x264-YIFY-HI.srt |
94.945 |
10.08.2023 09:22:14 +00:00 |
| poor.greg.drowning.(8313315).nfo |
6.354 |
26.08.2021 23:22:08 +00:00 |
| Poor.Greg.Drowning.2020.HDRip.XviD.AC3-EVO.srt |
110.682 |
27.08.2021 02:21:28 +00:00 |
| porno.(8182007).nfo |
6.520 |
20.09.2021 11:39:46 +00:00 |
| Porno.2019.720p.WEBRip.800MB.x264-GalaxyRG.srt |
68.934 |
20.09.2021 14:39:15 +00:00 |
| Portrait.Of.An.Animal.Behavior.2015.SPANISH.WEBRip.x264-VXT.srt |
69.765 |
10.09.2021 08:02:20 +00:00 |
| portrait.of.animal.behavior.(8327325).nfo |
6.437 |
10.09.2021 05:02:40 +00:00 |
| possessor.(8422516).nfo |
6.520 |
8.09.2021 20:04:28 +00:00 |
| Possessor.Uncut.2020.HDRip.XviD.AC3-EVO-HI.srt |
56.952 |
8.09.2021 23:04:17 +00:00 |
| powerbomb.(8163110).nfo |
6.354 |
16.09.2021 19:56:40 +00:00 |
| Powerbomb.2020.HDRip.XviD.AC3-EVO.srt |
94.040 |
16.09.2021 22:56:36 +00:00 |
| premature.(8102618).nfo |
6.437 |
16.09.2021 19:59:36 +00:00 |
| Premature.2019.720p.WEBRip.x264-.YTS.LT.srt |
82.313 |
16.09.2021 22:59:33 +00:00 |
| Prescience 2019 720p WEB-DL x264.srt |
65.618 |
24.09.2021 00:51:54 +00:00 |
| prescience.(7933759).nfo |
6.437 |
23.09.2021 21:52:52 +00:00 |
| pressure.(8313427).nfo |
6.354 |
26.08.2021 23:21:56 +00:00 |
| Pressure.2020.HDRip.XviD.AC3-EVO.srt |
99.099 |
27.08.2021 02:21:15 +00:00 |
| Pretenders.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
92.300 |
14.07.2023 06:30:27 +00:00 |
| pretending.i.m.a.superman.the.(8322441).nfo |
6.445 |
21.09.2021 01:53:36 +00:00 |
| Pretending.Im.A.Superman.The.Tony.Hawk.Video.Game.Story.2020.1080p.WEBRip.x264-RARBG.srt |
111.490 |
21.09.2021 04:53:00 +00:00 |
| prison.break.manhunt.(4655835).nfo |
6.285 |
18.08.2021 06:34:59 +00:00 |
| project.power.(8316143).nfo |
6.271 |
2.09.2021 01:35:56 +00:00 |
| project.power.(9437399).nfo |
6.354 |
6.03.2023 12:33:42 +00:00 |
| Project.Power.2020.1080p.NF.WEB-DL.DDP2.0.x264-CMRG_Turkish.srt |
100.918 |
2.09.2021 04:35:33 +00:00 |
| Project.Power.2020.1080p.WEBRip.x264.AAC5.1-[YTS.MX]-tur.srt |
92.167 |
6.03.2023 15:33:44 +00:00 |
| proximity.(8742958).nfo |
6.437 |
20.09.2021 11:39:54 +00:00 |
| Proximity.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
98.748 |
20.09.2021 14:39:22 +00:00 |
| psy.3.w.imie.zasad.(8237063).nfo |
6.354 |
3.09.2021 15:03:38 +00:00 |
| Psy.3.W.Imie.Zasad.2020.720p.BluRay.x264-FLAME.srt |
85.792 |
3.09.2021 18:03:04 +00:00 |
| psych.2.lassie.come.home.(8302274).nfo |
6.437 |
21.09.2021 01:54:50 +00:00 |
| Psych.2.Lassie.Come.Home.2020.1080p.WEB-DL.DDP5.1.H.264-CMRG.srt |
134.203 |
21.09.2021 04:54:15 +00:00 |
| Psycho.Mother-In-Law.aka.Mad.Mom.2019.1080p.WEBRip.x264-RARBG.srt |
61.510 |
26.09.2021 22:48:35 +00:00 |
| psycho.yoga.instructor.(8241774).nfo |
6.437 |
3.09.2021 02:27:24 +00:00 |
| Psycho.Yoga.Instructor.2020.1080p.FNOW.WEB-DL.AAC2.0.x264-CMRG.srt |
76.600 |
3.09.2021 05:26:53 +00:00 |
| pulled.to.hell.(7824187).nfo |
6.354 |
22.09.2021 18:48:06 +00:00 |
| Pulled.to.Hell.2019.HDRip.AC3.x264-CMRG.srt |
58.997 |
22.09.2021 21:47:17 +00:00 |
| punching.and.stealing.(8232012).nfo |
6.354 |
3.09.2021 22:15:26 +00:00 |
| Punching.And.Stealing.2020.HDRip.XviD.AC3-EVO.srt |
101.182 |
4.09.2021 01:14:50 +00:00 |
| qian.nu.you.hun.ren.jian.qing.(8332294).nfo |
6.437 |
2.09.2021 01:35:34 +00:00 |
| quebramar.(8343028).nfo |
6.271 |
22.09.2021 04:49:02 +00:00 |
| Quebramar.AKA.Breakwater.2019.1080p.MUBI.WEB-DL.AAC2.0.x264-Cinefeel_tur.srt |
19.550 |
22.09.2021 07:48:18 +00:00 |
| queen.sono.i.am.queen.sono.(8111109).nfo |
6.437 |
29.03.2024 05:37:56 +00:00 |
| Queen.Sono.S01E01.NF.WEBRip.srt |
49.178 |
29.03.2024 05:37:56 +00:00 |
| Quien a hierro mata (2019).srt |
67.307 |
20.08.2023 17:56:54 +00:00 |
| quien.a.hierro.mata.(8082143).nfo |
6.271 |
20.08.2023 14:56:54 +00:00 |
| raat.akeli.hai.(8312710).nfo |
6.354 |
9.09.2021 16:28:06 +00:00 |
| Raat.Akeli.Hai.2020.1080p.WEBRip.x264.AAC5.1-[YTS.MX].srt |
106.155 |
9.09.2021 19:27:49 +00:00 |
| race.against.pandemic.(8277817).nfo |
6.271 |
22.08.2021 19:04:22 +00:00 |
| radioactive.(8406514).nfo |
6.354 |
28.08.2021 12:59:02 +00:00 |
| Radioactive.2019.1080p.BluRay.x264.DTS-HD.MA.5.1-FGT.srt |
87.027 |
28.08.2021 15:58:10 +00:00 |
| random.acts.of.violence.(8538157).nfo |
6.520 |
23.09.2021 08:17:38 +00:00 |
| Random.Acts.Of.Violence.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
83.839 |
23.09.2021 11:16:46 +00:00 |
| ready.to.mingle.(7912339).nfo |
6.271 |
24.07.2023 03:19:30 +00:00 |
| Ready.to.Mingle.2019.1080p.NF.WEB-DL.DDP5.1.H264-CMRG_tur.srt |
102.438 |
24.07.2023 06:19:30 +00:00 |
| reawakened.(8188878).nfo |
6.354 |
19.09.2021 06:07:12 +00:00 |
| Reawakened.2020.HDRip.XviD.AC3-EVO.srt |
85.527 |
19.09.2021 09:06:50 +00:00 |
| red.dog.(8254380).nfo |
6.520 |
3.09.2021 15:05:16 +00:00 |
| Red.Dog.2019.720p.WEBRip.x264.AAC-[YTS.MX].srt |
164.200 |
3.09.2021 18:04:42 +00:00 |
| red.shoes.and.the.seven.dwarfs.(8217231).nfo |
6.437 |
24.09.2021 11:41:20 +00:00 |
| Red.Shoes.And.The.Seven.Dwarfs.2019.720p.BluRay.x264.AAC-YTS.MX.srt |
71.367 |
24.09.2021 14:41:21 +00:00 |
| redemption.(8131583).nfo |
6.354 |
22.08.2021 01:39:26 +00:00 |
| Redemption.2019.PORTUGUESE.WEBRip.XviD.MP3-VXT.srt |
7.322 |
22.09.2021 07:48:56 +00:00 |
| Redemption.2020.1080p.WEBRip.x264.AAC-.YTS.MX.es.srt |
51.597 |
22.08.2021 04:39:20 +00:00 |
| reign.of.the.supermen.(7620117).nfo |
6.354 |
22.09.2021 04:49:20 +00:00 |
| Reign.of.the.Supermen.2019.HDRip.AC3.X264-CMR.srt |
77.438 |
22.09.2021 07:48:36 +00:00 |
| relic.(8296444).nfo |
6.354 |
5.09.2021 19:53:34 +00:00 |
| Relic.srt |
36.060 |
5.09.2021 22:52:45 +00:00 |
| repeat.attenders.(8260337).nfo |
6.437 |
14.09.2021 23:24:06 +00:00 |
| Repeat.Attenders.2020.1080p.AMZN.WEB-DL.DDP2.0.H.264-QOQ.srt |
99.984 |
15.09.2021 02:23:13 +00:00 |
| resgate.(8304165).nfo |
6.354 |
22.09.2021 04:49:40 +00:00 |
| resistance.(8287842).nfo |
6.354 |
15.09.2021 17:31:00 +00:00 |
| Resistance.2020.HDRip.XviD.AC3-EVO.srt |
77.567 |
15.09.2021 20:30:00 +00:00 |
| rev.(8562150).nfo |
6.271 |
19.09.2021 06:06:38 +00:00 |
| Rev.2020.1080p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
79.900 |
19.09.2021 09:06:17 +00:00 |
| revenge.ride.(8408338).nfo |
6.354 |
18.09.2021 15:46:36 +00:00 |
| Revenge.Ride.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
43.508 |
18.09.2021 18:46:19 +00:00 |
| Rich.in.Love.2020.720p.NF.WEB-DL.DDP5.1.x264-CMRG_tur.srt |
115.338 |
25.08.2021 20:50:57 +00:00 |
| ricos.de.amor.(8269417).nfo |
6.271 |
25.08.2021 17:51:30 +00:00 |
| ring.ring.(8003672).nfo |
6.354 |
22.09.2021 04:49:16 +00:00 |
| Ring.Ring.2019.1080p.WEB-DL.DD2.0.H264-EVO-HI.srt |
71.050 |
22.09.2021 07:48:32 +00:00 |
| ringside.(8245516).nfo |
6.437 |
27.08.2023 22:49:46 +00:00 |
| Ringside.2019.AMZN.WEB-DL.AAC2.0.H.264-NTG.srt |
97.660 |
28.08.2023 01:49:46 +00:00 |
| Rising.High.WEBRip.Netflix.ar.srt |
105.696 |
23.08.2021 18:20:10 +00:00 |
| rising.phoenix.(8330032).nfo |
6.355 |
18.09.2021 15:46:46 +00:00 |
| Rising.Phoenix.2020.1080p.WEBRip.x265-RARBG.srt |
131.702 |
18.09.2021 18:46:29 +00:00 |
| Rob Schneider Asian Momma Mexican Kids 2020.srt |
50.714 |
25.08.2021 20:51:32 +00:00 |
| rob.schneider.asian.momma.(8313692).nfo |
6.271 |
25.08.2021 17:52:04 +00:00 |
| robert.reborn.(7820574).nfo |
6.437 |
21.09.2021 15:04:36 +00:00 |
| Robert.Reborn.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
52.970 |
21.09.2021 18:03:56 +00:00 |
| rock.and.roll.christmas.(8297831).nfo |
6.354 |
26.09.2021 19:48:00 +00:00 |
| Rock.N.Roll.Christmas.2019.1080p.WEBRip.x264-RARBG.srt |
111.661 |
26.09.2021 22:47:43 +00:00 |
| rocket.hunter.(8069607).nfo |
6.437 |
10.09.2021 15:29:44 +00:00 |
| rocket.hunter.(8758341).nfo |
6.437 |
14.03.2022 04:20:28 +00:00 |
| Rocket.Hunter.2020.1080p.BluRay.FLAC.x264-HANDJOB.srt |
84.358 |
14.03.2022 07:19:59 +00:00 |
| Rocket.Hunter.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
62.427 |
10.09.2021 18:29:20 +00:00 |
| rogue.(8334335).nfo |
6.354 |
29.08.2021 19:27:58 +00:00 |
| Rogue.srt |
88.799 |
29.08.2021 22:27:58 +00:00 |
| rogue.warfare.2.the.hunt.(8151696).nfo |
6.437 |
22.09.2021 04:49:22 +00:00 |
| rogue.warfare.death.of.a.nation.(8360003).nfo |
6.437 |
21.08.2021 13:13:52 +00:00 |
| Rogue.Warfare.Death.Of.A.Nation.2020.720p.BluRay.x264-[YTS.LT].srt |
72.935 |
21.08.2021 16:13:48 +00:00 |
| Rogue.Warfare.The.Hunt.2019.720p.BluRay.x264-[YTS.LT].srt |
73.142 |
22.09.2021 07:48:38 +00:00 |
| romance.doll.(8313375).nfo |
6.437 |
20.09.2021 11:39:02 +00:00 |
| Romance.Doll.2020.JAPANESE.1080p.BluRay.H264.AAC-VXT.srt |
96.229 |
20.09.2021 14:38:31 +00:00 |
| romantic.comedy.(8202076).nfo |
6.354 |
22.09.2021 04:49:44 +00:00 |
| Romantic.Comedy.2019.1080p.WEBRip.x264-RARBG_English.srt |
118.292 |
22.09.2021 07:49:00 +00:00 |
| ron.hopper.s.misfortune.(8223426).nfo |
6.437 |
6.09.2021 15:53:10 +00:00 |
| Ron.Hoppers.Misfortune.2020.720p.WEBRip.X264.AAC.2.0-EVO.srt |
54.993 |
6.09.2021 18:52:15 +00:00 |
| rook.(8313421).nfo |
6.354 |
26.08.2021 23:22:24 +00:00 |
| Rook.2020.1080p.WEB-DL.AAC.H264-CMRG.srt |
53.260 |
27.08.2021 02:21:42 +00:00 |
| roped.(8511881).nfo |
6.437 |
14.09.2021 23:25:34 +00:00 |
| Roped.2020.x264-WEBDL-480p.AAC-2.0-ION10_tt8523028.srt |
121.506 |
15.09.2021 02:24:40 +00:00 |
| rose.matafeo.horndog.(8323141).nfo |
6.188 |
23.08.2021 06:18:50 +00:00 |
| Rose.Matafeo.Horndog.2020.WEBRip.x264-ION10.srt |
87.429 |
23.08.2021 09:18:36 +00:00 |
| run.this.town.(8117973).nfo |
6.354 |
13.09.2021 05:17:54 +00:00 |
| Run.This.Town.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
135.698 |
13.09.2021 08:17:13 +00:00 |
| run.with.the.hunted.(8251990).nfo |
6.520 |
11.09.2021 02:03:18 +00:00 |
| Run.With.The.Hunted.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
62.884 |
11.09.2021 05:02:52 +00:00 |
| russell.peters.deported.(8066420).nfo |
6.271 |
23.06.2023 02:57:58 +00:00 |
| russell.peters.deported.(8066425).nfo |
6.271 |
21.08.2021 02:21:54 +00:00 |
| ruta.madre.(7834139).nfo |
6.354 |
14.07.2023 17:27:32 +00:00 |
| Ruta.Madre.2019.HDRip.XviD.AC3-EVO.srt |
58.024 |
14.07.2023 20:27:33 +00:00 |
| ruthless.the.musical.(8325290).nfo |
6.437 |
23.07.2023 15:52:02 +00:00 |
| Ruthless.The.Musical.2019.1080p.WEBRip.x264-RARBG.srt |
157.436 |
23.07.2023 18:52:02 +00:00 |
| Saint Frances.srt |
89.985 |
15.09.2021 02:25:09 +00:00 |
| saint.frances.(8543122).nfo |
6.354 |
14.09.2021 23:26:02 +00:00 |
| sam.jay.3.in.the.morning.(8307880).nfo |
6.271 |
4.09.2021 05:17:16 +00:00 |
| Sam.Jay.3.in.the.Morning.2020.720p.WEB.H264-HUZZAH.srt |
92.176 |
4.09.2021 08:16:38 +00:00 |
| samsam.(8307781).nfo |
6.437 |
2.09.2021 13:54:12 +00:00 |
| SamSam.2019.720p.WEBRip.x264.AAC-[YTS.MX].srt |
80.910 |
2.09.2021 16:53:45 +00:00 |
| Santa's.Little.Helpers.2019.1080p.BluRay.x264-.YTS.AM.srt |
2.160 |
26.03.2023 22:14:29 +00:00 |
| santa.s.little.helpers.(7724088).nfo |
6.437 |
26.03.2023 19:14:28 +00:00 |
| santana.(8331322).nfo |
6.271 |
20.08.2021 18:33:08 +00:00 |
| Santana.2020.1080p.NF.WEB-DL.DDP2.0.H264-pawel2006_Turkish.srt |
59.984 |
20.08.2021 21:32:11 +00:00 |
| Saraitda.2020.720p.NF.WEB-DL.DDP5.1.x264-NTG_tur.srt |
44.627 |
19.09.2021 23:27:46 +00:00 |
| savage.creatures.(8214899).nfo |
6.437 |
18.09.2021 15:46:42 +00:00 |
| Savage.Creatures.2020.WEBRip.x264-ION10.srt |
51.112 |
18.09.2021 18:46:25 +00:00 |
| scarborough.(7891013).nfo |
6.437 |
26.09.2021 19:48:28 +00:00 |
| Scarborough.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
68.792 |
26.09.2021 22:48:11 +00:00 |
| scary.stories.(8293137).nfo |
6.437 |
23.09.2021 21:52:58 +00:00 |
| Scary.Stories.2018.1080p.WEBRip.x264-RARBG.srt |
122.617 |
24.09.2021 00:52:01 +00:00 |
| scheme.birds.(8262762).nfo |
6.520 |
27.03.2023 08:56:48 +00:00 |
| Scheme.Birds.2019.HDRip.XviD.AC3-EVO-HI.srt |
93.452 |
27.03.2023 11:56:48 +00:00 |
| scoob.(8218946).nfo |
6.354 |
25.08.2021 17:52:14 +00:00 |
| Scoob.2020.1080p.WEBRip.x265-RARBG.tr.srt |
107.108 |
25.08.2021 20:51:41 +00:00 |
| sea.fever.(8205607).nfo |
6.437 |
21.09.2021 15:03:46 +00:00 |
| Sea.Fever.2019.1080p.BluRay.x265-RARBG.tr.srt |
59.518 |
21.09.2021 18:03:06 +00:00 |
| secret.zoo.(8407827).nfo |
6.437 |
10.09.2021 15:29:46 +00:00 |
| Secret.Zoo.2020.HDRip.XviD.AC3-EVO.srt |
144.211 |
10.09.2021 18:29:23 +00:00 |
| seduced.inside.the.nxivm.cult.(8390980).nfo |
6.439 |
14.12.2022 17:07:56 +00:00 |
| Seduced.Inside.The.NXIVM.Cult.S01E01.Hooked.1080p.AMZN.WEB-DL.DDP5.1.H.264-NTb.srt |
99.421 |
14.12.2022 17:07:56 +00:00 |
| selfie.dad.(8252120).nfo |
6.437 |
3.09.2021 15:04:10 +00:00 |
| Selfie.Dad.2020.HDRip.XviD.AC3-EVO.srt |
154.019 |
3.09.2021 18:03:36 +00:00 |
| Sem Norte 2020 1080p WEB-DL DUAL.srt |
54.376 |
22.01.2023 04:32:02 +00:00 |
| sergio.(8175055).nfo |
6.367 |
18.08.2021 06:35:00 +00:00 |
| sergio.(8293506).nfo |
6.285 |
18.08.2021 06:35:01 +00:00 |
| Sergio.2020.1080p.NF.WEB-DL.DDP5.1.Atmos.x264-CMRG.srt |
86.438 |
18.08.2021 06:34:47 +00:00 |
| Sergio.srt |
89.989 |
18.08.2021 06:34:48 +00:00 |
| seriously.single.(8303764).nfo |
6.188 |
21.08.2021 08:28:46 +00:00 |
| Seriously.Single.2020.720p.WEB.H264-SECRECY_Turkish.srt |
112.727 |
21.08.2021 11:28:44 +00:00 |
| serpent.in.the.bottle.(8306411).nfo |
6.437 |
29.08.2021 19:28:12 +00:00 |
| Serpent.In.The.Bottle.2020.720p.WEBRip.X264.AAC.2.0-EVO-HI.srt |
84.696 |
29.08.2021 22:28:11 +00:00 |
| sesame.street.elmo.s.playdate.(8315949).nfo |
6.437 |
19.09.2021 06:06:50 +00:00 |
| Sesame.Street.Elmos.Playdate.Scavenger.Hunt.2020.720p.HMAX.WEB-DL.DD5.1.H.264-monkee.srt |
42.030 |
19.09.2021 09:06:28 +00:00 |
| Seules les betes 2019 1080p BluRay DD5.1 x264-BdC.srt |
61.067 |
25.09.2021 18:12:06 +00:00 |
| seven.stages.to.achieve.eternal.(8159587).nfo |
6.437 |
28.08.2021 12:58:46 +00:00 |
| Seven.Stages.To.Achieve.Eternal.Bliss.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
112.218 |
28.08.2021 15:57:54 +00:00 |
| sex.and.the.future.(8219489).nfo |
6.520 |
11.09.2021 22:00:16 +00:00 |
| Sex.And.The.Future.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
101.497 |
12.09.2021 00:59:44 +00:00 |
| sex.doll.(7033245).nfo |
6.271 |
14.02.2022 16:11:02 +00:00 |
| Sex.Doll.2016.720p.BluRay.x264-.YTS.AG.srt |
42.455 |
14.02.2022 19:10:30 +00:00 |
| shadow.wolves.(8030353).nfo |
6.437 |
22.09.2021 04:49:24 +00:00 |
| Shadow.Wolves.2019.720p.BluRay.x264-YTS.LT.srt |
98.878 |
22.09.2021 07:48:40 +00:00 |
| shadowplay.(7876632).nfo |
6.271 |
26.09.2021 19:48:48 +00:00 |
| Shadowplay.2019.720p.WEB-DL.DD5.1.H264-FGT.srt |
47.575 |
26.09.2021 22:48:31 +00:00 |
| shakuntala.devi.(8312686).nfo |
6.354 |
10.09.2021 05:02:10 +00:00 |
| Shakuntala.Devi.2020.720p.AMZN.WEBRip.6CH.ESub.x264.BonsaiHD.srt |
130.430 |
10.09.2021 08:01:50 +00:00 |
| shazam.(7776829).nfo |
6.354 |
9.07.2023 09:00:48 +00:00 |
| Shazam.2019.720p.HC.HDRip.X264-EVO.srt |
114.871 |
9.07.2023 12:00:48 +00:00 |
| She Dies Tomorrow (2020) - forumiptv.srt |
51.245 |
11.09.2021 05:01:53 +00:00 |
| she.dies.tomorrow.(8319058).nfo |
6.354 |
11.09.2021 02:02:20 +00:00 |
| she.never.died.(8171905).nfo |
6.520 |
11.09.2021 11:55:36 +00:00 |
| She.Never.Died.2020.HDRip.XviD.AC3-EVO.srt |
68.084 |
11.09.2021 14:55:07 +00:00 |
| shepard.(8122879).nfo |
6.354 |
18.09.2021 15:47:52 +00:00 |
| Shepard.2020.1080p.WEBRip.x264-RARBG.es.srt |
55.648 |
18.09.2021 18:47:34 +00:00 |
| shifter.(8309217).nfo |
6.437 |
11.09.2021 21:59:34 +00:00 |
| Shifter.2020.HDRip.XviD.AC3-EVO.srt |
35.787 |
12.09.2021 00:59:01 +00:00 |
| shine.your.eyes.(8304229).nfo |
6.271 |
20.08.2021 02:03:14 +00:00 |
| Shine.Your.Eyes.2020.PORTUGUESE.1080p.WEBRip.x264-VXT.srt |
32.782 |
20.08.2021 05:02:21 +00:00 |
| shirley.(8295265).nfo |
6.354 |
20.08.2021 21:13:50 +00:00 |
| Shirley.srt |
75.336 |
21.08.2021 00:12:52 +00:00 |
| shooting.heroin.(8188502).nfo |
6.437 |
11.09.2021 02:03:28 +00:00 |
| Shooting.Heroin.2020.HDRip.XviD.AC3-EVOtr.srt |
96.643 |
11.09.2021 05:03:02 +00:00 |
| showbiz.kids.(8287798).nfo |
6.354 |
25.08.2021 17:52:24 +00:00 |
| Showbiz.Kids.srt |
112.640 |
25.08.2021 20:51:52 +00:00 |
| shubh.mangal.zyada.saavdhan.(8529729).nfo |
6.354 |
4.09.2021 11:57:00 +00:00 |
| Shubh.Mangal.Zyada.Saavdhan.2020.Hindi.1080p.heb.srt |
174.185 |
4.09.2021 14:56:19 +00:00 |
| sibyl.(8212569).nfo |
6.354 |
21.09.2021 15:05:14 +00:00 |
| Sibyl.2019.FRENCH.1080p.BluRay.DTS.x264-EXTREME.srt |
76.876 |
21.09.2021 18:04:34 +00:00 |
| Side.Hustle.S02E09.Return.of.Uncle.Nedward.720p.AMZN.WEBRip.DDP2.0.x264-LAZY - No HI.srt |
32.101 |
28.03.2024 20:58:32 +00:00 |
| side.hustle.the.return.of.uncle.(9010854).nfo |
6.437 |
28.03.2024 20:58:32 +00:00 |
| Simulation Theory Film (Drake, Lance 2020)_BDRip.720p.x264.AAC_UKh.srt |
70.068 |
15.03.2022 02:01:55 +00:00 |
| simulation.theory.film.(8334312).nfo |
6.437 |
13.09.2021 05:17:28 +00:00 |
| simulation.theory.film.(8467218).nfo |
6.437 |
14.03.2022 23:02:30 +00:00 |
| Simulation.Theory.Film.2020.1080p.WEB-DL.DD5.1.H.264.srt |
19.613 |
13.09.2021 08:16:46 +00:00 |
| sinful.(8334231).nfo |
6.354 |
2.09.2021 13:52:50 +00:00 |
| Sinful.srt |
46.951 |
2.09.2021 16:52:24 +00:00 |
| skinned.(8334999).nfo |
6.520 |
11.09.2021 22:00:58 +00:00 |
| sleeping.dogs.lie.(7649157).nfo |
6.271 |
24.09.2021 11:40:06 +00:00 |
| Sleeping.Dogs.Lie.2018.1080p.AMZN.WEBRip.DDP5.1.x264-CM.srt |
62.207 |
24.09.2021 14:40:06 +00:00 |
| slow.ride.home.(8275634).nfo |
6.354 |
1.09.2021 11:41:12 +00:00 |
| Slow.Ride.Home.2020.720p.AMZN.WEB-DL.DD+2.0.H.264-iKA.srt |
118.010 |
1.09.2021 14:40:53 +00:00 |
| sniper.assassin.s.end.(8661514).nfo |
6.271 |
2.09.2021 13:52:56 +00:00 |
| Sniper.Assassins.End.2020.1080p.bluray.mora.25r.srt |
79.052 |
2.09.2021 16:52:28 +00:00 |
| solitary.(8333973).nfo |
6.354 |
4.09.2021 11:57:18 +00:00 |
| solitary.(8816415).nfo |
6.520 |
22.10.2021 07:24:40 +00:00 |
| Solitary.2020.1080p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
62.687 |
4.09.2021 14:56:37 +00:00 |
| Solitary.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
83.416 |
22.10.2021 10:23:43 +00:00 |
| Someone Somewhere 2019 (Deux moi).tur.srt |
117.616 |
10.07.2023 11:43:26 +00:00 |
| someone.somewhere.(8726547).nfo |
6.354 |
10.07.2023 08:43:26 +00:00 |
| sonic.the.hedgehog.(8152494).nfo |
6.354 |
18.09.2021 01:12:10 +00:00 |
| Sonic.The.Hedgehog.2020.1080p.WEB-DL.DD5.1.H264-FGT.srt |
99.541 |
18.09.2021 04:11:58 +00:00 |
| Sons.of.Denmark.2019.SweSub.1080p.x264-Justiso.srt |
73.408 |
26.09.2021 08:44:07 +00:00 |
| soundtrack.to.sixteen.(9039834).nfo |
6.437 |
16.08.2022 08:42:26 +00:00 |
| Soundtrack.To.Sixteen.2019.HDRip.XviD.AC3-EVO.srt |
101.632 |
16.08.2022 11:42:27 +00:00 |
| south.mountain.(8198230).nfo |
6.520 |
26.09.2021 19:48:58 +00:00 |
| South.Mountain.2020.HDRip.XviD.AC3-EVO.srt |
71.690 |
26.09.2021 22:48:41 +00:00 |
| space.(8150927).nfo |
6.354 |
6.09.2021 15:53:24 +00:00 |
| Space.2020.HDRip.XviD.AC3-EVO.srt |
106.400 |
6.09.2021 18:52:29 +00:00 |
| spaceship.earth.(8274335).nfo |
6.354 |
14.09.2021 23:23:28 +00:00 |
| Spaceship.Earth.2020.1080p.HULU.WEB-DL.DDP5.1.H.264-NTG.srt |
80.851 |
15.09.2021 02:22:34 +00:00 |
| speak.your.mind.(8273957).nfo |
6.354 |
25.09.2021 15:14:26 +00:00 |
| Speak.Your.Mind.2020.HDRip.XviD.AC3-EVO.srt |
178.474 |
25.09.2021 18:14:17 +00:00 |
| special.actors.(8313376).nfo |
6.437 |
23.08.2023 20:36:02 +00:00 |
| Special.Actors.2019.JAPANESE.1080p.BluRay.H264.AAC-VXT.srt |
79.066 |
23.08.2023 23:36:03 +00:00 |
| speed.of.life.(8051879).nfo |
6.271 |
8.09.2021 20:04:44 +00:00 |
| Speed.Of.Life.2019.1080p.WEB-DL.x264-FGT.srt |
88.986 |
8.09.2021 23:04:34 +00:00 |
| spelling.the.dream.(8233426).nfo |
6.438 |
8.09.2021 20:04:30 +00:00 |
| Spelling.the.Dream.2020.WEBRip.x264-ION10.srt |
109.325 |
8.09.2021 23:04:21 +00:00 |
| spenser.confidential.(8118004).nfo |
6.271 |
21.09.2021 01:54:42 +00:00 |
| Spenser.Confidential.2020.720p.NF.WEBRip.800MB.x264-GalaxyRG.srt |
111.631 |
21.09.2021 04:54:05 +00:00 |
| Spider-Man Homecoming 2017 HD-TS x264-CPG.srt |
128.891 |
13.06.2022 20:10:46 +00:00 |
| spider.man.homecoming.(7051062).nfo |
6.354 |
13.06.2022 17:10:46 +00:00 |
| spinster.(8310011).nfo |
6.437 |
15.09.2021 17:31:44 +00:00 |
| Spinster.2019.720p.WEBRip.x264.AAC-[YTS.MX].srt |
121.540 |
15.09.2021 20:30:46 +00:00 |
| spirits.in.the.dark.(8261873).nfo |
6.437 |
14.09.2021 23:24:36 +00:00 |
| Spirits.In.The.Dark.2020.REPACK.1080p.AMZN.WEB-DL.DDP2.0.H.264-CMRG.srt |
20.278 |
15.09.2021 02:23:42 +00:00 |
| spree.(8316019).nfo |
6.437 |
4.09.2021 05:17:00 +00:00 |
| Spree.2020.1080p.WEB-DL.DD5.1.H264-CMRG.srt |
125.089 |
4.09.2021 08:16:22 +00:00 |
| sprinter.(8061060).nfo |
6.437 |
26.09.2021 05:43:40 +00:00 |
| Sprinter.2018.720p.BluRay.x264-SPRiNTER.srt |
98.905 |
26.09.2021 08:43:27 +00:00 |
| sputnik.(8317174).nfo |
6.354 |
1.09.2021 11:41:06 +00:00 |
| Sputnik.2020.RUSSIAN.720p.WEBRip.800MB.x264-GalaxyRG.srt |
69.909 |
1.09.2021 14:40:46 +00:00 |
| Spy.Cat.2018.720p.WEBRip.x264-.YTS.LT.srt |
59.304 |
26.09.2021 22:48:00 +00:00 |
| spy.intervention.(8097319).nfo |
6.354 |
16.09.2021 19:57:50 +00:00 |
| spy.intervention.(9644603).nfo |
6.354 |
12.08.2023 18:12:46 +00:00 |
| Spy.Intervention.2020.720p.WEBRip.800MB.x264-kr.srt |
140.383 |
16.09.2021 22:57:47 +00:00 |
| Spy.Intervention.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
143.180 |
12.08.2023 21:12:46 +00:00 |
| spycies.(8110882).nfo |
6.437 |
18.09.2021 01:13:04 +00:00 |
| Spycies.2019.720p.WEBRip.x264.AAC-.YTS.MX.srt |
80.091 |
18.09.2021 04:12:50 +00:00 |
| stage.mother.(8324297).nfo |
6.520 |
27.08.2021 19:10:20 +00:00 |
| Stage.Mother.2020.HDRip.XviD.AC3-EVO-HI.srt |
112.413 |
27.08.2021 22:09:33 +00:00 |
| standing.up.falling.down.(8102625).nfo |
6.520 |
4.09.2021 05:17:52 +00:00 |
| Standing.Up.Falling.Down.2019.HDRip.XviD.AC3-EVO-HI.srt |
151.281 |
4.09.2021 08:17:14 +00:00 |
| star.light.(8307075).nfo |
6.437 |
2.09.2021 13:53:20 +00:00 |
| Star.Light.2020.HDRip.XviD.AC3-EVO.srt |
74.244 |
2.09.2021 16:52:52 +00:00 |
| star.trek.lower.decks.crisis.(9221031).nfo |
6.437 |
2.04.2024 21:24:28 +00:00 |
| star.trek.lower.decks.cupid.s.(9221022).nfo |
6.437 |
28.03.2024 19:39:22 +00:00 |
| star.trek.lower.decks.envoys.(9221018).nfo |
6.437 |
2.04.2024 15:48:28 +00:00 |
| star.trek.lower.decks.moist.(9221021).nfo |
6.437 |
2.04.2024 15:51:42 +00:00 |
| star.trek.lower.decks.much.ado.(9221028).nfo |
6.437 |
3.04.2024 11:11:38 +00:00 |
| star.trek.lower.decks.no.small.(9221032).nfo |
6.437 |
3.04.2024 10:52:02 +00:00 |
| star.trek.lower.decks.second.(9221011).nfo |
6.437 |
2.04.2024 14:19:32 +00:00 |
| star.trek.lower.decks.temporal.(9221019).nfo |
6.437 |
3.04.2024 01:52:12 +00:00 |
| star.trek.lower.decks.terminal.(9221023).nfo |
6.437 |
3.04.2024 00:44:02 +00:00 |
| star.trek.lower.decks.veritas.(9221029).nfo |
6.437 |
3.04.2024 06:48:46 +00:00 |
| star.wars.episode.viii.the.last.(7242144).nfo |
6.437 |
6.11.2022 10:39:08 +00:00 |
| Star.Wars.TheLast.Jedi.2017.720p.HDTC.MkvCage.srt |
111.760 |
6.11.2022 13:39:08 +00:00 |
| stateless.incognita.(8276643).nfo |
6.271 |
2.04.2024 20:37:52 +00:00 |
| stateless.panis.angelicus.(8276646).nfo |
6.271 |
3.04.2024 09:36:06 +00:00 |
| stateless.run.sofie.run.(8276645).nfo |
6.271 |
3.04.2024 02:40:32 +00:00 |
| Stateless.S01E01.The.Circumstances.in.Which.They.Come.720p.NF.WEB-DL.DDP5.1.x264-NTG_tur.srt |
48.156 |
28.03.2024 14:21:06 +00:00 |
| Stateless.S01E02.Incognita.720p.NF.WEB-DL.DDP5.1.x264-NTG_tur.srt |
42.245 |
2.04.2024 20:37:52 +00:00 |
| Stateless.S01E03.The.Right.Thing.720p.NF.WEB-DL.DDP5.1.x264-NTG_tur.srt |
36.036 |
2.04.2024 16:59:32 +00:00 |
| Stateless.S01E04.Run.Sofie.Run.720p.NF.WEB-DL.DDP5.1.x264-NTG_tur.srt |
34.581 |
3.04.2024 02:40:32 +00:00 |
| Stateless.S01E05.Panis.Angelicus.720p.NF.WEB-DL.DDP5.1.x264-NTG_tur.srt |
45.606 |
3.04.2024 09:36:06 +00:00 |
| Stateless.S01E06.The.Seventh.Circle.720p.NF.WEB-DL.DDP5.1.x264-NTG_tur.srt |
41.392 |
3.04.2024 12:40:02 +00:00 |
| stateless.the.circumstances.in.(8276642).nfo |
6.271 |
28.03.2024 14:21:06 +00:00 |
| stateless.the.right.thing.(8276644).nfo |
6.271 |
2.04.2024 16:59:32 +00:00 |
| stateless.the.seventh.circle.(8276647).nfo |
6.271 |
3.04.2024 12:40:02 +00:00 |
| stay.out.stay.alive.(7995573).nfo |
6.520 |
19.08.2023 01:55:40 +00:00 |
| Stay.Out.Stay.Alive.2019.1080p.WEBRip.x264-.YTS.LT.srt |
87.833 |
19.08.2023 04:55:40 +00:00 |
| stealing.school.(8547056).nfo |
6.437 |
14.09.2021 23:25:54 +00:00 |
| Stealing.School.2019.720p.WEBRip.x264.AAC-[YTS.MX].srt |
90.293 |
15.09.2021 02:25:00 +00:00 |
| steel.rain.2.(8325263).nfo |
6.437 |
3.09.2021 15:03:32 +00:00 |
| Steel.Rain.2.2020.KOREAN.1080p.WEBRip.x264-VXT.srt |
131.999 |
3.09.2021 18:02:57 +00:00 |
| steve.o.gnarly.(8878424).nfo |
6.354 |
2.12.2021 19:47:18 +00:00 |
| Steve_OGnarly20201080pWEBRipAAC20x264_NOGRP_mp3_Spanish_.srt |
99.043 |
2.12.2021 22:46:40 +00:00 |
| stockton.on.my.mind.(8301721).nfo |
6.271 |
18.09.2021 01:11:50 +00:00 |
| Stockton.On.My.Mind.2020.AMZN.WEB-DL.AAC2.0.H.264-NTG.srt |
169.621 |
18.09.2021 04:11:36 +00:00 |
| stolen.by.my.mother.the.kamiyah.(8066397).nfo |
6.354 |
8.09.2021 20:04:00 +00:00 |
| stolen.by.my.mother.the.kamiyah.mobley.story.2020.1080p.hdtv.hevc.x265.rmteam.srt |
119.461 |
8.09.2021 23:03:49 +00:00 |
| stolen.season.(8191827).nfo |
6.437 |
16.09.2021 19:56:58 +00:00 |
| Stolen.Season.2019.HDRip.XviD.AC3-EVO-HI.srt |
91.519 |
16.09.2021 22:56:53 +00:00 |
| storm.boy.(7730642).nfo |
6.354 |
25.09.2021 15:12:50 +00:00 |
| Storm.Boy.2019.1080p.WEBRip.x264.srt |
54.110 |
25.09.2021 18:12:41 +00:00 |
| Street.Survivors.2020.BDRip.XviD.AC3-EVO-HI.srt |
94.032 |
20.09.2021 14:39:10 +00:00 |
| street.survivors.the.true.story.(8259080).nfo |
6.537 |
20.09.2021 11:39:42 +00:00 |
| strike.(8235498).nfo |
6.354 |
20.08.2023 08:12:52 +00:00 |
| STRIKE_UA_1080.srt |
142.468 |
20.08.2023 11:12:52 +00:00 |
| sulphur.and.white.(8376185).nfo |
6.354 |
18.08.2021 06:03:06 +00:00 |
| Sulphur.And.White.2020.1080p.BluRay.x264.AAC5.1-[YTS.MX].srt |
63.740 |
18.08.2021 09:02:27 +00:00 |
| Summer.Detective.2019.720p.BluRay.DD.5.1.x264-TDD.srt |
53.082 |
25.09.2021 03:52:12 +00:00 |
| summerland.(8612636).nfo |
6.354 |
21.08.2021 12:06:10 +00:00 |
| Summerland.2020.720p.BluRay.x264.AAC-[YTS.MX]-TR.srt |
79.011 |
21.08.2021 15:06:07 +00:00 |
| sunrise.in.heaven.(7715766).nfo |
6.437 |
24.09.2021 11:41:58 +00:00 |
| Sunrise.In.Heaven.2019.1080p.WEB-DL.DD5.1.H264-FGT.srt |
93.450 |
24.09.2021 14:41:58 +00:00 |
| superman.man.of.tomorrow.(8342407).nfo |
6.354 |
2.09.2021 13:52:34 +00:00 |
| Superman.Man.of.Tomorrow.2020.HDRip.XviD.AC3-EVO.srt |
62.623 |
2.09.2021 16:52:06 +00:00 |
| superman.red.son.(8110005).nfo |
6.271 |
20.08.2021 17:55:40 +00:00 |
| Superman.Red.Son.2020.1080p.WEBRip.x264-RARBG.srt |
72.012 |
20.08.2021 20:54:42 +00:00 |
| survive.the.night.(8218061).nfo |
6.354 |
4.09.2021 05:16:48 +00:00 |
| Survive.the.Night.2020.HDRip.XviD.AC3-EVO.srt |
55.178 |
4.09.2021 08:16:09 +00:00 |
| surviving.confession.(7847301).nfo |
6.188 |
26.09.2021 05:43:22 +00:00 |
| Surviving.Confession.2019.HDRip.XviD.AC3-EVO.srt |
94.859 |
26.09.2021 08:43:09 +00:00 |
| sutton.s.case.(8329239).nfo |
6.271 |
19.09.2021 06:06:54 +00:00 |
| Suttons.Case.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
31.379 |
19.09.2021 09:06:32 +00:00 |
| swallow.(8138103).nfo |
6.354 |
29.08.2021 19:28:34 +00:00 |
| Swallow.2019.720p.WEBRip.800MB.x264-GalaxyRG.srt |
52.113 |
29.08.2021 22:28:34 +00:00 |
| swimming.for.gold.(8337026).nfo |
6.271 |
6.09.2021 15:52:10 +00:00 |
| Swimming.for.Gold.2020.1080p.WEBRip.DD5.1.x264-LAZY.srt |
84.798 |
6.09.2021 18:51:14 +00:00 |
| system.crasher.(8138186).nfo |
6.520 |
12.04.2023 19:38:56 +00:00 |
| System.Crasher.2019.720p.BluRay.x264.AAC-.YTS.MX.srt |
80.498 |
12.04.2023 22:38:56 +00:00 |
| tainted.(8726545).nfo |
6.437 |
11.09.2021 02:03:04 +00:00 |
| Tainted.2020.HDRip.XviD.AC3-EVO.srt |
54.732 |
11.09.2021 05:02:39 +00:00 |
| tammy.pescatelli.s.way.after.(8322415).nfo |
6.437 |
21.09.2021 01:53:32 +00:00 |
| Tammy.Pescatellis.Way.After.School.Special.2020.1080p.WEBRip.x264-RARBG.srt |
86.092 |
21.09.2021 04:52:57 +00:00 |
| Tanhaji.2020.1080p.HS.WEB-DL.AAC.2.0.x264-Telly.srt |
103.522 |
22.08.2021 22:12:35 +00:00 |
| tanhaji.the.unsung.warrior.(8119113).nfo |
6.437 |
22.08.2021 19:12:46 +00:00 |
| Taoist.Master.2020.CHINESE.1080p.WEBRip.AAC2.0.x264-NOGRP.srt |
71.386 |
9.09.2021 19:27:44 +00:00 |
| tape.(8240762).nfo |
6.437 |
18.09.2021 15:47:02 +00:00 |
| Tape.2020.1080p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
94.322 |
18.09.2021 18:46:45 +00:00 |
| tell.it.to.the.bees.(7745915).nfo |
6.520 |
25.09.2021 15:13:20 +00:00 |
| Tell.It.to.the.Bees.2018.720p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
58.814 |
25.09.2021 18:13:10 +00:00 |
| tesla.(8334233).nfo |
6.354 |
3.09.2021 02:27:50 +00:00 |
| Tesla.srt |
95.782 |
3.09.2021 05:27:19 +00:00 |
| thappad.(8421753).nfo |
6.354 |
11.09.2021 11:54:14 +00:00 |
| Thappad.2020.WEBRip.Amazon.srt |
154.382 |
11.09.2021 14:53:45 +00:00 |
| The Aspern Papers 2018 TOD WEB-DL.srt |
75.273 |
29.01.2024 06:55:13 +00:00 |
| The Bay of Silence (2020).srt |
63.907 |
5.09.2021 22:52:09 +00:00 |
| The Body Remembers When the World Broke Open (2019).srt |
82.626 |
20.08.2023 16:22:27 +00:00 |
| The Call of the Wild 2020 720p HDCAM-C1NEM4.srt |
45.295 |
4.09.2021 14:57:06 +00:00 |
| The Closet.srt |
52.768 |
19.09.2021 23:27:56 +00:00 |
| The Dead Dont Die.2019.1080p.Bluray.X264-EVO.srt |
82.670 |
26.03.2023 19:25:59 +00:00 |
| The Fighting Preacher.2019_PT.srt |
81.205 |
21.09.2021 18:04:29 +00:00 |
| The Game Changers (2018).srt |
191.026 |
26.09.2021 22:48:19 +00:00 |
| The Gangster, The Cop, The Devil.2018.1080p.WEB-DL.H264.AAC-NonDRM.tr.srt |
95.465 |
24.09.2021 14:39:53 +00:00 |
| The Ghost Who Walks (2019) WEBRip 720p YTS .YIFY.srt |
81.219 |
26.09.2021 22:48:25 +00:00 |
| The Half of It.srt |
86.845 |
21.08.2021 13:13:31 +00:00 |
| The Head Hunter 2018 1080p WEB-DL DD5 1 H264-FGT.srt |
3.433 |
25.09.2021 03:52:49 +00:00 |
| The Huntress Rune of the Dead.2019.BRRip.XviD.AC3-EVO.srt |
53.849 |
17.07.2023 18:55:25 +00:00 |
| The King of Staten Island (2020) - forumiptv.srt |
241.078 |
27.08.2021 02:21:54 +00:00 |
| The Lost Husband.srt |
87.913 |
15.09.2021 20:29:47 +00:00 |
| The Lovebirds.srt |
103.309 |
6.09.2021 18:52:35 +00:00 |
| The Man Standing Next.2018.1080p.FHDRip.H264.AAC-NonDRM.srt |
67.584 |
10.09.2021 08:01:58 +00:00 |
| The Opposite Sex and How to Live with Them.srt |
135.441 |
14.02.2022 19:16:22 +00:00 |
| The Owl House - 01x02 - Witches Before Wizards Türkçe.srt |
29.692 |
17.04.2021 21:58:00 +00:00 |
| The Photograph.srt |
103.695 |
10.09.2021 08:02:46 +00:00 |
| The Quarry.srt |
55.119 |
8.09.2021 23:03:42 +00:00 |
| The Rental.srt |
74.852 |
3.09.2021 18:02:53 +00:00 |
| The Roads Not Taken.srt |
46.416 |
27.08.2021 22:10:03 +00:00 |
| The Silencing.srt |
47.870 |
3.09.2021 05:27:31 +00:00 |
| The Tooth Fairy 2 The Root of Evil .nl.srt |
45.581 |
19.09.2021 23:27:48 +00:00 |
| The Unfamiliar.srt |
46.139 |
3.09.2021 18:04:18 +00:00 |
| The Willoughbys.srt |
94.890 |
3.09.2021 05:27:14 +00:00 |
| The Wolf Hour 2019 1080p WEB-DL H264 AC3-EVO.srt |
56.710 |
10.07.2023 05:33:52 +00:00 |
| the.24th.(8323701).nfo |
6.437 |
29.08.2021 19:27:38 +00:00 |
| The.24th.2020.1080p.WEB-DL.DD5.1.H264-CMRG-HI.srt |
104.614 |
29.08.2021 22:27:38 +00:00 |
| the.addams.family.(8065435).nfo |
6.271 |
12.07.2023 18:58:00 +00:00 |
| The.Addams.Family.2019.720p.BluRay.H264.AAC-RARBG.srt |
86.346 |
12.07.2023 21:58:01 +00:00 |
| the.adventure.of.a.r.i.my.robot.(8498866).nfo |
6.437 |
10.09.2021 05:03:20 +00:00 |
| The.Adventure.Of.A.R.I.My.Robot.Friend.2020.720p.BluRay.H264.AAC-RARBG.srt |
84.352 |
10.09.2021 08:03:00 +00:00 |
| the.adventures.of.acela.(8176544).nfo |
6.271 |
9.09.2021 16:28:50 +00:00 |
| The.Adventures.of.Acela.2020.1080p.WEBRip.x264-RARBG_English.srt |
40.637 |
9.09.2021 19:28:34 +00:00 |
| the.aerialist.(8263946).nfo |
6.354 |
1.09.2021 11:41:48 +00:00 |
| The.Aerialist.2020.720p.AMZN.WEBRip.DDP5.1.x264-iKA - m.srt |
125.243 |
1.09.2021 14:41:29 +00:00 |
| the.alpha.test.(8122598).nfo |
6.437 |
20.08.2021 13:13:08 +00:00 |
| The.Alpha.Test.2020.HDRip.XviD.AC3-EVO.srt |
73.932 |
20.08.2021 16:12:12 +00:00 |
| the.angel.of.auschwitz.(8824209).nfo |
6.354 |
17.07.2023 10:13:04 +00:00 |
| The.Angel.Of.Auschwitz.2019.720p.WEBRip.x264-[YTS.LT].srt |
70.307 |
17.07.2023 13:13:05 +00:00 |
| The.Ascent.2020.HDRip.XviD.AC3-EVO.srt |
37.630 |
21.09.2021 04:54:03 +00:00 |
| the.aspern.papers.(7610570).nfo |
6.520 |
19.08.2023 03:44:34 +00:00 |
| the.aspern.papers.(9872414).nfo |
6.354 |
29.01.2024 03:55:12 +00:00 |
| The.Aspern.Papers.2018.HDRip.AC3.X264-CMRG_HI.srt |
85.083 |
19.08.2023 06:44:35 +00:00 |
| the.assistant.(8437429).nfo |
6.354 |
11.09.2021 11:55:40 +00:00 |
| The.Assistant.2019.1080p.WEBRip.x264.AAC5.1-[YTS.MX].srt |
56.324 |
11.09.2021 14:55:11 +00:00 |
| the.banker.(8150513).nfo |
6.354 |
21.08.2021 15:50:16 +00:00 |
| the.banker.(8567948).nfo |
6.354 |
28.12.2022 07:01:16 +00:00 |
| The.Banker.2020.1080p.BluRay.x264.DTS-MT.srt |
148.823 |
28.12.2022 10:01:18 +00:00 |
| The.Banker.2020.720p.BluRay.x264.AAC-[YTS.MX] TR.srt |
146.714 |
21.08.2021 18:50:14 +00:00 |
| the.bay.of.silence.(8726553).nfo |
6.354 |
5.09.2021 19:52:58 +00:00 |
| the.beach.house.(8457235).nfo |
6.437 |
26.11.2021 14:11:12 +00:00 |
| The.Beach.House.2019.1080p.BluRay.x264.AAC5.1-[YTS.MX].srt |
38.671 |
26.11.2021 17:10:22 +00:00 |
| the.bellmen.(8202048).nfo |
6.354 |
19.09.2021 06:08:04 +00:00 |
| The.Bellmen.2020.HDRip.XviD.AC3-EVO.srt |
119.110 |
19.09.2021 09:07:42 +00:00 |
| the.berlin.bride.(8228138).nfo |
6.354 |
19.08.2021 01:33:12 +00:00 |
| the.berlin.bride.(9783120).nfo |
6.271 |
12.11.2023 15:55:34 +00:00 |
| The.Berlin.Bride.2020.1080p.WEBDL.AC3.x264.Heb.srt |
4.353 |
12.11.2023 18:55:34 +00:00 |
| The.Berlin.Bride.2020.DUBBED.WEBRip.x264-ION10.srt |
3.633 |
19.08.2021 04:32:27 +00:00 |
| the.best.of.enemies.(7860300).nfo |
6.354 |
3.08.2023 21:22:34 +00:00 |
| The.Best.of.Enemies.2019.1080p.WEB-DL.DD5.1.H264-TRK.srt |
125.529 |
4.08.2023 00:22:36 +00:00 |
| the.bet.(8049363).nfo |
6.271 |
5.09.2021 19:53:20 +00:00 |
| The.Bet.2020.1080p.WEB-DL.DD5.1.H264-FGT.srt |
110.979 |
5.09.2021 22:52:30 +00:00 |
| the.big.ugly.(8295967).nfo |
6.520 |
6.09.2021 15:54:00 +00:00 |
| The.Big.Ugly.2020.1080p.WEB-DL.DD5.1.H264-CMRG.srt |
78.083 |
6.09.2021 18:53:03 +00:00 |
| the.binge.(8330856).nfo |
6.354 |
21.08.2021 17:16:40 +00:00 |
| The.Binge.2020.720p.HULU.WEBRip.DDP5.1.x264-NTG.srt |
160.457 |
21.08.2021 20:16:36 +00:00 |
| the.blackout.(8225004).nfo |
6.354 |
19.07.2023 01:18:38 +00:00 |
| the.blackout.2019.1080p.bluray.x264-yol0w.srt |
97.773 |
19.07.2023 04:18:38 +00:00 |
| the.body.remembers.when.the.(9355638).nfo |
6.354 |
20.08.2023 13:22:26 +00:00 |
| the.bone.box.(8292376).nfo |
6.437 |
4.09.2021 05:17:36 +00:00 |
| The.Bone.Box.2020.HDRip.x264-SHADOW.srt |
79.574 |
4.09.2021 08:16:58 +00:00 |
| the.booksellers.(8713788).nfo |
6.271 |
15.09.2021 17:31:58 +00:00 |
| the.booksellers.(9153681).nfo |
6.437 |
18.08.2022 21:19:44 +00:00 |
| The.Booksellers.2019.1080p.WEBRip.x265-RARBG.ass |
226.786 |
19.08.2022 00:19:44 +00:00 |
| The.Booksellers.2019.DVDRip.x264-BiPOLAR.srt |
160.075 |
15.09.2021 20:31:00 +00:00 |
| the.brink.(8320127).nfo |
6.354 |
27.08.2021 04:56:38 +00:00 |
| the.brink.(8737852).nfo |
6.437 |
18.03.2022 09:46:08 +00:00 |
| The.Brink.2020.1080p.WEBRip.x264-RARBG.en.srt |
103.655 |
27.08.2021 07:55:55 +00:00 |
| the.burnt.orange.heresy.(8461059).nfo |
6.271 |
10.09.2021 05:03:14 +00:00 |
| The.Burnt.Orange.Heresy.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
82.250 |
10.09.2021 08:02:54 +00:00 |
| the.call.of.the.wild.(8138082).nfo |
6.354 |
4.09.2021 11:57:46 +00:00 |
| the.candy.witch.(8240599).nfo |
6.354 |
4.09.2021 21:43:28 +00:00 |
| The.Candy.Witch.2020.HDRip.XviD.AC3-EVO.srt |
51.746 |
5.09.2021 00:42:45 +00:00 |
| the.car.road.to.revenge.(7605922).nfo |
6.520 |
15.08.2023 04:01:46 +00:00 |
| The.Car.Road.to.Revenge.2019.DVDRip.XviD.AC3-EVO.srt |
61.259 |
15.08.2023 07:01:47 +00:00 |
| the.claudia.kishi.club.(8280207).nfo |
6.354 |
11.09.2021 21:59:48 +00:00 |
| The.Claudia.Kishi.Club.2020.1080p.NF.WEB-DL.DDP5.1.x264-TEPES.srt |
23.842 |
12.09.2021 00:59:17 +00:00 |
| the.cleansing.hour.(8477656).nfo |
6.520 |
18.09.2021 15:47:42 +00:00 |
| The.Cleansing.Hour.2019.720p.BluRay.x264-[YTS.LT].srt |
92.418 |
18.09.2021 18:47:24 +00:00 |
| the.clearing.(8267121).nfo |
6.354 |
19.09.2021 06:07:40 +00:00 |
| The.Clearing.2020.1080p.WEB-DL.H.264-SNAKE.srt |
24.568 |
19.09.2021 09:07:18 +00:00 |
| the.closet.(8336200).nfo |
6.354 |
19.09.2021 20:28:22 +00:00 |
| the.collini.case.(8168078).nfo |
6.354 |
20.08.2023 23:22:52 +00:00 |
| The.Collini.Case.2019.720p.srt |
74.814 |
21.08.2023 02:22:52 +00:00 |
| the.complex.lockdown.(8399798).nfo |
6.437 |
2.09.2021 13:52:58 +00:00 |
| The.Complex.Lockdown.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
85.290 |
2.09.2021 16:52:32 +00:00 |
| the.crimes.that.bind.(8324221).nfo |
6.271 |
23.08.2021 15:18:52 +00:00 |
| The.Crimes.That.Bind.2020.1080p.NF.WEB-DL.DD+5.1.H.264-BdC_tur.srt |
91.089 |
23.08.2021 18:18:34 +00:00 |
| the.dalton.gang.(8380799).nfo |
6.437 |
2.09.2021 13:52:46 +00:00 |
| The.Dalton.Gang.2020.720p.AMZN.WEB-DL.DD+2.0.H.264-iKA.srt |
73.332 |
2.09.2021 16:52:19 +00:00 |
| the.dark.end.of.the.street.(8313432).nfo |
6.354 |
26.08.2021 23:22:28 +00:00 |
| The.Dark.End.of.the.Street.2020.HDRip.XviD.AC3-EVO.srt |
60.513 |
27.08.2021 02:21:48 +00:00 |
| the.dark.side.of.opulent.(8116317).nfo |
6.354 |
10.09.2021 05:02:54 +00:00 |
| The.Dark.Side.Of.Opulent.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
98.177 |
10.09.2021 08:02:34 +00:00 |
| the.dark.within.(7928584).nfo |
6.271 |
13.09.2021 05:17:38 +00:00 |
| The.Dark.Within.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
33.262 |
13.09.2021 08:16:58 +00:00 |
| the.dawn.(8099537).nfo |
6.437 |
13.09.2021 05:17:50 +00:00 |
| The.Dawn.2020.HDRip.XviD.AC3-EVO.srt |
59.100 |
13.09.2021 08:17:09 +00:00 |
| the.day.after.i.m.gone.(8299431).nfo |
6.271 |
10.07.2023 13:58:56 +00:00 |
| The.Day.After.Im.Gone.2019.1080p.AMZN.WEB-DL.DDP2.0.H264-TEPES_Turkish.srt |
63.113 |
10.07.2023 16:58:58 +00:00 |
| the.dead.center.(7919765).nfo |
6.437 |
21.09.2021 15:04:54 +00:00 |
| The.Dead.Center.2019.720p.WEBRip.800MB.x264-GalaxyRG.srt |
49.775 |
21.09.2021 18:04:15 +00:00 |
| the.dead.don.t.die.(7884127).nfo |
6.354 |
26.03.2023 16:25:58 +00:00 |
| The.Dead.Lands.S01E01.Tell.the.Dead.Im.Coming.1080p.AMZN.WEBRip.DDP2.0.x264-NTG.srt |
26.002 |
29.03.2024 03:38:00 +00:00 |
| the.dead.lands.tell.the.dead.i.m.(8189882).nfo |
6.436 |
29.03.2024 03:38:00 +00:00 |
| the.death.of.dick.long.(7917295).nfo |
6.520 |
21.07.2023 03:10:54 +00:00 |
| The.Death.of.Dick.Long.2019.1080p.WEB-DL.DD5.1.H264-CMRG-HI.srt |
120.063 |
21.07.2023 06:10:54 +00:00 |
| the.decline.(8145635).nfo |
6.520 |
18.08.2021 18:35:22 +00:00 |
| The.Decline.2020.NF.WEBRip.srt |
55.313 |
18.08.2021 21:34:39 +00:00 |
| the.departure.(8243701).nfo |
6.437 |
5.09.2021 19:53:16 +00:00 |
| The.Departure.2020.HDRip.XviD.AC3-EVO.srt |
89.380 |
5.09.2021 22:52:26 +00:00 |
| the.devil.s.machine.(8092312).nfo |
6.437 |
23.09.2021 21:53:40 +00:00 |
| the.dictator.(5293984).nfo |
6.437 |
29.04.2022 13:39:40 +00:00 |
| The.Dictator.2012.UNRATED.BDRip.XviD-AMIABLE.srt |
111.479 |
29.04.2022 16:39:42 +00:00 |
| the.dinner.party.(8240597).nfo |
6.437 |
26.08.2021 19:48:58 +00:00 |
| The.Dinner.Party.2020.HDRip.XviD.AC3-EVO.srt |
89.270 |
26.08.2021 22:48:19 +00:00 |
| the.directive.(7691453).nfo |
6.271 |
25.09.2021 00:52:32 +00:00 |
| The.Directive.2019.1080p.HULU.WEB-DL.AAC2.0.H.264-SiGMA.srt |
59.424 |
25.09.2021 03:52:27 +00:00 |
| the.discarded.(8307714).nfo |
6.354 |
4.09.2021 05:18:28 +00:00 |
| The.Discarded.2020.HDRip.XviD.AC3-EVO.srt |
36.812 |
4.09.2021 08:17:50 +00:00 |
| the.drone.(7956000).nfo |
6.271 |
25.09.2021 00:53:04 +00:00 |
| the.eagle.and.the.albatross.(8232005).nfo |
6.354 |
11.09.2021 11:55:10 +00:00 |
| the.eastern.front.(8248835).nfo |
6.520 |
19.09.2021 20:29:24 +00:00 |
| The.Eastern.Front.2020.HDRip.XviD.AC3-EVO.srt |
61.117 |
19.09.2021 23:28:58 +00:00 |
| The.Elfkins.Baking.a.Difference.2019.GERMAN.1080p.BluRay.H264.AAC-VXT.srt |
68.894 |
3.09.2021 05:27:47 +00:00 |
| The.Enchanting.Phantom.2020.CHINESE.1080p.WEBRip.AAC2.0.x264-NOGRP.srt |
71.433 |
2.09.2021 04:35:11 +00:00 |
| the.escape.from.auschwitz.(8405144).nfo |
6.354 |
10.09.2021 15:29:40 +00:00 |
| The.Escape.From.Auschwitz.2020.720p.WEBRip.x264.AAC-YTS.MX.srt |
34.917 |
10.09.2021 18:29:18 +00:00 |
| the.f.k.it.list.(8265563).nfo |
6.352 |
3.09.2021 15:04:58 +00:00 |
| the.faceless.man.(8349814).nfo |
6.271 |
24.09.2021 11:41:54 +00:00 |
| The.Faceless.Man.2019.720p.WEBRip.x264.AAC-[YTS.MX]-spa.srt |
67.586 |
24.09.2021 14:41:54 +00:00 |
| the.fighting.preacher.(8473858).nfo |
6.354 |
21.09.2021 15:05:10 +00:00 |
| the.final.level.escaping.rancala.(8048539).nfo |
6.354 |
26.09.2021 19:48:04 +00:00 |
| The.Final.Level.Escaping.Rancala.2019.1080p.BluRay.x264-HANDJOB |
62.571 |
26.09.2021 22:47:47 +00:00 |
| the.fox.hunter.(8248774).nfo |
6.437 |
25.08.2021 17:52:28 +00:00 |
| The.Fox.Hunter.2020.HDRip.XviD.AC3-EVO.srt |
71.321 |
25.08.2021 20:51:56 +00:00 |
| The.FxxkIt.List.2019.1080p.NF.WEB-DL.HIN-ENG.DDP5.1.x264-Telly.srt |
114.928 |
3.09.2021 18:04:24 +00:00 |
| the.gallows.act.ii.(7985128).nfo |
6.271 |
17.07.2023 04:10:54 +00:00 |
| The.Gallows.Act.II.2019.1080p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
61.474 |
17.07.2023 07:10:55 +00:00 |
| the.game.changers.(7935225).nfo |
6.271 |
26.09.2021 19:48:38 +00:00 |
| the.game.changers.(9034773).nfo |
6.354 |
22.03.2023 17:25:24 +00:00 |
| The.Game.Changers.2018.720p.WEBRip.x264-[YTS.LT].srt |
190.832 |
22.03.2023 20:25:26 +00:00 |
| the.gangster.the.cop.the.devil.(7916848).nfo |
6.271 |
24.09.2021 11:39:52 +00:00 |
| the.gangster.the.cop.the.devil.(9441162).nfo |
6.354 |
7.03.2023 09:51:34 +00:00 |
| The.Gangster.The.Cop.The.Devil.2019.KOREAN.1080p.WEB-DL.DD5.1.H264-FGT.srt |
92.155 |
7.03.2023 12:51:36 +00:00 |
| the.gentlemen.(8149790).nfo |
6.437 |
19.09.2021 20:29:14 +00:00 |
| The.Gentlemen.2020.HDRip.XviD.AC3-EVO.srt |
140.588 |
19.09.2021 23:28:47 +00:00 |
| the.ghost.who.walks.(8032289).nfo |
6.437 |
26.09.2021 19:48:42 +00:00 |
| The.Go-Gos.2020.1080p.WEBRip.x264-RARBG.srt |
149.125 |
22.08.2021 16:03:56 +00:00 |
| the.go.go.s.(8303920).nfo |
6.271 |
22.08.2021 13:04:06 +00:00 |
| the.great.war.(8087313).nfo |
6.437 |
1.09.2021 11:41:22 +00:00 |
| The.Great.War.2019.720p.BluRay.x264-ROVERS.srt |
85.910 |
1.09.2021 14:41:03 +00:00 |
| the.grizzlies.(7898844).nfo |
6.437 |
28.08.2021 12:59:04 +00:00 |
| The.Grizzlies.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
86.302 |
28.08.2021 15:58:12 +00:00 |
| the.grudge.(8136150).nfo |
6.271 |
11.09.2021 21:59:58 +00:00 |
| The.Grudge.2020.1080p.WEBRip.x264.AAC5.1-.YTS.MX.-tur.srt |
43.092 |
12.09.2021 00:59:25 +00:00 |
| the.half.of.it.(8291346).nfo |
6.354 |
21.08.2021 10:13:32 +00:00 |
| the.hard.way.(7676995).nfo |
6.437 |
26.09.2021 19:49:04 +00:00 |
| The.Hard.Way.2019.1080p.NF.WEB-DL.DD5.1.H264-CMRG.srt |
72.847 |
26.09.2021 22:48:47 +00:00 |
| the.hater.(8304779).nfo |
6.354 |
1.09.2021 11:41:56 +00:00 |
| The.Hater.2020.720p.BluRay.x264.AAC-[YTS.MX].srt |
113.773 |
1.09.2021 14:41:37 +00:00 |
| the.haunted.(8218479).nfo |
6.437 |
20.09.2021 11:39:28 +00:00 |
| The.Haunted.2019.HDRip.XviD.AC3-EVO.srt |
18.598 |
20.09.2021 14:38:57 +00:00 |
| the.haunting.of.alcatraz.(8330453).nfo |
6.437 |
18.09.2021 01:11:44 +00:00 |
| The.Haunting.Of.Alcatraz.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
74.614 |
18.09.2021 04:11:32 +00:00 |
| the.haunting.of.margam.castle.(8629667).nfo |
6.354 |
11.09.2021 11:54:02 +00:00 |
| The.Haunting.Of.Margam.Castle.2020.1080p.WEBRip.x264.AAC5.1-[YTS.MX].tr.srt |
53.509 |
11.09.2021 14:53:32 +00:00 |
| The.Haunting.Of.Molly.Bannister.2019.720p.WEBRip.x264.AAC-[YTS.MX].srt |
44.555 |
8.09.2021 23:04:41 +00:00 |
| the.head.hunter.(7710495).nfo |
6.271 |
25.09.2021 00:52:54 +00:00 |
| the.high.note.(8653858).nfo |
6.354 |
8.09.2021 20:04:58 +00:00 |
| The.High.Note.2020.720p.BluRay.x264.srt |
183.633 |
8.09.2021 23:04:47 +00:00 |
| the.host.(8114958).nfo |
6.520 |
20.06.2022 11:10:12 +00:00 |
| the.host.(8125116).nfo |
6.437 |
3.09.2021 22:16:26 +00:00 |
| the.host.(9896373).nfo |
6.438 |
17.02.2024 23:45:16 +00:00 |
| The.Host.2020.720p.WEBRip.x264-.YTS.LT.es.srt |
90.476 |
4.09.2021 01:15:50 +00:00 |
| The.Host.2020.HDRip.XviD.AC3-EVO.srt |
85.989 |
20.06.2022 14:10:13 +00:00 |
| the.hunt.(8145056).nfo |
6.354 |
27.08.2021 19:10:16 +00:00 |
| The.Hunt.2020.HDRip.XviD.AC3-EVO.srt |
81.140 |
27.08.2021 22:09:29 +00:00 |
| the.huntress.rune.of.the.dead.(7946817).nfo |
6.437 |
17.07.2023 15:55:24 +00:00 |
| the.insurrection.(8206134).nfo |
6.271 |
11.09.2021 11:54:18 +00:00 |
| The.Insurrection.2020.720p.WEBRip.x264.AAC.srt |
84.642 |
11.09.2021 14:53:49 +00:00 |
| the.inventor.out.for.blood.in.(7957552).nfo |
6.354 |
17.07.2023 12:47:52 +00:00 |
| The.Inventor.Out.For.Blood.In.Silicon.Valley.2019.1080p.WEBRip.x264.srt |
195.866 |
17.07.2023 15:47:52 +00:00 |
| the.invisible.man.(8138124).nfo |
6.285 |
18.08.2021 06:35:02 +00:00 |
| The.Invisible.Man.2020.srt |
56.065 |
18.08.2021 06:34:49 +00:00 |
| the.jack.in.the.box.(8198258).nfo |
6.437 |
23.08.2021 15:18:40 +00:00 |
| The.Jack.In.The.Box.2020.720p.WEBRip.x264.AAC-YTS.MX.srt |
54.027 |
23.08.2021 18:18:23 +00:00 |
| the.jonestown.haunting.(8180434).nfo |
6.437 |
23.08.2021 15:20:14 +00:00 |
| The.Jonestown.Haunting.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
67.984 |
23.08.2021 18:19:56 +00:00 |
| the.king.(7952940).nfo |
6.271 |
22.09.2021 18:48:54 +00:00 |
| The.King.2019.1080p.NF.WEBRip.DDP5.1.Atmos.x264-NTG_tur.srt |
83.567 |
22.09.2021 21:48:06 +00:00 |
| the.king.of.staten.island.(8320284).nfo |
6.354 |
26.08.2021 23:22:36 +00:00 |
| the.kissing.booth.2.(8296118).nfo |
6.354 |
2.09.2021 13:54:04 +00:00 |
| The.Kissing.Booth.2.2020.720p.WEB.H264-SECRECY_Turkish.srt |
140.830 |
2.09.2021 16:53:38 +00:00 |
| the.knight.before.christmas.(7992997).nfo |
6.271 |
24.09.2021 11:39:48 +00:00 |
| The.Knight.Before.Christmas.2019.1080p.NF.WEB-DL.DDP5.1.Atmos.H264-CMRG.srt |
95.383 |
24.09.2021 14:39:47 +00:00 |
| the.larva.island.movie.(8295481).nfo |
6.354 |
28.08.2021 12:58:32 +00:00 |
| The.Larva.Island.Movie.2020.1080p.WEBRip.x264-RARBG.srt |
37.440 |
28.08.2021 15:57:41 +00:00 |
| the.last.beyond.(8223472).nfo |
6.354 |
18.09.2021 15:47:08 +00:00 |
| The.Last.Beyond.2019.HDRip.XviD.AC3-EVO.srt |
47.337 |
18.09.2021 18:46:50 +00:00 |
| the.last.big.save.(8051865).nfo |
6.271 |
22.08.2021 18:12:36 +00:00 |
| The.Last.Big.Save.2019.WEB-DL.x264-FGT.srt |
99.138 |
22.08.2021 21:12:25 +00:00 |
| the.last.conception.(8307663).nfo |
6.354 |
19.09.2021 06:08:22 +00:00 |
| The.Last.Conception.2020.HDRip.XviD.AC3-EVO.srt |
115.785 |
19.09.2021 09:07:59 +00:00 |
| the.last.days.of.american.crime.(8235493).nfo |
6.354 |
2.09.2021 01:35:40 +00:00 |
| The.Last.Days.of.American.Crime.2020.1080p.NF.WEB-DL.DDP5.1.x264-NTG.srt |
93.721 |
2.09.2021 04:35:16 +00:00 |
| the.last.faust.(8002668).nfo |
6.188 |
25.09.2021 15:13:48 +00:00 |
| The.Last.Faust.2019.1080p.WEB-DL.DD2.0.H264-EVO-HI.srt |
83.162 |
25.09.2021 18:13:39 +00:00 |
| the.last.full.measure.(8110642).nfo |
6.449 |
18.08.2021 06:35:02 +00:00 |
| The.Last.Full.Measure.2019.720p.BluRay.x264.AAC-.YTS.LT.srt |
117.309 |
18.08.2021 06:34:50 +00:00 |
| the.last.thing.he.wanted.(8102844).nfo |
6.354 |
18.09.2021 15:47:30 +00:00 |
| The.Last.Thing.He.Wanted.2020.1080p.NF.WEBRip.DD5.1.x264-FGT.srt |
123.513 |
18.09.2021 18:47:12 +00:00 |
| the.legion.(8208909).nfo |
6.354 |
5.09.2021 19:53:28 +00:00 |
| The.Legion.2020.1080p.WEB-DL.DD5.1.H264-FGT.srt |
50.274 |
5.09.2021 22:52:37 +00:00 |
| the.lion.king.(7872891).nfo |
6.354 |
22.09.2021 18:48:36 +00:00 |
| The.Lion.King.2019.720p.HDCAM.x264-1XBET.srt |
73.527 |
22.09.2021 21:47:48 +00:00 |
| the.lost.husband.(8333531).nfo |
6.354 |
15.09.2021 17:30:46 +00:00 |
| the.lovebirds.(8293621).nfo |
6.354 |
6.09.2021 15:53:32 +00:00 |
| the.madness.within.(8005022).nfo |
6.188 |
23.09.2021 08:18:04 +00:00 |
| The.Madness.Within.2019.1080p.WEB-DL.DD2.0.H264-EVO-HI.srt |
105.594 |
23.09.2021 11:17:12 +00:00 |
| the.maestro.(7682055).nfo |
6.354 |
21.09.2021 01:54:08 +00:00 |
| The.Maestro.2018.1080p.WEB-DL.DD5.1.H264-eSc.srt |
119.804 |
21.09.2021 04:53:33 +00:00 |
| the.magic.kids.three.unlikely.(8307693).nfo |
6.520 |
18.09.2021 15:47:58 +00:00 |
| The.Magic.Kids.Three.Unlikely.Heroes.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
77.968 |
18.09.2021 18:47:41 +00:00 |
| the.main.event.(8166941).nfo |
6.271 |
6.09.2021 15:52:06 +00:00 |
| The.Main.Event.2020.720p.iNTERNAL.WEB.x264-SECRECY.srt |
108.135 |
6.09.2021 18:51:09 +00:00 |
| The.Man.From.Kathmandu.2020.HDRip.XviD.AC3-EVO.srt |
47.283 |
15.09.2021 02:23:22 +00:00 |
| the.man.from.kathmandu.vol.1.(8307651).nfo |
6.437 |
14.09.2021 23:24:16 +00:00 |
| the.man.standing.next.(8199754).nfo |
6.520 |
10.09.2021 05:02:18 +00:00 |
| the.mercenary.(8062080).nfo |
6.520 |
4.09.2021 05:18:34 +00:00 |
| The.Mercenary.2019.1080p.WEB-DL.DD5.1.H264-EVO.srt |
60.461 |
4.09.2021 08:17:55 +00:00 |
| the.message.(8323706).nfo |
6.437 |
3.09.2021 15:04:46 +00:00 |
| The.Messenger.2019.720p.BluRay.x264-SPRiNTER.srt |
78.545 |
25.09.2021 03:53:16 +00:00 |
| the.most.dangerous.animal.of.all.(8153526).nfo |
6.442 |
2.04.2024 17:30:44 +00:00 |
| The.Most.Dangerous.Animal.of.All.S01E01.1080p.WEB.H264-XLF.srt |
49.599 |
2.04.2024 17:30:44 +00:00 |
| the.murder.of.nicole.brown.(8051613).nfo |
6.437 |
1.09.2021 11:41:46 +00:00 |
| The.Murder.Of.Nicole.Brown.Simpson.2019.720p.WEBRip.x264-.YTS.LT.srt |
70.301 |
1.09.2021 14:41:26 +00:00 |
| the.naked.wanderer.(8286416).nfo |
6.437 |
23.09.2021 08:18:20 +00:00 |
| The.Naked.Wanderer.2019.1080p.WEBRip.x264-[YTS.LT].srt |
92.821 |
23.09.2021 11:17:27 +00:00 |
| the.night.clerk.(8219571).nfo |
6.354 |
19.08.2021 20:46:54 +00:00 |
| The.Night.Clerk.2020.1080p.BluRay.REMUX.AVC.DTS-HD.MA.5.1-FGT.srt |
67.937 |
19.08.2021 23:46:04 +00:00 |
| the.nomads.(8069372).nfo |
6.271 |
25.09.2021 00:53:30 +00:00 |
| The.Nomads.2019.1080p.WEBRip.x264.srt |
118.244 |
25.09.2021 03:53:26 +00:00 |
| the.old.guard.(8279459).nfo |
6.271 |
4.09.2021 05:18:04 +00:00 |
| the.old.guard.(8318020).nfo |
6.354 |
12.04.2024 13:38:14 +00:00 |
| The.Old.Guard.2020.1080p.WEBRip.x264.AAC5.1-[YTS.MX].srt |
81.448 |
12.04.2024 16:38:15 +00:00 |
| The.Old.Guard.2020.720p.WEB.H264-SECRECY_Turkish.srt |
81.387 |
4.09.2021 08:17:25 +00:00 |
| the.one.and.only.ivan.(8327627).nfo |
6.354 |
26.08.2021 23:22:06 +00:00 |
| The.One.And.Only.Ivan.2020.1080p.WEBRip.x264.AAC5.1-[YTS.MX].srt |
92.250 |
27.08.2021 02:21:25 +00:00 |
| the.opposite.sex.and.how.to.live.(6913777).nfo |
6.354 |
14.02.2022 16:16:54 +00:00 |
| The.Orchard.2020.HDRip.XviD.AC3-EVO.srt |
71.138 |
27.08.2021 22:09:17 +00:00 |
| the.other.lamb.(8183563).nfo |
6.354 |
3.09.2021 15:04:44 +00:00 |
| The.Other.Lamb.2019.tr.srt |
32.191 |
3.09.2021 18:04:09 +00:00 |
| the.other.side.of.heaven.2.fire.(7917775).nfo |
6.520 |
23.09.2021 21:53:26 +00:00 |
| The.Other.Side.of.Heaven.2.Fire.of.Faith.2019.HDRip.AC3.x264-CMRG.srt |
93.016 |
24.09.2021 00:52:30 +00:00 |
| the.outpost.(8318186).nfo |
6.354 |
4.09.2021 11:57:42 +00:00 |
| The.Outpost.2020.720p.BluRay.800MB.x264-GalaxyRG.srt |
147.575 |
4.09.2021 14:57:01 +00:00 |
| the.pale.door.(8323687).nfo |
6.354 |
27.08.2021 19:10:46 +00:00 |
| The.Pale.Door.2020.1080p.WEB-DL.DD5.1.H264-CMRG.srt |
66.060 |
27.08.2021 22:10:00 +00:00 |
| the.photograph.(8296131).nfo |
6.354 |
10.09.2021 05:03:06 +00:00 |
| The.Players.2020.720p.WEB.H264-CRYPTIC_tur.srt |
79.220 |
18.08.2021 17:57:27 +00:00 |
| the.poison.rose.(7825892).nfo |
6.271 |
26.09.2021 19:48:22 +00:00 |
| The.Poison.Rose.2019.1080p.WEBRip.x264-RARBG.srt |
96.027 |
26.09.2021 22:48:04 +00:00 |
| the.postcard.killings.(8197348).nfo |
6.271 |
13.09.2021 05:17:32 +00:00 |
| The.Postcard.Killings.2020.1080p.WEBRip.x264.AAC5.1-[YTS.MX].srt |
102.845 |
13.09.2021 08:16:50 +00:00 |
| the.pretenders.(7961582).nfo |
6.437 |
14.07.2023 03:30:26 +00:00 |
| the.prince.(8295792).nfo |
6.437 |
2.09.2021 13:53:32 +00:00 |
| The.Prince.2019.[BluRay+BRRip+BDRip] - renomeie para seu release.srt |
51.548 |
2.09.2021 16:53:04 +00:00 |
| the.quarry.(8336212).nfo |
6.354 |
8.09.2021 20:03:52 +00:00 |
| The.Queen.at.War.2020.srt |
71.826 |
19.09.2021 23:28:00 +00:00 |
| the.rental.(8297182).nfo |
6.354 |
3.09.2021 15:03:28 +00:00 |
| the.resistance.fighter.(8424046).nfo |
6.437 |
25.09.2021 00:53:20 +00:00 |
| the.rest.of.us.(8174342).nfo |
6.354 |
27.08.2021 19:10:24 +00:00 |
| The.Rest.Of.Us.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
83.531 |
27.08.2021 22:09:38 +00:00 |
| the.rhythm.section.(8161873).nfo |
6.520 |
29.08.2021 19:28:30 +00:00 |
| The.Rhythm.Section.2020.HDRip.XviD.AC3-EVO.srt |
55.253 |
29.08.2021 22:28:31 +00:00 |
| the.roads.not.taken.(8297185).nfo |
6.354 |
27.08.2021 19:10:50 +00:00 |
| the.runners.(8284204).nfo |
6.437 |
8.09.2021 20:04:12 +00:00 |
| The.Runners.2020.720p.WEBRip.800MB.x264-GalaxyRG.srt |
64.583 |
8.09.2021 23:04:02 +00:00 |
| the.screaming.silent.(8224493).nfo |
6.354 |
4.09.2021 05:17:32 +00:00 |
| The.Screaming.Silent.2020.WEBRip.x264-ION10.srt |
126.353 |
4.09.2021 08:16:53 +00:00 |
| the.secret.dare.to.dream.(8394150).nfo |
6.437 |
22.08.2021 03:22:16 +00:00 |
| The.Secret.Dare.to.Dream.1080p.WEB-DL.DD5.1.H.264-EVO.srt |
120.211 |
22.08.2021 06:22:10 +00:00 |
| the.secret.garden.(8445502).nfo |
6.520 |
11.09.2021 11:54:42 +00:00 |
| The.Secret.Garden.2020.1080p.BluRay.6ch.srt |
61.313 |
11.09.2021 14:54:12 +00:00 |
| the.set.up.(8181149).nfo |
6.354 |
20.08.2023 13:16:32 +00:00 |
| The.Set.Up.2019.1080p.NF.WEB-DL.DDP2.0.x264-CMRG.srt |
102.734 |
20.08.2023 16:16:33 +00:00 |
| the.shed.(7979617).nfo |
6.520 |
22.09.2021 04:49:26 +00:00 |
| The.Shed.2019.1080p.WEB-DL.DD5.1.H264-CMRG.srt |
71.477 |
22.09.2021 07:48:42 +00:00 |
| The.Silence.of.the.Marsh.2019.1080p.NF.WEB-DL.DDP5.1.x264-CMRG.srt |
57.512 |
25.09.2021 03:53:19 +00:00 |
| the.silencing.(8295250).nfo |
6.354 |
3.09.2021 02:28:02 +00:00 |
| the.skywalker.legacy.(8708139).nfo |
6.437 |
2.09.2021 01:35:28 +00:00 |
| the.skywalker.legacy.(8801860).nfo |
6.354 |
22.04.2023 09:10:42 +00:00 |
| The.Skywalker.Legacy.2020.1080p.BluRay.x265-RARBG.srt |
161.343 |
2.09.2021 04:35:04 +00:00 |
| THE.SKYWALKER.LEGACY.2020.WEB-DL.DSNP.srt |
175.689 |
22.04.2023 12:10:42 +00:00 |
| the.sleepover.(8323994).nfo |
6.188 |
29.08.2021 19:27:46 +00:00 |
| The.Sleepover.2020.720p.NF.WEB-DL.DDP5.1.x264-NTG_tur.srt |
113.049 |
29.08.2021 22:27:46 +00:00 |
| the.soul.collector.(8112903).nfo |
6.520 |
28.08.2021 12:59:10 +00:00 |
| the.source.of.shadows.(8188876).nfo |
6.354 |
11.09.2021 11:54:10 +00:00 |
| The.Source.Of.Shadows.2020.HDRip.XviD.AC3-EVO.srt |
32.105 |
11.09.2021 14:53:40 +00:00 |
| the.souvenir.(7937549).nfo |
6.437 |
22.09.2021 18:48:42 +00:00 |
| the.souvenir.(9555343).nfo |
6.354 |
12.06.2023 02:16:16 +00:00 |
| The.Souvenir.2019.tr.srt |
97.316 |
12.06.2023 05:16:16 +00:00 |
| the.speed.cubers.(8306319).nfo |
6.437 |
15.09.2021 17:30:42 +00:00 |
| the.stalker.(8319099).nfo |
6.437 |
15.09.2021 17:32:02 +00:00 |
| The.Stalker.2020.1080p.AMZN.WEB-DL.DDP2.0.H.264-NTG.srt |
49.603 |
15.09.2021 20:31:04 +00:00 |
| the.stand.at.paxton.county.(8320581).nfo |
6.354 |
15.09.2021 17:31:30 +00:00 |
| The.Stand.at.Paxton.County.2020.1080p.NF.WEB-DL.DD+2.0.x264-iKA.srt |
85.558 |
15.09.2021 20:30:32 +00:00 |
| the.story.of.plastic.(8174063).nfo |
6.352 |
23.07.2023 20:46:40 +00:00 |
| The.Story.Of.Plastic.2020.WEBRip.x264-CAFFEiNE.srt |
104.022 |
23.07.2023 23:46:41 +00:00 |
| the.sun.is.also.a.star.(7854258).nfo |
6.520 |
25.09.2021 00:52:48 +00:00 |
| The.Sun.Is.Also.a.Star.2019.HDRip.AC3.x264-CMRG.srt |
96.604 |
25.09.2021 03:52:43 +00:00 |
| the.sunlit.night.(8577999).nfo |
6.437 |
3.09.2021 15:05:04 +00:00 |
| The.Sunlit.Night.2020.HDRip.XviD.AC3-EVO.srt |
49.069 |
3.09.2021 18:04:29 +00:00 |
| the.swamp.(8310559).nfo |
6.354 |
11.09.2021 11:54:36 +00:00 |
| The.Swamp.2020.1080p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
125.670 |
11.09.2021 14:54:06 +00:00 |
| the.swan.princess.a.royal.(8303423).nfo |
6.437 |
26.08.2021 23:21:54 +00:00 |
| The.Swan.Princess.A.Royal.Wedding.2020.HDRip.XviD.AC3-EVO.srt |
70.802 |
27.08.2021 02:21:13 +00:00 |
| the.swing.of.things.(8264496).nfo |
6.354 |
3.09.2021 22:16:10 +00:00 |
| The.Swing.of.Things.2020.1080p.BluRay.DTS.X264-CMRG.srt |
117.069 |
4.09.2021 01:15:35 +00:00 |
| the.tax.collector.(8455869).nfo |
6.437 |
11.09.2021 11:55:24 +00:00 |
| The.Tax.Collector.2020.1080p.BluRay.x264.AAC5.1-[YTS.MX].srt |
87.447 |
11.09.2021 14:54:55 +00:00 |
| the.tent.(8258777).nfo |
6.437 |
27.08.2021 19:10:12 +00:00 |
| The.Tent.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
61.185 |
27.08.2021 22:09:25 +00:00 |
| the.thousand.faces.of.dunjia.(8332038).nfo |
6.354 |
2.09.2021 01:35:32 +00:00 |
| the.trip.to.greece.(8216129).nfo |
6.437 |
21.08.2021 13:20:46 +00:00 |
| The.Trip.To.Greece.2020.720p.WEBRip.x264.AAC-YTS.MX.srt |
156.059 |
21.08.2021 16:20:43 +00:00 |
| the.turning.(8256013).nfo |
6.354 |
3.09.2021 02:28:06 +00:00 |
| The.Turning.2020.1080p.BluRay.x265-RARBG.tr.srt |
50.935 |
3.09.2021 05:27:34 +00:00 |
| the.twentieth.century.(8163141).nfo |
6.437 |
13.07.2023 20:34:10 +00:00 |
| The.Twentieth.Century.2019.HDRip.XviD.AC3-EVO.srt |
87.774 |
13.07.2023 23:34:11 +00:00 |
| the.unborn.(8192205).nfo |
6.437 |
28.08.2021 12:58:08 +00:00 |
| The.Unborn.2020.HDRip.XviD.AC3-EVO-HI.srt |
49.982 |
28.08.2021 15:57:16 +00:00 |
| the.unfamiliar.(8364701).nfo |
6.354 |
3.09.2021 15:04:52 +00:00 |
| the.ungulate.(8312142).nfo |
6.271 |
23.09.2021 21:53:50 +00:00 |
| The.Ungulate.2019.WEBRip.x264-ION10.srt |
61.774 |
24.09.2021 00:52:53 +00:00 |
| the.vast.of.night.(8227478).nfo |
6.438 |
6.09.2021 15:52:52 +00:00 |
| The.Vast.of.Night.2019.1080p.WEBRip.x264-RARBG.srt |
127.725 |
6.09.2021 18:51:56 +00:00 |
| the.very.excellent.mr.dundee.(8291812).nfo |
6.437 |
19.09.2021 20:29:20 +00:00 |
| The.Very.Excellent.Mr.Dundee.2020.HDRip.XviD.AC3-EVO.srt |
123.198 |
19.09.2021 23:28:53 +00:00 |
| the.viking.war.(7671532).nfo |
6.354 |
8.07.2023 23:39:48 +00:00 |
| The.Viking.War.2019.1080p.AMZN.WEB-DL.DDP5.1.H264-CMRG.srt |
52.430 |
9.07.2023 02:39:49 +00:00 |
| the.voices.(8207378).nfo |
6.437 |
22.08.2021 07:03:36 +00:00 |
| The.Voices.2020.HDRip.XviD.AC3-EVO.srt |
64.900 |
22.08.2021 10:03:27 +00:00 |
| the.war.with.grandpa.(8468226).nfo |
6.437 |
19.08.2021 00:26:34 +00:00 |
| The.War.With.Grandpa.2020.1080p.WEBRip.x264.AAC5.1- YTS.MX -TURKISH.srt |
105.914 |
19.08.2021 03:25:48 +00:00 |
| the.warrant.(8176167).nfo |
6.437 |
15.09.2021 17:30:28 +00:00 |
| The.Warrant.2020.720p.WEBRip.x264.AAC-YTS.MX.srt |
75.884 |
15.09.2021 20:29:29 +00:00 |
| the.way.back.(8146883).nfo |
6.354 |
11.09.2021 11:55:32 +00:00 |
| The.Way.Back.2020.HDRip.XviD.AC3-EVO.srt |
104.510 |
11.09.2021 14:55:03 +00:00 |
| the.wedding.unplanner.(8263498).nfo |
6.437 |
26.08.2021 23:22:26 +00:00 |
| The.Wedding.Unplanner.2020.SPANISH.1080p.BluRay.H264.AAC-VXT.srt |
137.866 |
27.08.2021 02:21:45 +00:00 |
| the.weight.of.gold.(8303507).nfo |
6.437 |
19.09.2021 20:29:06 +00:00 |
| The.Weight.of.Gold.2020.1080p.WEBRip.x265-RARBG.srt |
99.381 |
19.09.2021 23:28:39 +00:00 |
| the.whistlers.(8166094).nfo |
7.018 |
2.09.2021 01:36:04 +00:00 |
| the.whistlers.(9944697).nfo |
6.354 |
20.03.2024 08:34:58 +00:00 |
| The.Whistlers.2019.1080p.AMZN.WEB-DL.DDP5.1.H264-CMRG.BEYAZ.srt |
53.316 |
2.09.2021 04:35:40 +00:00 |
| The.Whistlers.2019.1080p.AMZN.WEB-DL.DDP5.1.H264-CMRG.SARI.srt |
70.666 |
2.09.2021 01:36:04 +00:00 |
| The.Whistlers.2019.1080p.BluRay.x264.DTS.5.1-EDPH.srt |
49.668 |
20.03.2024 11:34:58 +00:00 |
| the.will.(8231733).nfo |
6.520 |
11.09.2021 21:59:28 +00:00 |
| The.Will.2020.720p.AMZN.WEBRip.X264.AAC.2.0-EVO.srt |
117.996 |
12.09.2021 00:58:56 +00:00 |
| the.willoughbys.(8334226).nfo |
6.354 |
3.09.2021 02:27:46 +00:00 |
| the.wind.walker.(8162594).nfo |
6.437 |
23.08.2021 15:19:34 +00:00 |
| The.Wind.Walker.2020.720p.WEBRip.800MB.x264-GalaxyRG-HI.srt |
84.197 |
23.08.2021 18:19:16 +00:00 |
| the.windermere.children.(8083652).nfo |
6.520 |
20.09.2021 11:38:48 +00:00 |
| The.Windermere.Children.2020.720p.WEBRip.x264.AAC-.YTS.LT.srt |
79.301 |
20.09.2021 14:38:16 +00:00 |
| the.wishmas.tree.(8249908).nfo |
6.437 |
21.08.2021 15:20:26 +00:00 |
| The.Wishmas.Tree.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
65.821 |
21.08.2021 18:20:22 +00:00 |
| the.wolf.hour.(7971662).nfo |
6.271 |
10.07.2023 02:33:52 +00:00 |
| The.Wolves.[Los.Lobos].2019.1080p.WEBRip.x264.AC3.HORiZON-ArtSubs.srt |
48.873 |
25.08.2021 20:52:13 +00:00 |
| the.wrong.missy.(8210964).nfo |
6.437 |
9.09.2021 16:28:42 +00:00 |
| The.Wrong.Missy.2020.1080p.NF.WEBRip.DDP5.1.x264-CMRG.srt |
120.849 |
9.09.2021 19:28:25 +00:00 |
| the.wrong.mommy.(8299460).nfo |
6.437 |
24.09.2021 11:39:56 +00:00 |
| The.Wrong.Mommy.2019.polish.srt |
76.951 |
24.09.2021 14:39:55 +00:00 |
| Theater 2020 1080p AMZN WEB-DL DDP5.1-NSBC.srt |
115.813 |
3.09.2021 18:03:07 +00:00 |
| theater.(8291185).nfo |
6.271 |
3.09.2021 15:03:42 +00:00 |
| TheSouvenir.2019.1080p.BluRay.X264-AMIABLE.EtHD.srt |
106.518 |
22.09.2021 21:47:55 +00:00 |
| they.reach.(8410582).nfo |
6.437 |
29.08.2021 19:28:26 +00:00 |
| They.Reach.2020.720p.BluRay.x264.AAC-[YTS.MX].srt |
73.225 |
29.08.2021 22:28:26 +00:00 |
| think.like.a.dog.(8231231).nfo |
6.437 |
2.09.2021 13:53:10 +00:00 |
| Think.Like.A.Dog.2020.DVDRip.x264-CMRG.srt |
112.443 |
2.09.2021 16:52:43 +00:00 |
| this.changes.everything.(8419387).nfo |
6.354 |
21.09.2021 15:04:02 +00:00 |
| This.Changes.Everything.2019.1080p.AMZN.WEB-DL.DDP5.1.H.264-TEPES.srt |
132.723 |
21.09.2021 18:03:22 +00:00 |
| this.is.our.home.(8007806).nfo |
6.354 |
24.09.2021 11:41:50 +00:00 |
| This.Is.Our.Home.2019.1080p.WEBRip.x264-RARBG.srt |
63.502 |
24.09.2021 14:41:50 +00:00 |
| those.who.deserve.to.die.(8320211).nfo |
6.437 |
18.09.2021 01:12:56 +00:00 |
| Those.Who.Deserve.to.Die.2020.HDRip.XviD.AC3-EVO-HI.srt |
70.077 |
18.09.2021 04:12:42 +00:00 |
| Three Christs (2017) BeinTV_tur.srt |
113.003 |
10.09.2021 08:02:15 +00:00 |
| three.christs.(8579243).nfo |
6.354 |
10.09.2021 05:02:34 +00:00 |
| through.black.spruce.(7928852).nfo |
6.437 |
26.09.2021 05:44:06 +00:00 |
| Through.Black.Spruce.2018.720p.WEBRip.x264-YIFY.srt |
82.017 |
26.09.2021 08:43:52 +00:00 |
| tigertail.(8167755).nfo |
6.188 |
4.09.2021 11:58:16 +00:00 |
| Tigertail.2020.720p.iNTERNAL.WEB.x264-SECRECY.srt |
48.827 |
4.09.2021 14:57:36 +00:00 |
| tijuana.jackson.purpose.over.(8303550).nfo |
6.437 |
20.08.2021 12:50:32 +00:00 |
| Tijuana.Jackson.Purpose.Over.Prison.2020.HDRip.XviD.AC3-EVO.srt |
160.642 |
20.08.2021 15:49:37 +00:00 |
| time.to.hunt.(8184542).nfo |
6.354 |
1.09.2021 11:41:04 +00:00 |
| Time.to.Hunt.2020.1080p.NF.WEB-DL.DDP5.1.Atmos.x264-CMRG.srt |
78.496 |
1.09.2021 14:40:44 +00:00 |
| timeless.love.(8136261).nfo |
6.354 |
22.07.2023 05:11:22 +00:00 |
| Timeless.Love.2019.1080p.WEBRip.x264-RARBG.es.srt |
128.658 |
22.07.2023 08:11:23 +00:00 |
| timmy.failure.mistakes.were.made.(8182286).nfo |
6.354 |
18.09.2021 15:47:18 +00:00 |
| Timmy.Failure.Mistakes.Were.Made.2020.WEBRip.x264-ION10.tr.srt |
108.760 |
18.09.2021 18:47:00 +00:00 |
| tkkg no sdh.srt |
75.989 |
9.07.2023 11:36:34 +00:00 |
| tkkg.(7982396).nfo |
6.437 |
9.07.2023 08:36:34 +00:00 |
| To All the Boys P.S. I Still Love You.srt |
99.778 |
10.09.2021 18:30:15 +00:00 |
| to.all.the.boys.p.s.i.still.love.(8292893).nfo |
6.354 |
10.09.2021 15:30:38 +00:00 |
| to.the.beat.back.2.school.(8122855).nfo |
6.354 |
21.08.2021 09:13:20 +00:00 |
| To.The.Beat.Back.2.School.2020.1080p.WEBRip.x264-RARBG.es.srt |
135.959 |
21.08.2021 12:13:18 +00:00 |
| togo.(8028879).nfo |
6.520 |
23.09.2021 08:18:12 +00:00 |
| Togo.2019.iNTERNAL.720p.WEB.H264-SECRECY.srt |
61.236 |
23.09.2021 11:17:20 +00:00 |
| tommaso.(8320196).nfo |
6.520 |
20.09.2021 11:40:02 +00:00 |
| Tommaso.2019.720p.WEBRip.x264.AAC-YTS.MX.srt |
84.022 |
20.09.2021 14:39:31 +00:00 |
| tone.deaf.(7873451).nfo |
6.437 |
22.09.2021 04:49:30 +00:00 |
| Tone.Deaf.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
72.613 |
22.09.2021 07:48:46 +00:00 |
| toothfairy.2.(8482697).nfo |
6.271 |
19.09.2021 20:28:14 +00:00 |
| toothfairy.2.(9034906).nfo |
6.437 |
14.01.2023 23:59:38 +00:00 |
| Toothfairy.2.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
49.422 |
15.01.2023 02:59:39 +00:00 |
| top.gunner.(8256385).nfo |
6.520 |
28.08.2021 12:58:16 +00:00 |
| Top.Gunner.2020.HDRip.XviD.AC3-EVO-HI.srt |
82.139 |
28.08.2021 15:57:23 +00:00 |
| tora-san.wish.you.were.here.2019.1080p.bluray.x264-regret.srt |
122.345 |
22.09.2021 07:48:11 +00:00 |
| torn.dark.bullets.(8186937).nfo |
6.437 |
18.09.2021 01:13:18 +00:00 |
| Torn.Dark.Bullets.2020.1080p.WEB-DL.DDP5.1.x264-CMRG.srt |
102.329 |
18.09.2021 04:13:05 +00:00 |
| tower.of.silence.(8003678).nfo |
6.271 |
27.03.2023 16:45:40 +00:00 |
| Tower.Of.Silence.2019.1080p.WEB-DL.DD5.1.H264-EVO.srt |
66.079 |
27.03.2023 19:45:41 +00:00 |
| Toy Story 4.srt |
122.590 |
26.09.2021 22:47:52 +00:00 |
| toy.story.4.(7899886).nfo |
6.354 |
26.09.2021 19:48:10 +00:00 |
| tr final cow.srt |
48.645 |
6.09.2021 18:52:49 +00:00 |
| train.to.busan.presents.(8332418).nfo |
6.354 |
11.09.2021 02:03:32 +00:00 |
| transference.(8138518).nfo |
6.354 |
21.09.2021 01:54:22 +00:00 |
| Transference.2020.1080p.WEBRip.x264.AAC5.1-.YTS.MX.srt |
62.022 |
21.09.2021 04:53:47 +00:00 |
| Trauma Center 2019 1080p BluRay x264 6CH ESubs - MkvHub.Com.srt |
54.393 |
10.07.2023 10:59:22 +00:00 |
| trauma.center.(8079040).nfo |
6.354 |
10.07.2023 07:59:22 +00:00 |
| tread.(8254677).nfo |
6.437 |
23.08.2021 15:19:44 +00:00 |
| Tread.2020.720p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
126.139 |
23.08.2021 18:19:27 +00:00 |
| tribal.get.out.alive.(8298598).nfo |
6.437 |
9.09.2021 16:27:50 +00:00 |
| Tribal.Get.Out.Alive.2020.HDRip.XviD.AC3-EVO.srt |
67.929 |
9.09.2021 19:27:34 +00:00 |
| tribal.i.ll.show.you.chief.(8218384).nfo |
6.437 |
14.12.2022 17:07:56 +00:00 |
| Tribal.S01E01.1080p.WEBRip.x264-aAF.srt |
45.245 |
14.12.2022 17:07:56 +00:00 |
| trick.or.treat.(8389331).nfo |
6.437 |
21.09.2021 15:04:18 +00:00 |
| Trick.Or.Treat.2019.720p.WEBRip.x264.AAC-[YTS.MX].srt |
78.567 |
21.09.2021 18:03:39 +00:00 |
| trigger.points.(8183542).nfo |
6.437 |
19.08.2021 00:03:44 +00:00 |
| Trigger.Points.2020.1080p.AMZN.WEB-DL.DDP5.1.H.264-CMRG.srt |
34.832 |
19.08.2021 03:02:58 +00:00 |
| triple.threat.(7697268).nfo |
6.437 |
24.09.2021 11:41:42 +00:00 |
| Triple.Threat.2019.1080p.WEB-DL.DD5.1.H264-FGT.srt |
66.965 |
24.09.2021 14:41:42 +00:00 |
| trixie.mattel.moving.parts.(8326627).nfo |
6.437 |
22.09.2021 04:48:46 +00:00 |
| Trixie.Mattel.Moving.Parts.2019.1080p.WEBRip.x264.AAC5.1-[YTS.MX].srt |
121.236 |
22.09.2021 07:48:02 +00:00 |
| Trolls World Tour.srt |
99.649 |
18.08.2021 06:49:15 +00:00 |
| trolls.world.tour.(8296589).nfo |
6.354 |
18.08.2021 03:49:54 +00:00 |
| true.fiction.(8135189).nfo |
6.520 |
27.03.2023 11:16:10 +00:00 |
| True.Fiction.2019.1080p.WEBRip.x264-RARBG.srt |
72.046 |
27.03.2023 14:16:10 +00:00 |
| true.history.of.the.kelly.gang.(8175579).nfo |
6.354 |
20.08.2021 23:00:32 +00:00 |
| true.history.of.the.kelly.gang.(9276827).nfo |
6.354 |
19.10.2022 07:53:18 +00:00 |
| True.History.of.the.Kelly.Gang.2019.720p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
112.302 |
19.10.2022 10:53:19 +00:00 |
| True.History.of.the.Kelly.Gang.2019.HDR.2160p.WEB.H265-PETRiFiED.srt |
116.982 |
21.08.2021 01:59:33 +00:00 |
| true.north.(9211012).nfo |
6.437 |
22.01.2023 01:32:02 +00:00 |
| Turkish.tur.srt |
50.748 |
15.09.2021 20:29:43 +00:00 |
| turner.risk.(8240601).nfo |
6.520 |
18.08.2021 14:12:46 +00:00 |
| Turner.Risk.2019.HDRip.XviD.AC3-EVO.srt |
100.496 |
18.08.2021 17:12:04 +00:00 |
| turnt.(8155274).nfo |
6.354 |
9.09.2021 16:28:14 +00:00 |
| Turnt.2020.1080p.WEBRip.x264-RARBG_English.srt |
142.762 |
9.09.2021 19:27:58 +00:00 |
| turu.the.wacky.hen.(8282077).nfo |
6.437 |
15.09.2021 17:31:48 +00:00 |
| Turu.the.Wacky.Hen.2019.SPANISH.1080p.WEBRip.x264-VXT.srt |
65.976 |
15.09.2021 20:30:49 +00:00 |
| tuscaloosa.(8125890).nfo |
6.354 |
4.09.2021 05:18:14 +00:00 |
| Tuscaloosa.2019.1080p.WEBRip.x264-RARBG.es.srt |
107.186 |
4.09.2021 08:17:35 +00:00 |
| Two.Of.Us.2020.720p.WEBRip.x264.AAC-[YTS.MX].srt |
17.065 |
20.09.2021 14:39:03 +00:00 |
| two.one.(8098044).nfo |
6.437 |
18.09.2021 01:12:22 +00:00 |
| Two.One.2019.720p.WEBRip.x264.AAC-[YTS.MX].srt |
67.964 |
18.09.2021 04:12:09 +00:00 |
| unbound.(8302600).nfo |
6.520 |
16.09.2021 19:56:22 +00:00 |
| Unbound.2020.HDRip.XviD.AC3-EVO.srt |
98.042 |
16.09.2021 22:56:18 +00:00 |
| uncle.peckerhead.(8313414).nfo |
6.520 |
25.08.2021 17:51:44 +00:00 |
| Uncle.Peckerhead.2020.HDRip.XviD.AC3-EVO.srt |
78.877 |
25.08.2021 20:51:11 +00:00 |
| uncorked.(8146853).nfo |
6.354 |
6.09.2021 15:53:50 +00:00 |
| Uncorked.2020.srt |
92.080 |
6.09.2021 18:52:55 +00:00 |
| under.the.riccione.sun.(8263725).nfo |
6.437 |
1.09.2021 11:40:58 +00:00 |
| Under.the.Riccione.Sun.2020.720p.WEB.H264-CRYPTIC.srt |
100.822 |
1.09.2021 14:40:40 +00:00 |
| underwater.(8145044).nfo |
6.437 |
3.09.2021 02:27:58 +00:00 |
| Underwater.2020.1080p.HDRip.X264.AC3-EVO.srt |
78.431 |
3.09.2021 05:27:28 +00:00 |
| unknown.origins.(8331013).nfo |
6.188 |
18.08.2021 03:42:22 +00:00 |
| Unknown.Origins.2020.720p.NF.WEB-DL.DDP5.1.x264-NTG_Turkish.srt |
120.673 |
18.08.2021 06:41:43 +00:00 |
| Upside-Down.Magic.2020.1080p.WEBRip.DD5.1.x264-CM.srt |
89.264 |
22.09.2023 02:33:33 +00:00 |
| Upside-Down.Magic.2020.WEB-DL.DSNP.srt |
91.345 |
20.07.2022 10:40:10 +00:00 |
| upside.down.magic.(8304634).nfo |
6.437 |
28.08.2021 12:58:12 +00:00 |
| upside.down.magic.(8316220).nfo |
6.520 |
21.09.2023 23:33:32 +00:00 |
| upside.down.magic.(9169961).nfo |
6.354 |
20.07.2022 07:40:10 +00:00 |
| Upside.Down.Magic.2020.Disney.720p.HDTV.X264.Solar.srt |
85.460 |
28.08.2021 15:57:20 +00:00 |
| uri.the.surgical.strike.(7977480).nfo |
6.354 |
21.09.2021 15:04:22 +00:00 |
| Uri.The.Surgical.Strike.2019.720p.1080p.BluRay.Remux.AVC.DTS-HD.MA 5.1-ALiEN.Ganool.srt |
74.565 |
21.09.2021 18:03:42 +00:00 |
| urzila.carlson.overqualified.(8284563).nfo |
6.271 |
20.09.2021 11:39:08 +00:00 |
| Urzila.Carlson.Overqualified.Loser.2020.WEBRip.XviD.MP3-XVID.srt |
86.388 |
20.09.2021 14:38:37 +00:00 |
| use.me.(8019408).nfo |
6.271 |
26.09.2021 05:43:50 +00:00 |
| Use.Me.2019.1080p.WEBRip.x264-RARBG.srt |
88.107 |
26.09.2021 08:43:36 +00:00 |
| useless.humans.(8284227).nfo |
6.354 |
18.09.2021 15:47:20 +00:00 |
| Useless.Humans.2020.HDRip.XviD.AC3-EVO.srt |
90.438 |
18.09.2021 18:47:02 +00:00 |
| Ut Og Stjaele Hester 2019 NORWEGiAN BDRip x264-WASTE.srt |
40.453 |
16.03.2023 01:21:11 +00:00 |
| Ut.Og.Stjaele.Hester.2019.1080p.BluRay.x264-GRUNDiG.srt |
36.544 |
25.09.2021 18:13:15 +00:00 |
| V.2020.720p.AMZN.WEB-DL.DDP5.1.H.264-ABM.srt |
78.799 |
1.09.2021 14:41:13 +00:00 |
| Valley Of The Gods 2019.srt |
42.099 |
24.09.2021 14:41:24 +00:00 |
| valley.girl.(8202030).nfo |
6.285 |
18.08.2021 06:35:03 +00:00 |
| Valley.Girl.2020.HDRip.XviD.AC3-EVO.srt |
111.544 |
18.08.2021 06:34:51 +00:00 |
| valley.of.the.gods.(8383479).nfo |
6.354 |
24.09.2021 11:41:24 +00:00 |
| Vampire Burt's Serenade 2020_ENG.srt |
92.257 |
26.11.2021 17:10:35 +00:00 |
| vampire.burt.s.serenade.(8622275).nfo |
6.271 |
26.11.2021 14:11:26 +00:00 |
| variant.(8237605).nfo |
6.437 |
1.09.2021 11:41:32 +00:00 |
| vault.(7800196).nfo |
6.520 |
23.07.2023 20:18:38 +00:00 |
| Vault.2019.HDRip.XviD.AC3-EVO.srt |
87.118 |
23.07.2023 23:18:38 +00:00 |
| vhyes.(8116364).nfo |
6.271 |
29.08.2021 19:27:30 +00:00 |
| VHYes.2019.1080p.WEBRip.x264-RARBG_English.srt |
103.465 |
29.08.2021 22:27:30 +00:00 |
| Victoria.Gotti.My.Father's.Daughter.2019.1080p.WEBRip.x264-.YTS.AM.srt |
116.915 |
24.09.2021 00:52:48 +00:00 |
| victoria.gotti.my.father.s.(7738482).nfo |
6.271 |
23.09.2021 21:53:44 +00:00 |
| viena.and.the.fantomes.(8384469).nfo |
6.271 |
29.08.2021 19:28:22 +00:00 |
| Viena.and.the.Fantomes.2020.1080p.WEBRip.x265-RARBG.srt |
48.862 |
29.08.2021 22:28:22 +00:00 |
| villain.(8215302).nfo |
6.520 |
28.08.2021 12:59:28 +00:00 |
| villain.(9082291).nfo |
6.437 |
10.05.2022 14:08:10 +00:00 |
| Villain.2020.720p.WEBRip.x264.AAC-YTS.MX-HI.srt |
94.905 |
28.08.2021 15:58:36 +00:00 |
| Villain.2020.WEBRip.srt |
89.902 |
10.05.2022 17:08:10 +00:00 |
| villains.(8016984).nfo |
6.520 |
22.09.2021 04:49:12 +00:00 |
| Villains.2019.AMZN.WEB-DL.AAC2.0.H.264-NTG.srt |
94.352 |
22.09.2021 07:48:28 +00:00 |
| Virginia Minnesota 2019 1080p WEB-DL H264 AC3-EVO.srt |
124.990 |
20.08.2023 16:13:16 +00:00 |
| virginia.minnesota.(7717963).nfo |
6.271 |
20.08.2023 13:13:16 +00:00 |
| waiting.for.anya.(8627418).nfo |
6.271 |
13.09.2021 05:17:42 +00:00 |
| Waiting.For.Anya.2020.720p.WEBRip.x264.AAC-[YTS.MX]-TR.srt |
84.239 |
13.09.2021 08:17:01 +00:00 |
| waiting.for.the.barbarians.(8330870).nfo |
6.437 |
11.09.2021 02:03:16 +00:00 |
| Waiting.for.the.Barbarians.2020.1080p.WEB-DL.DDP5.1.H.264-CMRG.srt |
55.924 |
11.09.2021 05:02:50 +00:00 |
| walkaway.joe.(8444275).nfo |
6.354 |
9.09.2021 16:28:12 +00:00 |
| Walkaway.Joe.2020.1080p.WEB-DL.H264.AC3-EVO.srt |
52.606 |
9.09.2021 19:27:55 +00:00 |
| Warning.Do.Play.2019.KOREAN.ENSUBBED.1080p.AMZN.WEBRip.DDP2.0.x264-NTG.srt |
33.303 |
9.07.2023 00:48:50 +00:00 |
| warpath.(8256391).nfo |
6.354 |
6.09.2021 15:53:18 +00:00 |
| Warpath.2020.HDRip.XviD.AC3-EVO.srt |
77.141 |
6.09.2021 18:52:22 +00:00 |
| wasp.network.(8252322).nfo |
6.437 |
2.09.2021 01:35:48 +00:00 |
| Wasp.Network.2019.720p.WEB.H264-SECRECY.srt |
116.094 |
2.09.2021 04:35:26 +00:00 |
| waves.(8172381).nfo |
6.354 |
25.09.2021 00:53:16 +00:00 |
| waves.(8320203).nfo |
6.354 |
21.09.2021 01:53:58 +00:00 |
| Waves.2019.1080p.BluRay.H264.AAC-RARBG.srt |
120.338 |
25.09.2021 03:53:11 +00:00 |
| we.are.freestyle.love.supreme.(8291169).nfo |
6.271 |
3.09.2021 15:03:56 +00:00 |
| We.Are.Freestyle.Love.Supreme.2020.1080p.WEBRip.x264-RARBG.srt |
155.934 |
3.09.2021 18:03:22 +00:00 |
| we.are.one.(8284942).nfo |
6.271 |
19.09.2021 20:28:34 +00:00 |
| We.Are.One.2020.720p.WEBRip.x264.srt |
88.157 |
19.09.2021 23:28:07 +00:00 |
| we.bare.bears.the.movie.(8242490).nfo |
6.437 |
16.09.2021 19:54:18 +00:00 |
| We.Bare.Bears.The.Movie.2020.1080p.WEBRip.x265-RARBG.srt |
94.566 |
16.09.2021 22:54:15 +00:00 |
| we.die.young.(7672855).nfo |
6.520 |
20.08.2023 17:17:16 +00:00 |
| we.die.young.(9983991).nfo |
6.354 |
20.04.2024 12:52:22 +00:00 |
| We.Die.Young.2019.720p.BluRay.x264-tr.srt |
74.376 |
20.04.2024 15:52:23 +00:00 |
| We.Die.Young.2019.HDRip.AC3.X264-CMRG.srt |
69.067 |
20.08.2023 20:17:17 +00:00 |
| we.go.in.at.dawn.(8176934).nfo |
6.437 |
5.09.2021 19:53:24 +00:00 |
| We.Go.In.At.DAWN.2020.720p.WEBRip.x264.AAC-YTS.MX.srt |
56.636 |
5.09.2021 22:52:34 +00:00 |
| we.have.always.lived.in.the.(7763830).nfo |
6.520 |
6.03.2023 10:27:28 +00:00 |
| we.have.always.lived.in.the.(7846006).nfo |
6.437 |
24.09.2021 11:41:34 +00:00 |
| We.Have.Always.Lived.in.the.Castle.2018.1080p.WEB-DL.DD5.1.H264-CMRG.srt |
73.522 |
6.03.2023 13:27:28 +00:00 |
| We.Have.Always.Lived.In.The.Castle.2018.720p.WEBRip.x264-.YTS.AM.srt |
75.250 |
24.09.2021 14:41:33 +00:00 |
| wendy.(8351212).nfo |
6.354 |
20.09.2021 11:39:18 +00:00 |
| Wendy.2020.1080p.AMZN.WEB-DL.DDP5.1.H.264.srt |
54.106 |
20.09.2021 14:38:47 +00:00 |
| what.the.night.can.do.(8327818).nfo |
6.520 |
19.09.2021 06:07:18 +00:00 |
| What.the.Night.Can.Do.2020.HDRip.XViD.AC3-EVO-HI.srt |
100.302 |
19.09.2021 09:06:56 +00:00 |
| what.we.found.(8307643).nfo |
6.354 |
5.09.2021 19:53:12 +00:00 |
| What.We.Found.2020.1080p.WEB-DL.DD5.1.H264-CMRG.srt |
105.601 |
5.09.2021 22:52:22 +00:00 |
| what.you.gonna.do.when.the.world.(8267854).nfo |
6.271 |
21.09.2021 15:04:48 +00:00 |
| what.you.gonna.do.when.the.world.(9009150).nfo |
6.354 |
24.01.2023 13:17:14 +00:00 |
| What.You.Gonna.Do.When.The.Worlds.On.Fire.2018.1080p.WEBRip.x265-RARBG.srt |
147.137 |
24.01.2023 16:17:14 +00:00 |
| What.You.Gonna.Do.When.The.Worlds.On.Fire.2018.WEBRip.x264-ION10.srt |
182.909 |
21.09.2021 18:04:08 +00:00 |
| where.s.my.roy.cohn.(8609927).nfo |
6.354 |
26.03.2023 18:42:10 +00:00 |
| where.sleeping.dogs.lie.(8273882).nfo |
6.354 |
21.09.2021 15:03:56 +00:00 |
| Where.Sleeping.Dogs.Lie.2020.1080p.WEB-DL.H264.AC3-EVO.srt |
79.132 |
21.09.2021 18:03:16 +00:00 |
| where.we.belong.(7901260).nfo |
6.437 |
21.09.2021 15:03:32 +00:00 |
| Where.We.Belong.2019.1080p.WEB-DL.x264-aLD3N.srt |
63.480 |
21.09.2021 18:02:52 +00:00 |
| Wheres.My.Roy.Cohn.2019.720p.BluRay.x264-CADAVER.srt |
117.339 |
26.03.2023 21:42:10 +00:00 |
| Wild Rose 2018 1080p BluRay REMUX AVC DTS-HD MA 5 1-FGT.srt |
97.608 |
24.09.2021 00:51:37 +00:00 |
| wild.nights.with.emily.(8265492).nfo |
6.437 |
22.09.2021 18:48:22 +00:00 |
| Wild.Nights.With.Emily.2019.1080p.WEB-DL.H264.AC3-EVO.srt |
75.641 |
22.09.2021 21:47:33 +00:00 |
| wild.rose.(8098287).nfo |
6.271 |
23.09.2021 21:52:34 +00:00 |
| will.reading.(8332520).nfo |
6.437 |
2.09.2021 13:53:04 +00:00 |
| Will.Reading.2020.1080p.AMZN.WEB-DL.DDP5.1.H.264-iKA.srt |
91.694 |
2.09.2021 16:52:36 +00:00 |
| wingman.(8297598).nfo |
6.437 |
9.09.2021 16:28:04 +00:00 |
| WingMan.2020.1080p.WEBRip.x264-RARBG.srt |
88.527 |
9.09.2021 19:27:47 +00:00 |
| wizards.spellbound.(8310267).nfo |
6.354 |
2.04.2024 18:08:22 +00:00 |
| Wizards.Tales.of.Arcadia.S01E01.srt |
22.978 |
2.04.2024 18:08:22 +00:00 |
| Wonders.in.the.Suburbs.2019.FRENCH.1080p.WEBRip.x265-VXT.srt |
101.488 |
21.08.2021 10:25:39 +00:00 |
| work.it.(8310047).nfo |
6.520 |
11.09.2021 11:53:44 +00:00 |
| Work.It.2020.720p.WEB.H264-SECRECY.srt |
97.044 |
11.09.2021 14:53:14 +00:00 |
| working.man.(8198243).nfo |
6.437 |
18.09.2021 15:47:44 +00:00 |
| Working.Man.2020.HDRip.XviD.AC3-EVO.srt |
78.852 |
18.09.2021 18:47:27 +00:00 |
| ya.no.estoy.aqui.(8268167).nfo |
6.271 |
24.09.2021 11:41:14 +00:00 |
| Yaara (2020) Hindi - x264 - AAC - WEB - HDRip - ESub.srt |
107.002 |
10.09.2020 15:24:44 +00:00 |
| yi.lu.xiang.xi.(4759188).nfo |
6.354 |
14.02.2022 16:17:32 +00:00 |
| you.cannot.kill.david.arquette.(8642739).nfo |
6.354 |
21.08.2021 03:41:36 +00:00 |
| you.cannot.kill.david.arquette.(9117554).nfo |
6.437 |
4.06.2022 13:18:00 +00:00 |
| You.Cannot.Kill.David.Arquette.2020.1080p.WEBRip.x265-RARBG.srt |
111.831 |
21.08.2021 06:41:37 +00:00 |
| You.Cannot.Kill.David.Arquette.2020.srt |
97.892 |
4.06.2022 16:18:01 +00:00 |
| you.re.not.alone.(8324945).nfo |
6.354 |
3.09.2021 15:04:08 +00:00 |
| you.should.have.left.(8256009).nfo |
6.354 |
25.08.2021 17:52:42 +00:00 |
| You.Should.Have.Left.2020.1080p.WEBRip.x265-RARBG.tr.srt |
71.776 |
25.08.2021 20:52:09 +00:00 |
| Youre.Not.Alone.2020.1080p.WEBRip.x264-RARBG.srt |
66.500 |
3.09.2021 18:03:33 +00:00 |
| Yours Sincerely Kanan Gill 2020.srt |
94.068 |
26.08.2021 01:24:17 +00:00 |
| yours.sincerely.kanan.gill.(8183827).nfo |
6.354 |
25.08.2021 22:24:52 +00:00 |
| Yusuf Hawkins.Storm.Over.Brooklyn.2020.WEBRip.x264-ION10.srt |
127.169 |
4.09.2021 14:57:19 +00:00 |
| yusuf.hawkins.storm.over.(8315366).nfo |
6.271 |
4.09.2021 11:58:00 +00:00 |
| yvonne.orji.momma.i.made.it.(8287562).nfo |
6.354 |
28.08.2021 12:58:26 +00:00 |
| Yvonne.Orji.Momma.I.Made.It.2020.1080p.WEBRip.x265-RARBG.srt |
84.933 |
28.08.2021 15:57:34 +00:00 |
| zerozerozero.en.el.mismo.camino.(8513556).nfo |
6.354 |
3.04.2024 07:48:50 +00:00 |
| zerozerozero.family.(8156412).nfo |
6.271 |
2.04.2024 18:26:00 +00:00 |
| zerozerozero.miranda.(8148267).nfo |
6.271 |
2.04.2024 20:50:02 +00:00 |
| ZeroZeroZero.S01E01.The.Shipment.720p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
31.885 |
28.03.2024 14:53:14 +00:00 |
| ZeroZeroZero.S01E02.Tampico.Skies.720p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
28.004 |
3.04.2024 11:23:24 +00:00 |
| ZeroZeroZero.S01E03.Miranda.720p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
21.085 |
2.04.2024 20:50:02 +00:00 |
| ZeroZeroZero.S01E04.Transshipment.720p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
22.784 |
2.04.2024 20:50:14 +00:00 |
| ZeroZeroZero.S01E05.Sharia.720p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
14.468 |
2.04.2024 18:24:16 +00:00 |
| ZeroZeroZero.S01E06.En.el.mismo.camino.720p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
31.685 |
3.04.2024 07:48:50 +00:00 |
| ZeroZeroZero.S01E07.Family.720p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
23.301 |
2.04.2024 18:26:00 +00:00 |
| ZeroZeroZero.S01E08.Same.Blood.720p.AMZN.WEB-DL.DDP5.1.H.264-NTG.srt |
10.622 |
3.04.2024 02:01:12 +00:00 |
| zerozerozero.same.blood.(8156476).nfo |
6.271 |
3.04.2024 02:01:12 +00:00 |
| zerozerozero.sharia.(8149936).nfo |
6.271 |
2.04.2024 18:24:16 +00:00 |
| zerozerozero.tampico.skies.(8230090).nfo |
6.354 |
3.04.2024 11:23:24 +00:00 |
| zerozerozero.the.shipment.(8129548).nfo |
6.271 |
28.03.2024 14:53:14 +00:00 |
| zerozerozero.transshipment.(8148344).nfo |
6.271 |
2.04.2024 20:50:14 +00:00 |
| zhang.sanfeng.2.tai.chi.master.(8332297).nfo |
6.437 |
9.09.2021 16:28:00 +00:00 |
| zoo.wars.2.(7847028).nfo |
6.437 |
9.07.2023 13:03:06 +00:00 |
| Zoo.Wars.2.2019.HDRip.XviD.AC3-EVO.srt |
116.567 |
9.07.2023 16:03:07 +00:00 |
| 爱情是啥样？What.Love.Looks.Like.2020.WEBRip.XviD.MP3-XVID.srt |
85.908 |
17.04.2021 22:56:06 +00:00 |